| Revision as of 07:52, 18 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444147356 of page Mafosfamide for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 15:01, 30 March 2019 edit Zakblade2000 (talk | contribs)Extended confirmed users4,108 editsNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
⚫ |
| verifiedrevid = 477499263 |
| ⚫ |
| UNII = 5970HH9923 |
|
|
⚫ |
| ImageFile = Mafosfamide.svg |
| ⚫ |
| verifiedrevid = 442313396 |
|
|
⚫ |
| ImageSize = 175 |
| ⚫ |
|ImageFile=Mafosfamide.svg |
|
|
|
| ImageAlt = Skeletal formula |
| ⚫ |
|ImageSize= |
|
|
|
| ImageFile1 = Mafosfamide-3D-balls.png |
| ⚫ |
|IUPACName=2-{(2--2-oxido-1,3,2-oxazaphosphinan-4-yl}thio)ethanesulfonic acid |
|
|
|
| ImageSize1 = 230 |
| ⚫ |
|OtherNames=2-{-2-oxo-1-oxa-3-aza-2λ<sup>5</sup>-phosphacyclohex-4-yl}sulfanyl]ethanesulfonic acid |
|
|
|
| ImageAlt1 = Ball-and-stick model |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| IUPACName=2-<nowiki/>{(2--2-oxido-1,3,2-oxazaphosphinan-4-yl}thio)ethanesulfonic acid |
| ⚫ |
| InChI = 1/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 |
|
|
⚫ |
| OtherNames=2-<nowiki/>{-2-oxo-1-oxa-3-aza-2λ<sup>5</sup>-phosphacyclohex-4-yl}sulfanyl]ethanesulfonic acid |
|
|
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
⚫ |
| InChI = 1/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 |
|
| InChIKey = PBUUPFTVAPUWDE-AYLIAGHABO |
|
| InChIKey = PBUUPFTVAPUWDE-AYLIAGHABO |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 15: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PBUUPFTVAPUWDE-AYLIAGHASA-N |
|
| StdInChIKey = PBUUPFTVAPUWDE-AYLIAGHASA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 88859-04-5 --> |
|
| CASNo = 88859-04-5 |
|
| PubChem=104746 |
|
| PubChem = 104746 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=16736958 |
|
| ChemSpiderID = 16736958 |
|
| SMILES = O=P1(N(CCO1)SCCS(O)(=O)=O)N(CCCl)CCCl |
|
| SMILES = O=P1(N(CCO1)SCCS(O)(=O)=O)N(CCCl)CCCl |
|
| MeSHName=Mafosfamide |
|
| MeSHName = Mafosfamide |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 5970HH9923 |
|
}} |
|
}} |
|
|
|
|
|Section2= {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula=C<sub>9</sub>H<sub>19</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>5</sub>PS<sub>2</sub> |
|
| Formula = C<sub>9</sub>H<sub>19</sub>Cl<sub>2</sub>N<sub>2</sub>O<sub>5</sub>PS<sub>2</sub> |
|
| MolarMass=401.269 g/mol |
|
| MolarMass = 401.269 g/mol |
|
| Appearance= |
|
|
|
| Appearance = |
|
| Density= |
|
|
|
| Density = |
|
| MeltingPt= |
|
|
|
| MeltingPt = |
|
| BoilingPt= |
|
|
|
| BoilingPt = |
|
| Solubility= |
|
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
|
|Section3= {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards= |
|
|
|
| MainHazards = |
|
| FlashPt= |
|
|
|
| FlashPt = |
|
| Autoignition= |
|
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Mafosfamide''' (]) is an oxazaphosphorine (]-like) ] under investigation as a ]. It is metabolized by ] into ], which is then converted into ], which, in turn yields the ] ]s ] and ].<ref> Ludeman SM. The chemistry of the metabolites of cyclophosphamide. Curr Pharm Des. 1999 Aug;5(8):627-43. {{PMID|10469895}}</ref> |
|
|
|
|
|
Several ] ] have been completed.<ref>{{cite web | url = http://www.clinicaltrials.gov/ct/show/NCT00062881?order=1 | title = Intrathecal Mafosfamide | accessdate = 2007-07-13 | date = August 21, 2006 | publisher = U.S. ] | work = ClinicalTrials.gov}} ClinicalTrials.gov Identifier NCT00062881.</ref><ref>{{cite web | url =http://www.clinicaltrials.gov/ct/show/NCT00031928?order=2 | title = Mafosfamide in Treating Patients With Progressive or Refractory Meningeal Tumors | accessdate = 2007-07-13 | date = February 20, 2007 | publisher = U.S. ] | work = ClinicalTrials.gov}} ClinicalTrials.gov Identifier NCT00031928.</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |