| Revision as of 10:45, 3 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 02:08, 22 August 2022 edit undoIra Leviton (talk | contribs)Extended confirmed users330,896 editsm Clean up duplicate template arguments using findargdups |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{About|the psychedelic drug|the instrument on the Perseverance rover|Mars Environmental Dynamics Analyzer}} |
|
|
{{one source|date=July 2019}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 444291686 |
|
| ImageFile = MEDA.png |
|
| ImageFile = MEDA.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 1-(8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
|
| PIN = 1-(8-Methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24034 |
|
| ChemSpiderID = 24034 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| InChI = 1/C4H11NS.ClH/c1-5(2)3-4-6;/h6H,3-4H2,1-2H3;1H |
|
|
|
| KEGG = D03376 |
|
| InChIKey = NRVFDGZJTPCULU-UHFFFAOYAB |
|
|
| StdInChI = 1S/C4H11NS.ClH/c1-5(2)3-4-6;/h6H,3-4H2,1-2H3;1H |
|
| InChI=1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
|
|
| InChIKey = HEYPARQBPGSFKW-UHFFFAOYSA-N |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
|
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 23693-25-6 |
|
| CASNo = 23693-25-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = T2DAA4TB22 |
|
| PubChem = 25798 |
|
| PubChem = 25798 |
|
| SMILES = Cl.SCCN(C)C |
|
| SMILES = NC(CC1=CC2=C(OCCO2)C(OC)=C1)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12 |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> |
|
|
|
| H=17 |
|
| MolarMass = 223.268 g/mol |
|
|
|
| N=1 |
|
|
| O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 22: |
Line 37: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''MEDA''', or '''3-]-4,5-]di]]''', is a lesser-known ]. MEDA was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown. MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA. |
|
'''MEDA''' ('''3-methoxy-4,5-ethylenedioxyamphetamine''') is a lesser-known ]. MEDA was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown.<ref></ref> MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA. |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 35: |
Line 50: |
|
* ] |
|
* ] |
|
|
|
|
|
== External links == |
|
== References == |
|
|
{{reflist}} |
|
* |
|
|
* |
|
|
|
|
|
|
|
] |
|
{{PiHKAL}} |
|
|
|
|
|
|
] |
|
|
|
|
|
|
{{Psychoactive-stub}} |
|
{{Psychoactive-stub}} |