Revision as of 16:56, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 14:13, 16 February 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 edits Updated PubChem |
(22 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 312456642 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 428781643 |
|
| ImageFile = Monocalcium citrate.png |
|
| ImageFile = Monocalcium citrate.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = calcium tetrahydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
| IUPACName = calcium tetrahydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 109459-70-3 |
|
|
| PubChem = |
|
| CASNo = 1185-56-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = QCD9FA9PLW |
|
|
| InChI = 1/2C6H8O7.Ca/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+2/p-2 |
|
|
| InChIKey = OWFJMGQSOHDIPP-NUQVWONBAR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/2C6H8O7.Ca/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;;+2/p-2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = OWFJMGQSOHDIPP-UHFFFAOYSA-L |
|
| SMILES = OC(CC(C(O)=O)(O)CC()=O)=O.OC(CC(C(O)=O)(O)CC()=O)=O. |
|
| SMILES = OC(CC(C(O)=O)(O)CC()=O)=O.OC(CC(C(O)=O)(O)CC()=O)=O. |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 35803758 |
|
|
| PubChem = 24363 |
|
|
| DTXSID = DTXSID30726685 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>14</sub>CaO<sub>14</sub> |
|
| Formula = C<sub>6</sub>H<sub>8</sub>CaO<sub>7</sub> |
|
| MolarMass = 422.31 g/mol |
|
| MolarMass = 232.20 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
Line 18: |
Line 32: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Monocalcium citrate''' is a ] with formula C<sub>12</sub>H<sub>14</sub>CaO<sub>14</sub>. It is a ] ] of ]. It is used as a ] in food, and as an ] and ]. |
|
'''Monocalcium citrate''' also known as '''calcium monocitrate''' is a ] with formula C<sub>6</sub>H<sub>8</sub>CaO<sub>7</sub>. It is a ] ] of ]. It is used as a ] in food, and as an ] and ]. |
|
|
|
|
|
==See also== |
|
==See also== |
Line 31: |
Line 45: |
|
|
|
|
|
==References== |
|
==References== |
|
|
*''Food Additives in Europe 2000'', pp. 322-324, Nordic Council of Ministers, 2002 {{ISBN|928930829X}}. |
|
{{Unreferenced|date =September 2007}} |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
Line 37: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |