| Revision as of 21:00, 10 September 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Adding category Category:Lactams (using HotCat)← Previous edit |
Latest revision as of 14:19, 18 April 2024 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,708,346 editsm Moving Category:Thiosemicarbazone to Category:Thiosemicarbazones per Misplaced Pages:Categories for discussion/Speedy |
| (45 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Methisazone.png |
|
|
|
| verifiedrevid = 384087307 |
| ⚫ |
|ImageSize=180px |
|
|
⚫ |
| ImageFile = Methisazone.png |
| ⚫ |
|IUPACName=thiourea |
|
|
⚫ |
| ImageSize = 180 |
| ⚫ |
|OtherNames=Metisazone |
|
|
|
| ImageAlt = Skeletal formula of methisazone |
|
|
| ImageFile1 = Methisazone-3D-spacefill.png |
|
|
| ImageSize1 = 170 |
|
|
| ImageAlt1 = Space-filling model of the methisazone molecule |
|
⚫ |
| IUPACName=thiourea |
|
⚫ |
| OtherNames=Metisazone |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=1910-68-5 |
|
| CASNo=1910-68-5 |
|
| PubChem=6861563 |
|
| PubChem=6861563 |
| ⚫ |
| SMILES=CN1C2=CC=CC=C2C(=NNC(=S)N)C1=O |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1512080 |
|
|
| EINECS = 217-616-2 |
|
|
| MeSHName = D008720 |
|
|
| ChEBI = |
|
|
| KEGG = D02496 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = K3QML4J07E |
|
⚫ |
| SMILES= CN1C(=O)C(=NNC(N)=S)c2ccccc21 |
|
|
| InChI = 1/C10H10N4OS/c1-14-7-5-3-2-4-6(7)8(9(14)15)12-13-10(11)16/h2-5H,1H3,(H3,11,13,16)/b12-8- |
|
|
| InChIKey = DLGSOJOOYHWROO-WQLSENKSBL |
|
|
| StdInChI = 1S/C10H10N4OS/c1-14-7-5-3-2-4-6(7)8(9(14)15)12-13-10(11)16/h2-5H,1H3,(H3,11,13,16)/b12-8- |
|
|
| StdInChIKey = DLGSOJOOYHWROO-WQLSENKSSA-N |
|
|
| ChemSpiderID = 5259074 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>10</sub>N<sub>4</sub>OS |
|
| Formula=C<sub>10</sub>H<sub>10</sub>N<sub>4</sub>OS |
|
| MolarMass=234.28 g/mol |
|
| MolarMass=234.28 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section6={{Chembox Pharmacology |
|
|
| ATCCode_prefix = J05 |
| ⚫ |
| MainHazards= |
|
|
|
| ATCCode_suffix = AA01 |
| ⚫ |
| FlashPt= |
|
|
|
}} |
|
| Autoignition= |
|
|
|
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Methisazone''' (]) or '''metisazone''' (])<ref name="Potopalsky">, Yuriy V. Patskovsky*, Emma N. Negrebetskaya, Alexandra A. Chernomaz, Tamara P. Voloshchuk, Eugeniy L. Rubashevsky, Oleg E. Kitam, Mikhail I. Tereshchenko, Lidiya N. Nosach, Anatoliy I. Potopalsky</ref> is an ] that works by inhibiting ] and ], especially in pox viruses. During trials in the 1960s it showed promising results against ] infection, but widespread use was considered logistically impractical in the developing countries facing smallpox cases, and it saw only limited use. In developed countries able to cope with the logistic challenge, treatment of smallpox could be achieved just as effectively with ], without the severe nausea associated with metisazone.<ref>{{cite book |last1=Fenner |first1=Frank |last2=Henderson |first2=Donald A |last3=Arita |first3=Isa |last4=Jezek |first4=Zdenek |last5=Ladnyi |first5=Ivan Danilovich |title=Smallpox and its eradication |date=1988 |publisher=World Health Organization |location=Geneva |isbn=9241561106 |page=67 |hdl=10665/39485 |url=https://apps.who.int/iris/handle/10665/39485}}</ref> |
|
'''Methisazone''' is an ] that works by inhibiting ] and ], especially in pox viruses. It has been used in the past to treat ].<ref>, Merriam-Webster's Medical Dictionary</ref> |
|
|
|
|
|
|
Methisazone has been described as being used in prophylaxis since at least 1965.<ref name="pmid4159212 ">{{Cite journal|pmid=4159212|journal=Lancet|date=13 Nov 1965|volume=2|issue=7420|pages=976–8|title=Methisazone in prevention of variola minor among contacts|last=do Valle|first=LA|last2=de Melo|first2=PR|last3=de Gomes|first3=LF|last4=Proença|first4=LM}}</ref><ref name="pmid15578369">{{Cite journal |author=Weiss MM, Weiss PD, Mathisen G, Guze P |title=Rethinking smallpox |journal=Clin. Infect. Dis. |volume=39 |issue=11 |pages=1668–73 |date=December 2004|pmid=15578369 |doi=10.1086/425745 |url=http://www.journals.uchicago.edu/cgi-bin/resolve?CID34015}}</ref> |
|
Methisazone has been described as being used in prophylaxis since at least 1965.<ref name="pmid4159212 ">{{Cite journal|pmid=4159212|journal=Lancet|date=13 Nov 1965|volume=2|issue=7420|pages=976–8|title=Methisazone in prevention of variola minor among contacts|last1=do Valle|first1=LA|last2=de Melo|first2=PR|last3=de Gomes|first3=LF|last4=Proença|first4=LM|doi=10.1016/s0140-6736(65)92840-0}}</ref><ref name="pmid15578369">{{Cite journal |vauthors=Weiss MM, Weiss PD, Mathisen G, Guze P |title=Rethinking smallpox |journal=Clin. Infect. Dis. |volume=39 |issue=11 |pages=1668–73 |date=December 2004|pmid=15578369 |doi=10.1086/425745 |pmc=7107961 |doi-access=free }}</ref> |
|
|
|
|
|
The condensation of N-methyl] with ] leads to methisazone.{{cn|date=January 2023}} |
|
|
|
|
|
==References== |
|
==References== |
| Line 34: |
Line 60: |
|
{{DNA antivirals}} |
|
{{DNA antivirals}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |
|
{{antiinfective-drug-stub}} |