| Revision as of 11:34, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 00:42, 20 July 2023 edit undo2405:4802:1d22:1a90:7882:ac94:3471:4873 (talk)No edit summary |
| (9 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 325652204 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Reference=<ref>Chemical structure from: {{cite journal | title = Versatile building blocks from disaccharides: glycosylated 5-hydroxymethylfurfurals | author = Dierk Martin and Frieder W. Lichtenthaler | journal = Tetrahedron: Asymmetry | volume = 17 | year = 2006 | pages = 756–762 | doi = 10.1016/j.tetasy.2005.12.010}}</ref> |
|
|
⚫ |
| verifiedrevid = 424841558 |
|
⚫ |
| Reference=<ref>Chemical structure from: {{cite journal | title = Versatile building blocks from disaccharides: glycosylated ] | author = Dierk Martin and Frieder W. Lichtenthaler | journal = Tetrahedron: Asymmetry | volume = 17 | year = 2006 | issue = 5 | pages = 756–762 | doi = 10.1016/j.tetasy.2005.12.010}}</ref> |
|
| ImageFile = Melibiulose.png |
|
| ImageFile = Melibiulose.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| IUPACName = 6-''O''-α-<small>D</small>-Galactopyranosyl-<small>D</small>-fructofuranose |
|
| IUPACName = |
|
|
| OtherNames = 6-''O''-(β-<small>D</small>-Galactopyranosyl)-<small>D</small>-fructofuranose; 6-''O''-α-<small>D</small>-galactopyranosyl-<small>D</small>-fructose |
|
| OtherNames = 6-''O''-α-<small>D</small>-galactopyranosyl-<small>D</small>-fructose |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 111188-56-8 |
|
| CASNo = 111188-56-8 |
|
| PubChem = |
|
| PubChem = 11602584 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| SMILES = O1(CO)O(OC2(O)(O)C(O)(CO)O2)(O)1O |
|
|
|
| ChemSpiderID = 9777340 |
| ⚫ |
}} |
|
|
⚫ |
| SMILES = O1(O)(OC1(O)CO)CO2O(CO)(O)(O)2O |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| InChI = 1/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6+,7-,8+,9-,10+,11+,12?/m1/s1 |
|
| C=12 | H=22 | O=11 |
|
|
|
| InChIKey = PVXPPJIGRGXGCY-XIOYNQKVBL |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6+,7-,8+,9-,10+,11+,12?/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PVXPPJIGRGXGCY-XIOYNQKVSA-N |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
|
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> |
|
|
| MolarMass = 342.297 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition = }} |
|
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Melibiulose''' is a ] formed from ] and ] similar to ] |
|
'''Melibiulose''' is a ] formed from ] and ] similar to ]. |
|
|
|
|
|
==References== |
|
==References== |