Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 18:10, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit		Latest revision as of 16:04, 6 January 2022 edit undoLennart97 (talk | contribs)Extended confirmed users, Page movers69,823 editsm Disambiguating links to Alcohol (link changed to Alcohol (chemistry)) using DisamAssist.
(20 intermediate revisions by 15 users not shown)
Line 1:		Line 1:
	{{chembox		{{chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 405332765
			| Watchedfields = changed
		⚫	| verifiedrevid = 428793132
	| Name = Mosher's acid		| Name = Mosher's acid
	| ImageFileR1 = R-MTPA.png		| ImageFileR1 = (R)-Mosher Acid Formula V.1.svg
	<!-- | ImageSize = 150px -->
	| ImageName =		| ImageName =
	| ImageFileL1 = S-MTPA.png		| ImageFileL1 = (S)-Mosher Acid Formula V.1.svg
	<!-- | ImageSize1 = 150px -->
	| ImageFileR2 = R-Mosher's-acid-3D-balls.png		| ImageFileR2 = R-Mosher's-acid-3D-balls.png
	| ImageFileL2 = S-Mosher's-acid-3D-balls.png		| ImageFileL2 = S-Mosher's-acid-3D-balls.png
	| IUPACName = (R/S)-3,3,3-trifluoro-2-<br />methoxy-2-phenylpropanoic acid		| IUPACName =(''R'')-3,3,3-trifluoro-2-<wbr />methoxy-2-phenylpropanoic acid<br/>
			(''S'')-3,3,3-trifluoro-2-<wbr />methoxy-2-phenylpropanoic acid
	| OtherNames = Methoxy(trifluoromethyl)phenylacetic acid, MTPA		| OtherNames = Methoxy(trifluoromethyl)phenylacetic acid, MTPA
	| Section1 = {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| SMILES = COC(C(O)=O)(c1ccccc1)C(F)(F)F		| SMILES = COC(C(O)=O)(c1ccccc1)C(F)(F)F
			| CASNo1_Ref = {{cascite|correct|CAS}}
	| CASNo=81655-41-6		| CASNo1 = 81655-41-6
	| CASOther = (racemic) <br/> (R)<br /> (S)
			| index1_label = (racemic)
			| CASNo2_Ref = {{cascite|correct|PubChem}}
			| CASNo2 = 20445-31-2
			| index2_label = (''R'')
			| CASNo3_Ref = {{cascite|correct|PubChem}}
			| CASNo3 = 17257-71-5
			| index3_label = (''S'')
			| PubChem2 = 2723917
			| PubChem3 = 6992788
			| EC_number2 = 243-829-5
			| EC_number3 = 241-292-1
			| UNII1_Ref = {{fdacite|correct|FDA}}
			| UNII2_Ref = {{fdacite|correct|FDA}}
			| UNII3_Ref = {{fdacite|correct|FDA}}
			| UNII3 = 172HCJ1IQV
			| UNII2 = 27O5L9T1WM
			| UNII1 = E015GCC0MA
			| DTXSID = DTXSID90897007
	| RTECS =		| RTECS =
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID = 78043
			| InChI = 1/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)
			| InChIKey = JJYKJUXBWFATTE-UHFFFAOYAJ
			| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChI = 1S/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)
			| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChIKey = JJYKJUXBWFATTE-UHFFFAOYSA-N
	}}		}}
	| Section2 = {{Chembox Properties		|Section2={{Chembox Properties
	| Formula = C<sub>10</sub>H<sub>9</sub>F<sub>3</sub>O<sub>3</sub>		| Formula = C<sub>10</sub>H<sub>9</sub>F<sub>3</sub>O<sub>3</sub>
	| MolarMass = 234.17		| MolarMass = 234.17
Line 23:		Line 52:
	| Density =		| Density =
	| Solubility =		| Solubility =
	| MeltingPt = 46-49°C (319-322 K)		| MeltingPtC = 46 to 49
			| MeltingPt_notes =
⚫	| BoilingPt = 105 - 107 °C at 1 torr<!-- 116-118 °C -->
			| BoilingPtC = 105 to 107
		⚫	| BoilingPt_notes = at 1 torr<!-- 116-118 °C -->
	| pKa =		| pKa =
	| pKb =		| pKb =
	| Viscosity =		| Viscosity =
	}}		}}
	| Section3 = {{Chembox Structure		|Section3={{Chembox Structure
	| Dipole =		| Dipole =
	}}		}}
	| Section7 = {{Chembox Hazards		|Section7={{Chembox Hazards
	| ExternalMSDS =		| ExternalSDS =
	| MainHazards =		| MainHazards =
	| FlashPt = 110°C		| FlashPtC = 110
	| RPhrases = {{R36/37/38}}		| GHSPictograms = {{GHS07}}
			| GHSSignalWord = Warning
	| SPhrases = {{S26-36}}
			| HPhrases = {{H-phrases|315|319|335}}
⚫	}}
			| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}
⚫	| Section8 = {{Chembox Related
	| Function = ]
⚫	| OtherFunctn = ]
	| OtherCpds =
	}}		}}
		⚫	|Section8={{Chembox Related
			| OtherFunction_label = ]
		⚫	| OtherFunction = ]
			| OtherCompounds =
		⚫	}}
	}}		}}
	'''Mosher's acid''', or '''α-methoxy-α-trifluoromethylphenylacetic acid (MTPA)''' is a ] which was first used by ] as a ].<ref>{{cite journal		'''Mosher's acid''', or '''α-methoxy-α-trifluoromethylphenylacetic acid''' ('''MTPA''') is a ] which was first used by ] as a ].<ref>{{cite journal
