Misplaced Pages

MBBA: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 10:24, 19 January 2012 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits added CSID, (std)InChI and (Std)InChIKey← Previous edit Latest revision as of 16:38, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,111 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat 
(19 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{ou}}
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 385876878 | verifiedrevid = 472035275
|ImageFile=MBBA.svg | ImageFile=MBBA cleaner.svg
|ImageSize=
| ImageAlt = Structural formula of MBBA
|IUPACName=
| ImageFile1 = MBBA molecule ball.png
|OtherNames=
| ImageSize1 = 240
| ImageAlt1 = Ball-and-stick model of the MBBA molecule
| PIN = ''N''-(4-Butylphenyl)-1-(4-methoxyphenyl)methanimine
| OtherNames =
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo=97402-82-9 | CASNo=26227-73-6
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem=33363
| UNII_Ref = {{fdacite|correct|FDA}}
| SMILES=CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC
| UNII = O69C41149Y
| ChemSpiderID = 30817
| PubChem=33363
| InChI = 1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+
| SMILES=CCCCC1=CC=C(C=C1)N=CC2=CC=C(C=C2)OC
| InChIKey = FEIWNULTQYHCDN-XMHGGMMEBZ
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| StdInChI = 1S/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+
| ChemSpiderID = 30817
| StdInChIKey = FEIWNULTQYHCDN-XMHGGMMESA-N
| InChI = 1/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+
| InChIKey = FEIWNULTQYHCDN-XMHGGMMEBZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H21NO/c1-3-4-5-15-6-10-17(11-7-15)19-14-16-8-12-18(20-2)13-9-16/h6-14H,3-5H2,1-2H3/b19-14+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FEIWNULTQYHCDN-XMHGGMMESA-N
}} }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| C = 18 | H = 21 | N = 1 | O = 1 | C=18 | H=21 | N=1 | O=1
| Appearance= | Appearance = Turbid yellow liquid
| Density = 1.027 g/mL at 25 °C<ref name="sigma">{{cite web|title=N-(4-Methoxybenzylidene)-4-butylaniline|url=http://www.sigmaaldrich.com/catalog/product/aldrich/158224?lang=en&region=US|website=sigmaaldrich.com|accessdate=12 February 2015}}</ref>
| Density=
| MeltingPt= | MeltingPt=
| BoilingPt= | BoilingPt=
| Solubility= | Solubility=
}} }}
|Section3={{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt = 113 °C (235 °F)<ref name="sigma" />
| FlashPt=
| AutoignitionPt=
| Autoignition=
| ExternalSDS =
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
}} }}
}} }}


'''''N''-(4-Methoxybenzylidene)-4-butylaniline''' ('''MBBA''') is an organic compound often used in ]s. '''''N''-(4-Methoxybenzylidene)-4-butylaniline''' ('''MBBA''') is an organic compound often used as a ].

==References==
{{reflist}}


==External links== ==External links==
Line 37: Line 55:
] ]
] ]
] ]