| Revision as of 18:50, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:53, 10 March 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,382,355 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Maxim Masiutin - 17955 |
| (14 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 379536713 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 424728565 |
|
|
| Name=Methylenedioxymethoxyethyl{{shy}}amphetamine |
|
| ImageFile = MDMEOET.png |
|
| ImageFile = MDMEOET.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 1-(1,3-benzodioxol-5-yl)-''N''-(2-methoxyethyl)propan-2-amine |
|
| PIN = 1-(2''H''-1,3-Benzodioxol-5-yl)-''N''-(2-methoxyethyl)propan-2-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 74698-44-5 |
|
| CASNo = 74698-44-5 |
|
| PubChem = |
|
| UNII = YPA4B5U3U8 |
|
|
| PubChem = 44719584 |
|
| SMILES = C1=C2C(=CC=C1CC(C)NCCOC)OCO2}} |
|
|
|
| DTXSID = DTXSID10660371 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 21106334 |
|
|
| SMILES = CC(Cc1ccc2c(c1)OCO2)NCCOC |
|
|
| InChI = 1/C13H19NO3/c1-10(14-5-6-15-2)7-11-3-4-12-13(8-11)17-9-16-12/h3-4,8,10,14H,5-7,9H2,1-2H3 |
|
|
| InChIKey = LOZJEWOZOKSOKA-UHFFFAOYAB |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H19NO3/c1-10(14-5-6-15-2)7-11-3-4-12-13(8-11)17-9-16-12/h3-4,8,10,14H,5-7,9H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LOZJEWOZOKSOKA-UHFFFAOYSA-N}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula = C<sub>13</sub>H<sub>19</sub>NO<sub>3</sub> |
|
| Formula = C<sub>13</sub>H<sub>19</sub>NO<sub>3</sub> |
|
| MolarMass = 237.295 g/mol |
|
| MolarMass = 237.295 g/mol |
| Line 17: |
Line 31: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''MDMEOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-methoxyethyl analogue of ]. MDMEOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 180 ]. MDMEOET produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDMEOET. |
|
'''MDMEOET''', or 3,4-]enedioxy-N-]]], is a lesser-known ] and a ]. It is also the N-methoxyethyl analogue of ]. MDMEOET was first synthesized by ]. In his book '']'', the minimum dosage is listed as 180 ]. MDMEOET produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MDMEOET. |
|
|
|
|
|
==Legality== |
|
|
|
|
|
===United Kingdom=== |
|
|
This substance is a Class A drug in the ].<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | accessdate = 12 March 2014 | publisher = Isomer Design | archive-date = 22 October 2017 | archive-url = https://web.archive.org/web/20171022085110/http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | url-status = dead }}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 29: |
Line 48: |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
== External links == |
| Line 35: |
Line 57: |
|
|
|
|
|
{{Methylenedioxyphenethylamines}} |
|
{{Methylenedioxyphenethylamines}} |
|
{{PiHKAL}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Psychoactive-stub}} |
|
{{Psychoactive-stub}} |