		⚫	|author1=J. A. Dale |author2=D. L. Dull |author3=H. S. Mosher | title = α-Methoxy-α-trifluoromethylphenylacetic acid, a versatile reagent for the determination of enantiomeric composition of alcohols and amines
	| author = J. A. Dale, D. L. Dull, H. S. Mosher
⚫	| title = α-Methoxy-α-trifluoromethylphenylacetic acid, a versatile reagent for the determination of enantiomeric composition of alcohols and amines
	| journal = ]		| journal = ]
	| year = 1969		| year = 1969
Line 56:		Line 88:
	| doi = 10.1021/jo01261a013		| doi = 10.1021/jo01261a013
	}}</ref><ref>{{cite journal		}}</ref><ref>{{cite journal
		⚫	|author1=J. A. Dale |author2=H. S. Mosher | title = Nuclear magnetic resonance enantiomer regents. Configurational correlations via nuclear magnetic resonance chemical shifts of diastereomeric mandelate, O-methylmandelate, and α-methoxy-α-trifluoromethylphenylacetate (MTPA) esters
	| author = J. A. Dale, H. S. Mosher
⚫	| title = Nuclear magnetic resonance enantiomer regents. Configurational correlations via nuclear magnetic resonance chemical shifts of diastereomeric mandelate, O-methylmandelate, and α-methoxy-α-trifluoromethylphenylacetate (MTPA) esters
	| journal = ]		| journal = ]
	| year = 1973		| year = 1973
	| volume = 95		| volume = 95
	| issue = 2		| issue = 2
	| pages = 512–519		| pages = 512–519
	| doi = 10.1021/ja00783a034		| doi = 10.1021/ja00783a034
	}}</ref><ref>{{cite journal		}}</ref><ref>{{cite journal
	| author = Y. Goldberg, H. Alper		|author1=Y. Goldberg |author2=H. Alper | title = A new and simple synthesis of Mosher's acid
	| title = A new and simple synthesis of Mosher's acid
	| journal = ]		| journal = ]
	| year = 1992		| year = 1992
Line 74:		Line 104:
	| doi = 10.1021/jo00039a043		| doi = 10.1021/jo00039a043
	}}</ref><ref>{{cite journal		}}</ref><ref>{{cite journal
		⚫	|author1=D. L. Dull |author2=H. S. Mosher | title = Aberrant rotatory dispersion curves of α-hydroxy- and α-methoxy-α-trifluoromethylphenylacetic acids
	| author = D. L. Dull, H. S. Mosher
⚫	| title = Aberrant rotatory dispersion curves of α-hydroxy- and α-methoxy-α-trifluoromethylphenylacetic acids
	| journal = ]		| journal = ]
	| year = 1967		| year = 1967
	| volume = 89		| volume = 89
	| issue = 16		| issue = 16
	| pages = 4230–4230		| pages = 4230
	| doi = 10.1021/ja00992a053		| doi = 10.1021/ja00992a053
	}}</ref> It is a chiral molecule, consisting of R and S enantiomers.		}}</ref> It is a ] molecule, consisting of ''R'' and ''S'' enantiomers.
	==Applications==		==Applications==
	As a chiral derivatizing agent, it reacts with an ] or ]<ref>See for example: ''Mosher Amides: Determining the Absolute Stereochemistry of Optically-Active Amines'' Allen, Damian A.; Tomaso, Anthony E., Jr.; Priest, Owen P.; Hindson, David F.; Hurlburt, Jamie L. ] '''2008''', 85, 698. </ref> of unknown ] to form an ester or amide. The ] of the ester or amide is then determined by proton and/or ] ].		As a chiral derivatizing agent, it reacts with an ] or ]<ref>See for example: ''Mosher Amides: Determining the Absolute Stereochemistry of Optically-Active Amines'' Allen, Damian A.; Tomaso, Anthony E., Jr.; Priest, Owen P.; Hindson, David F.; Hurlburt, Jamie L. ] '''2008''', 85, 698. </ref> of unknown ] to form an ester or amide. The ] of the ester or amide is then determined by proton and/or ] ].
	'''Mosher's acid chloride''', the ] form, is sometimes used because it has better reactivity.<ref>{{cite journal		'''Mosher's acid chloride''', the ] form, is sometimes used because it has better reactivity.<ref>{{cite journal
		⚫	|author1=D. E. Ward |author2=C. K. Rhee | title = A simple method for the microscale preparation of Mosher's acid chloride
	| author = D. E. Ward, C. K. Rhee
⚫	| title = A simple method for the microscale preparation of Mosher's acid chloride
	| journal = ]		| journal = ]
	| year = 1991		| year = 1991
Line 97:		Line 125:
	| doi = 10.1016/0040-4039(91)80466-J		| doi = 10.1016/0040-4039(91)80466-J
	}}</ref>		}}</ref>
			== See also ==
			* ]
	==References==		==References==
Line 103:		Line 134:
	]		]
	]		]
	]		]
			]
	]
	]