| Revision as of 07:28, 11 June 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:Méthacrylyl-coenzyme A← Previous edit |
Latest revision as of 23:23, 4 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits fix mistake, add semisystematic name |
| (8 intermediate revisions by 7 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 265864628 |
|
| verifiedrevid = 433682385 |
|
|ImageFile=Methacrylyl-CoA.png |
|
| ImageFile=Methacrylyl-CoA.png |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|IUPACName= |
|
|
|
| IUPACName=3′-''O''-Phosphonoadenosine 5′-ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl dihydrogen phosphate] |
| ⚫ |
|OtherNames= |
|
|
|
| SystematicName=''O''<sup>1</sup>-<nowiki/>{methyl} ''O''<sup>3</sup>-ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=6008-91-9 |
|
| CASNo=6008-91-9 |
|
| PubChem=877 |
|
| PubChem = 165390 |
| ⚫ |
| SMILES=O1(OP(O)(O)=O)(COP(OP(OCC(C)(C)(O)C(NCCC(NCCSC(C(C)=C)=O)=O)=O)(O)=O)(O)=O)O1N2C(N=CN=C3N)=C3N=C2 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MeSHName=methacrylyl-coenzyme+A |
|
|
|
| ChemSpiderID = 144985 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C25H40N7O17P3S/c1-13(2)24(37)53-8-7-27-15(33)5-6-28-22(36)19(35)25(3,4)10-46-52(43,44)49-51(41,42)45-9-14-18(48-50(38,39)40)17(34)23(47-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-12,14,17-19,23,34-35H,1,5-10H2,2-4H3,(H,27,33)(H,28,36)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40)/t14-,17-,18-,19+,23-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NPALUEYCDZWBOV-NDZSKPAWSA-N |
|
⚫ |
| SMILES=O1(OP(O)(O)=O)(COP(OP(OCC(C)(C)(O)C(NCCC(NCCSC(C(C)=C)=O)=O)=O)(O)=O)(O)=O)O1N2C(N=CN=C3N)=C3N=C2 |
|
⚫ |
| MeSHName=methacrylyl-coenzyme+A |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>25</sub>H<sub>40</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| Formula=C<sub>25</sub>H<sub>40</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S |
|
| MolarMass=835.61 g/mol |
|
| MolarMass=835.61 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
| Line 31: |
Line 40: |
|
{{Amino acid metabolism intermediates}} |
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|