| Revision as of 15:20, 24 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 20:39, 21 February 2023 edit undoMarbletan (talk | contribs)Extended confirmed users5,415 edits move reference from external links section to inline |
| (15 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 400298374 |
|
| verifiedrevid = 415699350 |
|
| ImageFile = Meta-DOT.png |
|
| ImageFile = Meta-DOT.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 1-propan-2-amine |
|
| PIN = 1-propan-2-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 127832 |
|
| ChemSpiderID = 127832 |
|
| InChI = 1/C12H19NO2S/c1-8(13)5-9-6-12(16-4)11(15-3)7-10(9)14-2/h6-8H,5,13H2,1-4H3 |
|
| InChI = 1/C12H19NO2S/c1-8(13)5-9-6-12(16-4)11(15-3)7-10(9)14-2/h6-8H,5,13H2,1-4H3 |
|
| InChIKey = BEMIKIUJWHLJTP-UHFFFAOYAK |
|
| InChIKey = BEMIKIUJWHLJTP-UHFFFAOYAK |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 31787 |
|
| ChEMBL = 31787 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 15: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BEMIKIUJWHLJTP-UHFFFAOYSA-N |
|
| StdInChIKey = BEMIKIUJWHLJTP-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 79440-52-1 |
|
| CASNo = 79440-52-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8A89CW1FXK |
|
| PubChem = 144891 |
|
| PubChem = 144891 |
|
| SMILES = O(c1cc(OC)c(cc1SC)CC(N)C)C |
|
| SMILES = O(c1cc(OC)c(cc1SC)CC(N)C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 12 | H = 19 | N = 1 | O = 2 | S = 1 |
|
| Formula = C<sub>12</sub>H<sub>19</sub>NO<sub>2</sub>S |
|
|
| MolarMass = 241.350 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 27: |
Line 30: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Meta-DOT''', or '''5-]]-2,4-di]]''', is a lesser-known ]. It is similar in structure to ]. Meta-DOT was first synthesized by ]. In his book '']'', the minimum dosage is listed as 35 mg, and the duration unknown. Meta-DOT produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Meta-DOT. |
|
'''Meta-DOT''', or '''5-methylthio-2,4-dimethoxyamphetamine''', is a lesser-known ]. It is similar in structure to ]. Meta-DOT was first synthesized by ]. In his book '']'', the minimum dosage is listed as 35 mg, and the duration unknown.<ref>{{cite web | url = http://www.erowid.org/library/books_online/pihkal/pihkal125.shtml | title = PiHKAL | author = Alexander Shulgin }}</ref> Meta-DOT produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Meta-DOT. |
|
|
|
|
|
== See also == |
|
== See also == |
|
|
* ] |
|
|
|
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== External links == |
|
== References == |
|
|
{{reflist}} |
|
* |
|
|
* |
|
|
|
|
|
|
|
] |
|
{{PiHKAL}} |
|
|
⚫ |
] |
|
|
|
|
|
] |
|
| ⚫ |
] |
|
|
|
|
|
|
{{Psychoactive-stub}} |
|
{{Psychoactive-stub}} |