Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 10:56, 17 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo← Previous edit		Latest revision as of 00:19, 4 August 2023 edit undo2405:4802:1f91:7e70:cdbe:480:c59:9e2a (talk)No edit summary
(32 intermediate revisions by 23 users not shown)
Line 1:		Line 1:
	{{chembox		{{Chembox
			| Watchedfields = changed
	| verifiedrevid = 443935362		| verifiedrevid = 450950432
	|ImageFile=Mannose-6-phosphate.svg		| ImageFile = Mannose-6-phosphate.svg
	|ImageSize=		| ImageSize =
	|IUPACName=
			| IUPACName =6-''O''-Phosphono-<small>D</small>-mannopyranose
	|OtherNames=		| OtherNames =
	|Section1= {{Chembox Identifiers		|Section1={{Chembox Identifiers
⚫	| CASNo=3672-15-9
		⚫	| CASNo_Ref = {{cascite|correct|??}}
⚫	| PubChem=65127
		⚫	| CASNo = 3672-15-9
⚫	| ChEBI_Ref = {{ebicite|correct|EBI}}
		⚫	| UNII_Ref = {{fdacite|correct|FDA}}
			| UNII = U2S53JF879
		⚫	| PubChem = 65127
			| ChEBI_Ref = {{ebicite|correct|EBI}}
	| ChEBI = 48066		| ChEBI = 48066
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = NBSCHQHZLSJFNQ-QTVWNMPRSA-N		| StdInChIKey = NBSCHQHZLSJFNQ-QTVWNMPRSA-N
	| SMILES=C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O		| SMILES = C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O
	| MeSHName=mannose-6-phosphate		| MeSHName = mannose-6-phosphate
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
	| ChemSpiderID = 58636		| ChemSpiderID = 58636
	| ChemSpiderID_Comment = Unspecified anomers		| ChemSpiderID_Comment = Unspecified anomers
		⚫	| SMILES2 = O=P(O)(O)OC1OC(O)(O)(O)1O
⚫	| ChEBI_Ref = {{ebicite|correct|EBI}}
		⚫	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
	| ChEBI = 48066
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = NBSCHQHZLSJFNQ-QTVWNMPRSA-N
⚫	| SMILES = O=P(O)(O)OC1OC(O)(O)(O)1O
⚫	| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChI = 1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6?/m1/s1		| StdInChI = 1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6?/m1/s1
	| ChemSpiderID1 = 394282		| ChemSpiderID1 = 394282
	| ChemSpiderID1_Comment = alpha anomer		| ChemSpiderID1_Comment = alpha anomer
	| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
	| ChemSpiderID2 = 388338		| ChemSpiderID2 = 388338
	| ChemSpiderID2_Comment = beta anomer		| ChemSpiderID2_Comment = beta anomer
	| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}
	}}		}}
	|Section2= {{Chembox Properties		|Section2={{Chembox Properties
	| Formula=C<sub>6</sub>H<sub>13</sub>O<sub>9</sub>P		| Formula = C<sub>6</sub>H<sub>13</sub>O<sub>9</sub>P
	| MolarMass=260.136 g/mol		| MolarMass = 260.136 g/mol
	| Appearance=		| Appearance =
	| Density=		| Density =
	| MeltingPt=		| MeltingPt =
	| BoilingPt=		| BoilingPt =
	| Solubility=		| Solubility =
	}}		}}
	|Section3= {{Chembox Hazards		|Section3={{Chembox Hazards
	| MainHazards=		| MainHazards =
	| FlashPt=		| FlashPt =
			| AutoignitionPt =
	| Autoignition=
	}}		}}
	}}		}}
	'''Mannose-6-phosphate''' (M6P) is a molecule bound by ] in the ]. M6P is converted to ] by ].		'''Mannose-6-phosphate''' ('''M6P''') is a molecule bound by ] in the ]. M6P is converted to ] by ].
	M6P is a targeting signal for ] ] that are destined for transport to ]s. The M6P tag is added to such proteins in the ''cis''-]. Specifically, in a reaction involving ] (UDP) and ], the enzyme UDP-N-acetylglucosamine:N-acetylglucosaminyl-1-phosphotransferase catalyzes the ''N''-linked ] of ] residues with M6P. Once appropriately marked with the M6P targeting signal, these proteins are moved to the ''trans''-Golgi. There, the M6P ] is recognized by ] (MPR) proteins.		M6P is a key targeting signal for ] ] that are destined for transport to ]s. The M6P tag is added to such proteins in the ''cis''-]. Specifically, in a reaction involving ] (UDP) and ], the enzyme ] catalyzes the ] of ] residues with M6P. Once appropriately marked with the M6P targeting signal, these proteins are moved to the ''trans''-Golgi network. There, the M6P ] is recognized and bound by ] (MPR) proteins at pH 6.5–6.7.<ref name=Alberts>{{cite book|last=Alberts|first=Bruce|title=Molecular biology of the cell|year=2002|publisher=Garland Science|location=New York|isbn=978-0-8153-3218-3|edition=4th|display-authors=etal}}</ref>
			The M6P-tagged lysosomal enzymes are shipped to the late ] via vesicular transport.<ref name=Alberts /> ] (ERT) for several ] relies on this pathway to efficiently direct synthetic enzymes to the lysosome where each can metabolize its particular substrate.<ref name = Coutinho>{{cite journal |title= Mannose-6-phosphate pathway: A review on its role in lysosomal function and dysfunction|last1=Coutinho|first1= MF|last2=Prata|first2=MJ|date=2011-12-15|doi=10.1016/j.ymgme.2011.12.012 |pmid= 22266136|publisher=Elsevier|volume=105|issue= 4|journal=Molecular Genetics and Metabolism|pages=542–550}}</ref> The pH in the late endosome can reach 6.0, which causes dissociation of M6P from its receptor.<ref name=Alberts /> Upon release, the enzymes are ferried to their final destination in the lysosomes.<ref name=Alberts /> The MPRs are packed into vesicles that bud off the late endosome and return to the ''trans''-Golgi network.<ref name=Alberts /> In this way, the MPRs can be recycled.
	The MPRs traffic in ] to the lysosome via an ].
	==See also==		==See also==
⚫	* ]
⚫	* ]
	* ]		* ]
		⚫	* ]
		⚫	* ]
	* ]		* ]
			==References==
			<references />
	==External links==		==External links==
	* {{MeshName|Mannose-6-Phosphate+Receptor}}		* {{MeshName|Mannose-6-Phosphate+Receptor}}
	*		*
		⚫	{{Fructose and galactose metabolic intermediates}}
	]		]
	]		]
	{{biochem-stub}}
⚫	{{Fructose and galactose metabolic intermediates}}
	]
	]
	]