| Revision as of 16:56, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:W← Previous edit |
Latest revision as of 02:08, 22 August 2022 edit undoIra Leviton (talk | contribs)Extended confirmed users330,828 editsm Clean up duplicate template arguments using findargdups |
| (19 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{About|the psychedelic drug|the instrument on the Perseverance rover|Mars Environmental Dynamics Analyzer}} |
|
|
{{one source|date=July 2019}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 415688021 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444291686 |
|
| ImageFile = MEDA.png |
|
| ImageFile = MEDA.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 1-(8-methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
|
| PIN = 1-(8-Methoxy-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24034 |
|
| ChemSpiderID = 24034 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03376 |
|
| KEGG = D03376 |
|
| InChI = 1/C4H11NS.ClH/c1-5(2)3-4-6;/h6H,3-4H2,1-2H3;1H |
|
| InChI=1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
|
| InChIKey = NRVFDGZJTPCULU-UHFFFAOYAB |
|
| InChIKey = HEYPARQBPGSFKW-UHFFFAOYSA-N |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C4H11NS.ClH/c1-5(2)3-4-6;/h6H,3-4H2,1-2H3;1H |
|
| StdInChI = 1S/C12H17NO3/c1-8(13)5-9-6-10(14-2)12-11(7-9)15-3-4-16-12/h6-8H,3-5,13H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
|
| StdInChIKey = NRVFDGZJTPCULU-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 23693-25-6 |
|
| CASNo = 23693-25-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = T2DAA4TB22 |
|
| PubChem = 25798 |
|
| PubChem = 25798 |
|
| SMILES = Cl.SCCN(C)C |
|
| SMILES = NC(CC1=CC2=C(OCCO2)C(OC)=C1)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12 |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> |
|
|
|
| H=17 |
|
| MolarMass = 223.268 g/mol |
|
|
|
| N=1 |
|
|
| O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 28: |
Line 37: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''MEDA''', or '''3-]-4,5-]di]]''', is a lesser-known ]. MEDA was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown. MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA. |
|
'''MEDA''' ('''3-methoxy-4,5-ethylenedioxyamphetamine''') is a lesser-known ]. MEDA was first synthesized by ]. In his book '']'', the minimum dosage is listed as 200 mg, and the duration unknown.<ref></ref> MEDA produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MEDA. |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 41: |
Line 50: |
|
* ] |
|
* ] |
|
|
|
|
|
== External links == |
|
== References == |
|
|
{{reflist}} |
|
* |
|
|
* |
|
|
|
|
|
|
|
] |
|
{{PiHKAL}} |
|
|
|
|
|
|
] |
|
|
|
|
|
|
{{Psychoactive-stub}} |
|
{{Psychoactive-stub}} |