Revision as of 18:32, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 12:04, 23 January 2023 edit undoMichael D. Turnbull (talk | contribs)Extended confirmed users13,762 edits Add soft hyphens to |name parameter in chembox so the box does not become too wide |
(17 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 420503368 |
|
| verifiedrevid = 451185539 |
⚫ |
| ImageFile1 = MDHOET.png |
|
|
|
| Name=Methylenedioxyhydroxyethyl{{shy}}amphetamine |
|
⚫ |
| ImageFile1 = MDHOET svg.svg |
|
| ImageSize1 = 200px |
|
| ImageSize1 = 200px |
|
| ImageFile2 = |
|
| ImageFile2 = |
|
| ImageSize2 = 200px |
|
| ImageSize2 = 200px |
|
|
| PIN = 2-<nowiki/>{amino}ethan-1-ol |
|
| IUPACName = 2-(2-Benzodioxol-5-yl-1-methylethylamino)ethanol |
|
|
| OtherNames = 3,4-Methylenedioxy-''N''-hydroxyethylamphetamine<br>3,4-Methylenedioxy-1-(alpha-methylaminohydroxyethyl)ethane<br />MDOHET, MDHET, MDHEA |
|
| OtherNames = 3,4-Methylenedioxy-''N''-hydroxyethylamphetamine<br>3,4-Methylenedioxy-1-(alpha-methylaminohydroxyethyl)ethane<br />MDOHET, MDHET, MDHEA |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 74698-43-4 |
|
| CASNo = 74698-43-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = |
|
|
|
| UNII = 8DVH9HP8WG |
|
⚫ |
| PubChem = 21645837 |
|
|
| DTXSID = DTXSID30616572 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 15637662 |
|
| SMILES = C1=C2C(=CC=C1CC(C)NCCO)OCO2 |
|
| SMILES = C1=C2C(=CC=C1CC(C)NCCO)OCO2 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H17NO3/c1-9(13-4-5-14)6-10-2-3-11-12(7-10)16-8-15-11/h2-3,7,9,13-14H,4-6,8H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SCUUYKMQDUDNBP-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> |
|
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> |
|
| MolarMass = 223.271 g/mol |
|
| MolarMass = 223.271 g/mol |
Line 20: |
Line 32: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''MDHOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-]] analogue of ]. MDHOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 50 ]. MDHOET produces few to no effects. Very little data exists about the ], ]s, ]s, and toxicity of MDHOET. |
|
'''MDHOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-]] analogue of ]. MDHOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 50 ]. MDHOET produces few to no effects. Very little data exists about the ], ]s, ]s, and toxicity of MDHOET. |
|
|
|
|
|
==Legality== |
|
|
|
|
|
===United Kingdom=== |
|
|
This substance is a Class A drug in the ].<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | accessdate = 12 March 2014 | publisher = Isomer Design}}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
Line 32: |
Line 49: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
|
<references /> |
|
|
|
|
|
== External links == |
|
== External links == |
|
* |
|
* |
|
* |
|
* |
|
* |
|
* |
|
|
|
|
|
{{Methylenedioxyphenethylamines}} |
|
{{Methylenedioxyphenethylamines}} |
|
{{PiHKAL}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|