| Revision as of 12:38, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456573206 of page Minodronic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'UNII', 'CASNo'). |
Latest revision as of 17:53, 30 June 2022 edit Citation bot (talk | contribs)Bots5,389,923 edits Alter: title. | Use this bot. Report bugs. | Suggested by Abductive | Category:Multiple chemicals in an infobox that need indexing | #UCB_Category 453/1863 |
| Line 1: |
Line 1: |
|
|
{{distinguish|mildronate|medronate}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 462252636 |
|
| UNII = <!-- blanked - oldvalue: 40SGR63TGL --> |
|
| ⚫ |
| verifiedrevid = 403957731 |
|
|
| ImageFile = Minodronic acid.svg |
|
| ImageFile = Minodronic acid.svg |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = (1-Hydroxy-2-imidazopyridin-3-yl-1-phosphonoethyl)phosphonic acid |
|
| PIN = pyridin-3-yl)ethane-1,1-diyl]bis(phosphonic acid) |
|
| OtherNames = Minodronate; YM 529 |
|
| OtherNames = Minodronate; YM 529 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 180064-38-4 --> |
|
|
|
| UNII = 40SGR63TGL |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
| UNII1_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| CASNo1 = 155648-60-5 |
|
|
|
| UNII1 = 457X74V7ND |
| ⚫ |
| CASNo1_Comment = (hydrate) |
|
|
|
| UNII1_Comment = (monohydrate) |
| ⚫ |
| CASNo1_Ref = {{cascite|correct}} |
|
|
| ChEMBL = 319144 |
|
| IUPHAR_ligand = 3164 |
|
⚫ |
| CASNo = 180064-38-4 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo1 = 155648-60-5 |
|
⚫ |
| CASNo1_Comment = (monohydrate) |
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 319144 |
|
| PubChem = 130956 |
|
| PubChem = 130956 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 115805 |
|
| ChemSpiderID = 115805 |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
|
| StdInChIKey = VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
|
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12 |
|
| SMILES = O=P(O)(O)C(O)(P(=O)(O)O)Cc1cnc2ccccn12 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}} |
|
| StdInChI = 1S/C9H12N2O7P2/c12-9(19(13,14)15,20(16,17)18)5-7-6-10-8-3-1-2-4-11(7)8/h1-4,6,12H,5H2,(H2,13,14,15)(H2,16,17,18)}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=9|H=12|N=2|O=7|P=2 |
|
| C=9 | H=12 | N=2 | O=7 | P=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
| Section5 = {{Chembox Pharmacology |
|
|Section5={{Chembox Pharmacology |
|
| AdminRoutes = |
|
| AdminRoutes = |
|
| Bioavail = |
|
| Bioavail = |
|
| Metabolism = |
|
| Metabolism = |
|
| HalfLife = |
|
| HalfLife = |
|
| ProteinBound = |
|
| ProteinBound = |
|
| Excretion = |
|
| Excretion = |
|
| Legal_status = |
|
| Legal_status = |
|
| Legal_US = |
|
| Legal_US = |
|
| Legal_UK = |
|
| Legal_UK = |
|
| Legal_AU = |
|
| Legal_AU = |
|
| Legal_CA = |
|
| Legal_CA = |
|
| PregCat = |
|
| PregCat = |
|
| PregCat_AU = |
|
| PregCat_AU = |
|
| PregCat_US = }} |
|
| PregCat_US = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Minodronic acid''' is a third-generation ] drug. It is approved for use in Japan for the treatment of ].<ref>{{cite journal | journal = Annual Reports in Medicinal Chemistry | volume = 45 | title = To Market, To Market - 2009. 16. Minodronic acid | pages = 509–510 | author = Shridhar Hegde and Michelle Schmidt | year = 2009 | doi=10.1016/s0065-7743(10)45028-9}}</ref> Its ] involves ] of ] activity.<ref>{{cite journal | doi = 10.1358/dof.2002.027.10.701186 | last1 = Sorbera | first1 = L.A. | last2 = Castañer | first2 = J. | last3 = Leeson | first3 = P.A. | title = Minodronic Acid | journal = Drugs of the Future | year = 2002 | volume = 27 | issue = 10 | pages = 935–941}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Drugs for treatment of bone diseases}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{musculoskeletal-drug-stub}} |