| Revision as of 13:04, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 21:01, 19 June 2020 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added FDA UNII |
| (10 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
|
{{More citations needed|date=December 2014}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 376216080 |
|
| verifiedrevid = 428747903 |
|
|ImageFile=little gastrin.png |
|
| ImageFile=little gastrin.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName= |
|
| IUPACName= |
|
|OtherNames=Gastrin I; Human gastrin I; pGlu-Gly-Pro-Trp-Leu-Glu-Glu-Glu-Glu-Glu-Ala-Tyr-Gly-Trp-Met-Asp-Phe-NH<sub>2</sub> |
|
| OtherNames=Gastrin I; Human gastrin I; pGlu-Gly-Pro-Trp-Leu-Glu-Glu-Glu-Glu-Glu-Ala-Tyr-Gly-Trp-Met-Asp-Phe-NH<sub>2</sub> |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 3559 |
| ⚫ |
| CASNo=10047-33-3 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem=16162108 |
|
|
⚫ |
| CASNo=10047-33-3 |
| ⚫ |
| SMILES= C(C(=O)N(CC1=CC=C(C=C1)O)C(=O)NCC(=O)N(CC2=CNC3=CC=CC=C32)C(=O)N(CCSC)C(=O)N(CC(=O)O)C(=O)N(CC4=CC=CC=C4)C(=O)N)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CC(C)C)NC(=O)(CC5=CNC6=CC=CC=C65)NC(=O)7CCCN7C(=O)CNC(=O)8CCC(=O)N8 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = L6G91DE14D |
|
⚫ |
| PubChem=16162108 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 75441 |
|
⚫ |
| SMILES= C(C(=O)N(CC1=CC=C(C=C1)O)C(=O)NCC(=O)N(CC2=CNC3=CC=CC=C32)C(=O)N(CCSC)C(=O)N(CC(=O)O)C(=O)N(CC4=CC=CC=C4)C(=O)N)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CCC(=O)O)NC(=O)(CC(C)C)NC(=O)(CC5=CNC6=CC=CC=C65)NC(=O)7CCCN7C(=O)CNC(=O)8CCC(=O)N8 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>97</sub>H<sub>124</sub>N<sub>20</sub>O<sub>31</sub>S |
|
| Formula=C<sub>97</sub>H<sub>124</sub>N<sub>20</sub>O<sub>31</sub>S |
|
| MolarMass=2098.20 g/mol |
|
| MolarMass=2098.20 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Little gastrin I''' is a form of commonly called as gastrin-17. This is a protein hormone, secreted by the intestine]. |
|
'''Little gastrin I''' is a form of ] commonly called as gastrin-17.<ref>{{Cite book|title = Gastrointestinal Hormones: Advances in Metabolic Disorders|url = https://books.google.com/books?id=d7_dAgAAQBAJ|publisher = Academic Press|date = 2013-10-22|isbn = 9781483215532|language = en|first = Viktor|last = Mutt}}</ref> This is a protein hormone, secreted by the intestine. |
|
|
|
|
|
|
'''Gastrin II''' has identical amino acid composition to '''Gastrin I''', the only difference is that the single tyrosine residue is sulfated in Gastrin II.<ref>{{Cite book|title = Gastrin|url = https://books.google.com/books?id=JUBsCIwSrEQC|publisher = University of California Press|date = 1966-01-01|language = en}}</ref> |
|
|
|
|
|
|
==References== |
| ⚫ |
{{biochem-stub}} |
|
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{biochem-stub}} |