Misplaced Pages

Methylenedioxyhydroxyethylamphetamine: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 18:32, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit Latest revision as of 12:04, 23 January 2023 edit undoMichael D. Turnbull (talk | contribs)Extended confirmed users13,762 edits Add soft hyphens to |name parameter in chembox so the box does not become too wide 
(17 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 420503368 | verifiedrevid = 451185539
| ImageFile1 = MDHOET.png
| Name=Methylenedioxyhydroxyethyl{{shy}}amphetamine
| ImageFile1 = MDHOET svg.svg
| ImageSize1 = 200px | ImageSize1 = 200px
| ImageFile2 = | ImageFile2 =
| ImageSize2 = 200px | ImageSize2 = 200px
| PIN = 2-<nowiki/>{amino}ethan-1-ol
| IUPACName = 2-(2-Benzodioxol-5-yl-1-methylethylamino)ethanol
| OtherNames = 3,4-Methylenedioxy-''N''-hydroxyethylamphetamine<br>3,4-Methylenedioxy-1-(alpha-methylaminohydroxyethyl)ethane<br />MDOHET, MDHET, MDHEA | OtherNames = 3,4-Methylenedioxy-''N''-hydroxyethylamphetamine<br>3,4-Methylenedioxy-1-(alpha-methylaminohydroxyethyl)ethane<br />MDOHET, MDHET, MDHEA
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 74698-43-4 | CASNo = 74698-43-4
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem =
| UNII = 8DVH9HP8WG
| PubChem = 21645837
| DTXSID = DTXSID30616572
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 15637662
| SMILES = C1=C2C(=CC=C1CC(C)NCCO)OCO2 | SMILES = C1=C2C(=CC=C1CC(C)NCCO)OCO2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H17NO3/c1-9(13-4-5-14)6-10-2-3-11-12(7-10)16-8-15-11/h2-3,7,9,13-14H,4-6,8H2,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = SCUUYKMQDUDNBP-UHFFFAOYSA-N
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub> | Formula = C<sub>12</sub>H<sub>17</sub>NO<sub>3</sub>
| MolarMass = 223.271 g/mol | MolarMass = 223.271 g/mol
Line 20: Line 32:
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}


'''MDHOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-]] analogue of ]. MDHOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 50 ]. MDHOET produces few to no effects. Very little data exists about the ], ]s, ]s, and toxicity of MDHOET. '''MDHOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-]] analogue of ]. MDHOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 50 ]. MDHOET produces few to no effects. Very little data exists about the ], ]s, ]s, and toxicity of MDHOET.

==Legality==

===United Kingdom===
This substance is a Class A drug in the ].<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | accessdate = 12 March 2014 | publisher = Isomer Design}}</ref>


== See also == == See also ==
Line 32: Line 49:
* ] * ]
* ] * ]

== References ==
<references />


== External links == == External links ==
* *
* *
* *


{{Methylenedioxyphenethylamines}} {{Methylenedioxyphenethylamines}}
{{PiHKAL}}


] ]
] ]
] ]