| Revision as of 04:29, 11 July 2011 editChris the speller (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers868,494 editsm Typo fixing per WP:HYPHEN, replaced: naturally- → naturally using AWB (7774)← Previous edit |
Latest revision as of 00:30, 5 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (24 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 360353523 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 438855548 |
|
| ImageFile = Monatin.png |
|
| ImageFile = Monatin.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = (2''S'',4''S'')-4-Amino-2-hydroxy-2-(1''H''-indol-3-ylmethyl)-pentanedioic acid |
|
| IUPACName = (4''S'')-4-Hydroxy-4--<small>L</small>-glutamic acid |
|
| OtherNames = 2-Hydroxy-2-(indol-3-ylmethyl)-4-aminoglutaric acid<br>(S)-4-Hydroxy-4-(1''H''-indol-3-ylmethyl)-<small>L</small>-glutamic acid |
|
| SystematicName = (2''S'',4''S'')-4-Amino-2-hydroxy-2-pentanedioic acid |
|
|
| OtherNames = 2-Hydroxy-2-(indol-3-ylmethyl)-4-aminoglutaric acid<br>(''S'')-4-Hydroxy-4-(1''H''-indol-3-ylmethyl)-<small>L</small>-glutamic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 146142-94-1 |
|
| CASNo = 146142-94-1 |
|
| PubChem = |
|
| PubChem = 9860847 |
|
| SMILES = O((O)=O)(C(N)C(O)=O)CC2=CNC1=CC=CC=C12 |
|
| SMILES = O((O)=O)(C(N)C(O)=O)CC2=CNC1=CC=CC=C12 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8036546 |
|
|
| InChI = 1/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1 |
|
|
| InChIKey = RMLYXMMBIZLGAQ-HZMBPMFUBZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H16N2O5/c15-10(12(17)18)6-14(21,13(19)20)5-8-7-16-11-4-2-1-3-9(8)11/h1-4,7,10,16,21H,5-6,15H2,(H,17,18)(H,19,20)/t10-,14-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RMLYXMMBIZLGAQ-HZMBPMFUSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=14 | H=16 | N=2 | O=5 |
|
| C=14 | H=16 | N=2 | O=5 |
|
| Appearance = |
|
| Appearance = |
| Line 17: |
Line 29: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Monatin''' is a naturally occurring, high intensity sweetener isolated from the plant '']'', found in the ] region of ]. Monatin contains no carbohydrate or sugar, and nearly no ], unlike sucrose or other nutritive sweeteners.<ref>{{US patent application|20050106305}}, Timothy W. Abraham, ]</ref> |
|
'''Monatin''', commonly known as '''arruva''', is a naturally occurring, high intensity sweetener isolated from the plant ''Sclerochiton ilicifolius'', found in the ] region of ]. Monatin contains no carbohydrate or sugar, and nearly no ], unlike ] or other nutritive sweeteners.<ref>{{US patent application|20050106305}}, Timothy W. Abraham, ]</ref> |
|
|
|
|
|
The name "monatin" is derived from the indigenous word for it, "molomo monate," which literally means "mouth nice."<ref>"Sweeteners and Sugar Alternatives in Food Technology," Kay O'Donnell and Malcolm Kearsley, 2012</ref> |
|
|
|
|
|
Monatin is an ] derivative and, upon degradation, smells like ].<ref>"The Quest For a Natural Sugar Substitute," Daniel Engber, The New York Times, 01 January 2014</ref> |
|
|
|
|
|
It is 3000 times sweeter than sugar.<ref>{{Cite web|url=http://www.sugar-and-sweetener-guide.com/monatin.html|title = Monatin}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
] |
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references/> |
|
|
|
|
|
==External links== |
|
|
*{{Commonscatinline}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|