| Revision as of 12:47, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456999160 of page Monosodium_citrate for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 07:07, 10 September 2024 edit Citation bot (talk | contribs)Bots5,418,718 edits Added title. Changed bare reference to CS1/2. | Use this bot. Report bugs. | Suggested by Grimes2 | #UCB_webform 368/953 |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| Name = {{PAGENAME}} |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Monosodium citrate.png |
|
|
|
| verifiedrevid = 462253460 |
| ⚫ |
| OtherNames = sodium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
|
|
| Name = Monosodium citrate |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| ImageFile = Monosodium citrate.png |
| ⚫ |
| ChemSpiderID = 5989 |
|
|
|
| ImageFile2 = Monosodium citrate.jpg |
| ⚫ |
| ChEMBL = 1355 |
|
|
⚫ |
| OtherNames = sodium dihydrogen 2-hydroxypropane-1,2,3-tricarboxylate |
|
|
| IUPACName = Sodium 2-(carboxymethyl)-2,4-dihydroxy-4-oxobutanoate<ref>{{cite web | url=https://pubchem.ncbi.nlm.nih.gov/compound/23662352#section=IUPAC-Name&fullscreen=true | title=Sodium dihydrogen citrate }}</ref> |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| PubChem = 23662352 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = 27304 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEMBL = |
|
| InChI1 = 1/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 |
|
| InChI1 = 1/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 |
|
| InChIKey1 = HRXKRNGNAMMEHJ-DFZHHIFOAL |
|
| InChIKey1 = HRXKRNGNAMMEHJ-DFZHHIFOAL |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 53258 |
|
| ChEBI = 53258 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C6H8O7.3Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;/q;3*+1/p-3 |
|
| StdInChI = 1S/C6H8O7.Na/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+1/p-1 |
| ⚫ |
| StdInChIKey = HRXKRNGNAMMEHJ-UHFFFAOYSA-K |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| SMILES = ...O=C(CC(O)(C(=O)CC(=O) |
|
|
⚫ |
| StdInChIKey = HWPKGOGLCKPRLZ-UHFFFAOYSA-M |
| ⚫ |
| CASNo = |
|
|
⚫ |
| SMILES = C(C(=O)O)C(CC(=O)O)(C(=O))O. |
| ⚫ |
}} |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| CASNo = 18996-35-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 68538UP9SE |
|
|
| EINECS = 242-734-6 |
|
|
| RTECS = GE9750000 |
|
⚫ |
}} |
|
⚫ |
| Section2 = {{Chembox Properties |
|
| Na = 1 | C = 6 | H = 7 | O = 7 |
|
| Na = 1 | C = 6 | H = 7 | O = 7 |
|
|
| Appearance = white powder <br> ] |
| ⚫ |
}} |
|
|
|
| Odor = odorless |
|
|
| MeltingPtC = 212 |
|
|
| BoilingPtC = 309.6 |
|
|
| Solubility = soluble |
|
|
| SolubleOther = negligible in ] |
|
|
| pKa = 3.50–3.80 |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| Structure_ref = <ref name="Structure MSC">{{cite journal |last1=Glusker |first1=Jenny P. |last2=van der Helm |first2=D. |last3=Love |first3=Warner E. |last4=Dornberg |first4=Marilyn L. |last5=Patterson |first5=A. L. |title=The State of Ionization of Crystalline Sodium Dihydrogen Citrate1 |journal=Journal of the American Chemical Society |date=June 1960 |volume=82 |issue=11 |pages=2964–2965 |doi=10.1021/ja01496a071 |url=https://pubs.acs.org/doi/10.1021/ja01496a071 |access-date=22 July 2022 |language=en |issn=0002-7863}}</ref> |
|
|
| CrystalStruct = Monoclinic |
|
|
| SpaceGroup = P2<small>1</small>/a (No. 4) |
|
|
| UnitCellFormulas = 4 |
|
|
}} |
|
|
| Section4 = {{Chembox Hazards |
|
|
| ExternalSDS = |
|
|
| LD50 = 5400 mg/kg (mouse, oral) >2000 mg/kg (rat, dermal) |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Monosodium citrate''', more correctly, sodium dihydrogen citrate (Latin: {{Lang|la|natrium citricum acidulatum}}), is an ] of ]. ] and ] are also known. It can be prepared by partial neutralisation of citric acid<ref name="ref3">{{cite web |title=Monosodium Citrate - Jungbunzlauer |url=https://www.jungbunzlauer.com/en/products/special-salts/monosodium-citrate.html |website=www.jungbunzlauer.com |access-date=17 July 2022}}</ref> with an aqueous solution of ] or ]. It has a slightly acidic taste.<ref name="ref3" /> |
|
|
|
|
|
:NaHCO<sub>3</sub> + C<sub>6</sub>H<sub>8</sub>O<sub>7</sub> → NaC<sub>6</sub>H<sub>7</sub>O<sub>7</sub> + CO<sub>2</sub> + H<sub>2</sub>O |
|
|
|
|
|
:Na<sub>2</sub>CO<sub>3</sub> + 2C<sub>6</sub>H<sub>8</sub>O<sub>7</sub> → 2NaC<sub>6</sub>H<sub>7</sub>O<sub>7</sub> + CO<sub>2</sub> + H<sub>2</sub>O |
|
|
|
|
|
It is highly soluble in water and practically insoluble in ethanol.<ref name="ref3" /> Monosodium citrate is used as an ] in ].<ref>, Mary Louise Turgeon</ref> It is used as an ] to prevent ].<ref>{{Cite web|last=PubChem|title=Monosodium citrate|url=https://pubchem.ncbi.nlm.nih.gov/compound/23666341|access-date=2021-08-02|website=pubchem.ncbi.nlm.nih.gov|language=en}}</ref> The crystals form as nearly perfect cubes.<ref name="Structure NaH2Cit 2">{{cite journal |last1=Hitchcock |first1=David I. |title=Sodium Hydrogen Citrates |journal=Journal of the American Chemical Society |date=March 1946 |volume=68 |issue=3 |pages=524–525 |doi=10.1021/ja01207a507 |pmid=21015754 |url=https://pubs.acs.org/doi/10.1021/ja01207a507 |access-date=22 July 2022 |language=en |issn=0002-7863}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Monosodium Citrate}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |