Misplaced Pages

Mitoguazone: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 02:58, 14 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation← Previous edit Latest revision as of 23:32, 5 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,083 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(10 intermediate revisions by 9 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444738923
| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide
| image = mitoguazone.png
| image2 = mitoguazone_sf.gif

<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 459-86-9
| ATC_prefix = L01
| ATC_suffix = XX16
| PubChem = 5351154
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = OD5Q0L447W | UNII = OD5Q0L447W
| verifiedrevid = 443518984
| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide
|synonyms = <small>2-<nowiki>amino]guanidine</small>
| image = mitoguazone.png
| image2 = mitoguazone_sf.gif
| CAS_number = 459-86-9
| ATC_prefix = L01
| ATC_suffix = XX16
| PubChem = 5351154
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07258 | KEGG = D07258
| ChEBI_Ref = {{ebicite|changed|EBI}}
| C=5|H=12|N=8
| ChEBI = 43996
| molecular_weight = 184.20 g/mol
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| bioavailability =
| ChemSpiderID = 4508218
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}


<!--Chemical data-->
'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ].
| C=5 | H=12 | N=8
| synonyms = <small>2-<nowiki>amino]guanidine</small>
| smiles = C\C(\C=N\NC(N)=N)=N/NC(N)=N
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13)/b10-2+,11-3+
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = PKDBCJSWQUOKDO-UHFFFAOYSA-M
}}


'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ].<ref name="pmid2655552">{{cite journal | vauthors = Hoffmann H, Gutsche W, Amlacher R, Schulze W, Werner W, Lenk H, Wohlrab W, Haupt E | title = | language = German | journal = Archiv für Geschwulstforschung | volume = 59 | issue = 2 | pages = 135–48 | date = 1989 | pmid = 2655552 | doi = | url = }}</ref>


== References ==
{{Reflist}}


{{Chemotherapeutic agents}} {{Chemotherapeutic agents}}