Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 11:19, 12 August 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 editsmNo edit summary← Previous edit		Latest revision as of 16:20, 12 December 2021 edit undoDePiep (talk | contribs)Extended confirmed users294,285 editsm GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr) | GHS_ref =<!-- no GHS data in PubChem Dec2021 -->Tag: AWB
(16 intermediate revisions by 13 users not shown)
Line 1:		Line 1:
	{{chembox		{{chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 426851207
			| Watchedfields = changed
		⚫	| verifiedrevid = 444423998
	| Name = Methyl hydroxychalcone		| Name = Methyl hydroxychalcone
	| ImageFile = Methyl hydroxychalcone.png		| ImageFile = Methyl hydroxychalcone.svg
	| ImageSize = 200px		| ImageSize = 200px
	| ImageName = Chemical structure of methyl hydroxychalcone		| ImageName = Chemical structure of methyl hydroxychalcone
	| ImageAlt = Chemical structure of methyl hydroxychalcone		| ImageAlt = Chemical structure of methyl hydroxychalcone
			| PIN = 3-Hydroxy-3′-methylchalcone
	| IUPACName = (E)-3-(3-hydroxyphenyl)-1-(3-methylphenyl)prop-2-en-1-one
	| OtherNames = MCHP<br>3'-Methyl-3-hydroxychalcone		| OtherNames = MCHP<br>3'-Methyl-3-hydroxychalcone
	|Section1= {{Chembox Identifiers		|Section1={{Chembox Identifiers
			| CASNo_Ref = {{cascite|correct|??}}
	| CASNo = 153976-41-1		| CASNo = 153976-41-1
	| CASNo_Ref =		| CASNoOther =
	| CASOther =
	| PubChem = 6440383		| PubChem = 6440383
	| SMILES = CC1=CC=CC(=C1)C(=O)C=CC2=CC(=CC=C2)O		| SMILES = CC1=CC=CC(=C1)C(=O)C=CC2=CC(=CC=C2)O
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
	| InChI =
			| ChemSpiderID = 4944650
			| InChI = 1/C16H14O2/c1-12-4-2-6-14(10-12)16(18)9-8-13-5-3-7-15(17)11-13/h2-11,17H,1H3/b9-8+
			| InChIKey = GPJXEEMHEDUKIP-CMDGGOBGBY
			| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChI = 1S/C16H14O2/c1-12-4-2-6-14(10-12)16(18)9-8-13-5-3-7-15(17)11-13/h2-11,17H,1H3/b9-8+
			| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChIKey = GPJXEEMHEDUKIP-CMDGGOBGSA-N
	| MeSHName =		| MeSHName =
	}}		}}
	|Section2= {{Chembox Properties		|Section2={{Chembox Properties
	| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>2</sub>		| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>2</sub>
	| MolarMass = 238.28 g/mol		| MolarMass = 238.28 g/mol
	| ExactMass = 238.09938 u
	| Appearance =		| Appearance =
	| Density =		| Density =
			| MeltingPtC =
	| MeltingPt = <!-- °C -->
			| BoilingPtC =
	| BoilingPt = <!-- °C -->
	| Solubility =		| Solubility =
	}}		}}
	| Section3 = {{Chembox Hazards		|Section3={{Chembox Hazards
	| MainHazards =		| MainHazards =
	| FlashPt =		| FlashPt =
	| Autoignition =		| AutoignitionPt =
	| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->		| GHS_ref =<!-- no GHS data in PubChem Dec2021 -->
	| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
	}}		}}
	}}		}}
	'''Methyl hydroxychalcone''' is a ] found in ]. It was thought to be an ], improving insulin response of diabetics.<ref name="MCHP insulin">		'''Methyl hydroxychalcone''' is a ] found in ]. It was thought to be an ], improving insulin response of diabetics.<ref name="MCHP insulin">
	{{cite journal		{{cite journal
		⚫	| title=A hydroxychalcone derived from cinnamon functions as a mimetic for insulin in 3T3-L1 adipocytes
⚫	|last=Anderson
		⚫	| journal=J Am Coll Nutr
⚫	|title=A hydroxychalcone derived from cinnamon functions as a mimetic for insulin in 3T3-L1 adipocytes
⚫	|journal=J Am Coll Nutr.
	| volume=20		| volume=20
	| issue=4		| issue=4
	|pages=327–36		| pages=327–36
	|pmid=11506060		| pmid=11506060
	|url=http://www.jacn.org/cgi/content/full/20/4/327		| url=http://www.jacn.org/cgi/content/full/20/4/327
			| url-status=dead
	|accessdate=2008-06-19
			| archiveurl=https://web.archive.org/web/20040811194747/http://www.jacn.org/cgi/content/full/20/4/327
⚫	|date= August 1, 2001
			| archivedate=2004-08-11 |accessdate=2014-02-27
	|author1=J
		⚫	| date= August 1, 2001
	|author2=A
			| author1=Karalee J. Jarvill-Taylor, PhD
⚫	|author3=G }}</ref> It has since been determined that a flavonoid (]) is responsible for the insulin-like biological activity.<ref name="polyphenol insulin">{{cite journal
			| author2=Richard A. Anderson, PhD
⚫	|title=Isolation and characterization of polyphenol type-A polymers from cinnamon with insulin-like biological activity
			| author3=Donald J. Graves, PhD| doi=10.1080/07315724.2001.10719053
	|author =Anderson
			| s2cid=34049517
	|year=2004
		⚫	}}</ref> It has since been determined that a flavonoid (]) is responsible for the insulin-like biological activity.<ref name="polyphenol insulin">{{cite journal
⚫	|month=January
		⚫	| title=Isolation and characterization of polyphenol type-A polymers from cinnamon with insulin-like biological activity
⚫	|journal=J Agric Food Chem.
		⚫	| author =Anderson
⚫	|volume=52
		⚫	| date=January 2004
⚫	|issue=1
		⚫	| journal=J Agric Food Chem
⚫	|pages=65–70
		⚫	| volume=52
⚫	|pmid=14709014
		⚫	| issue=1
⚫	|doi=10.1021/jf034916b
		⚫	| pages=65–70
⚫	|last2=Broadhurst
		⚫	| pmid=14709014
⚫	|first2=CL
		⚫	| doi=10.1021/jf034916b
⚫	|last3=Polansky
		⚫	| last2=Broadhurst
⚫	|first3=MM
		⚫	| first2=CL
⚫	|last4=Schmidt
		⚫	| last3=Polansky
⚫	|first4=WF
		⚫	| first3=MM
⚫	|last5=Khan
		⚫	| last4=Schmidt
⚫	|first5=A
		⚫	| first4=WF
⚫	|last6=Flanagan
		⚫	| last5=Khan
⚫	|first6=VP
		⚫	| first5=A
⚫	|last7=Schoene
		⚫	| last6=Flanagan
⚫	|first7=NW
		⚫	| first6=VP
⚫	|last8=Graves
		⚫	| last7=Schoene
⚫	|first8=DJ
		⚫	| first7=NW
		⚫	| last8=Graves
		⚫	| first8=DJ
	}}</ref>		}}</ref>
Line 88:		Line 97:
	]		]
	{{Natural-phenol-stub}}
			{{Aromatic-stub}}