| Revision as of 11:49, 3 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,071 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 15:09, 16 January 2025 edit undoOzzie10aaaa (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers214,204 editsm Cleaned up using AutoEdTag: ProveIt edit |
| (47 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Distinguish|Meticillin|Meclocycline}} |
| ⚫ |
| IUPAC_name =(2''Z'',4''S'',4a''R'',5''S'',5a''R'',12a''S'')-2--4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methylene-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2''H'',4''H'',5''H'')-trione |
|
|
|
{{Drugbox |
|
| image = methacycline.png |
|
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 400298582 |
|
⚫ |
| IUPAC_name = (2''Z'',4''S'',4a''R'',5''S'',5a''R'',12a''S'')-2--4-(dimethylamino)-5,10,11,12a-tetrahydroxy-6-methylene-4a,5a,6,12a-tetrahydrotetracene-1,3,12(2''H'',4''H'',5''H'')-trione |
|
|
| image = Metacycline.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|metacycline}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
⚫ |
| CAS_number = 914-00-1 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = AA05 |
|
|
| PubChem = 54675785 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10468596 |
|
| ChemSpiderID = 10468596 |
|
|
| NIAID_ChemDB = 001301 |
|
| InChI = 1/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| InChIKey = MHIGBKBJSQVXNH-IWVLMIASBA |
|
|
|
| UNII = IR235I7C5P |
| ⚫ |
| smiles = NC(=O)C=3C(=O)4(O)C(\O)=C2\C(=O)c1c(O)cccc1C(=C)2(O)4(N(C)C)C=3O |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 249837 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=22 | H=22 | N=2 | O=8 |
|
⚫ |
| SMILES = NC(=O)C=3C(=O)4(O)C(\O)=C2\C(=O)c1c(O)cccc1C(=C)2(O)4(N(C)C)C=3O |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
|
| StdInChI = 1S/C22H22N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-6,10,14-15,17,25,27-29,32H,1H2,2-3H3,(H2,23,31)/t10-,14-,15+,17+,22+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = MHIGBKBJSQVXNH-IWVLMIASSA-N |
|
| StdInChIKey = MHIGBKBJSQVXNH-IWVLMIASSA-N |
| ⚫ |
| CAS_number = |
|
| ⚫ |
| ATC_prefix = J01 |
|
| ⚫ |
| ATC_suffix = AA05 |
|
|
| PubChem = 5281054 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=22|H=22|N=2|O=8 |
|
|
| molecular_weight = 442.419 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Metacycline''' is a ]. |
|
'''Metacycline''' or '''methacycline''' is a ]. It is used as a ] in the industrial ] of ].{{cn|date=March 2023}} |
|
|
|
|
|
|
It has been found to act as an ] of the human ] ] and to induce ] ] '']''.<ref name="pmid20966043">{{Cite journal |vauthors=Shukla SJ, Sakamuru S, Huang R, Moeller TA, Shinn P, Vanleer D, Auld DS, Austin CP, Xia M |year=2011 |title=Identification of clinically used drugs that activate pregnane X receptors |url=http://dmd.aspetjournals.org/content/dmd/39/1/151.full.pdf?with-ds=yes |journal=Drug Metab. Dispos. |volume=39 |issue=1 |pages=151–9 |doi=10.1124/dmd.110.035105 |pmc=3014269 |pmid=20966043}}</ref> |
|
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
{{Xenobiotic-sensing receptor modulators}} |
|
{{TetracyclineAntiBiotics}} |
|
|
|
{{Tetracyclics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{Antibiotic-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|