| Revision as of 16:44, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo← Previous edit |
Latest revision as of 18:33, 31 October 2024 edit undoSvartMan (talk | contribs)278 edits →Detailed nomenclature: Removed tangent on sweet taste. Perhaps that content would be more appropriate on a page about sweet taste or IP3?Tags: Mobile edit Mobile web edit Advanced mobile edit |
| (71 intermediate revisions by 32 users not shown) |
| Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''muco''-Inositol}} |
|
{{DISPLAYTITLE:''muco''-Inositol}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 444019767 |
|
| verifiedrevid = 449558949 |
|
| ImageFile = Muco-inositol.svg |
|
| ImageFile = Muco-inositol.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| Name = ''muco''-Inositol |
|
| Name = ''muco''-Inositol |
|
|
| IUPACName = ''muco''-Inositol<ref>{{cite book |author=] |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=] |pages=1415 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}</ref> |
|
| IUPACName = |
|
|
|
| SystematicName = (1''R'',2''r'',3''S'',4''R'',5''r'',6''S'')-Cyclohexane-1,2,3,4,5,6-hexol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4648 |
| ⚫ |
| CASNo = 488-55-1 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| PubChem = |
|
|
⚫ |
| CASNo = 488-55-1 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
|
|
| UNII = R1Y9F3N15A |
|
⚫ |
| PubChem = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16736990 |
|
| ChemSpiderID = 16736990 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 27987 |
|
| ChEBI = 27987 |
|
| SMILES = O1(O)(O)(O)(O)1O |
|
| SMILES = O1(O)(O)(O)(O)1O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5+,6+ |
|
| StdInChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5+,6+ |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CDAISMWEOUEBRE-GNIYUCBRSA-N |
|
| StdInChIKey = CDAISMWEOUEBRE-GNIYUCBRSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=6|H=12|O=6 |
|
| C=6 | H=12 | O=6 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 27: |
Line 35: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
⚫ |
''Muco''-inositol is one of nine ] of ]. |
|
|
|
|
|
|
==Nomenclature== |
| ⚫ |
'''''muco''-Inositol''' is one of the ]s of ]. |
|
|
|
Nomenclature is extremely important as it relates to ''muco''-inositol. The utilization of this material in the neural system of the biological entity is totally dependent on the precise stereo-chemistry of this stereo-isomer. Unfortunately, the nomenclature has gone through a series of significant changes during the last thirty years. Only the literature subsequent to 1988 can be depended upon in this regard.<ref>NC-IUB (Moss, G. ed.) (1988) Numbering of atoms in myo-inositol http://www.chem.qmul.ac.uk/iupac/cyclitol/myo.html</ref> |
|
|
|
|
|
Muco-inositol (CAS 488-55-1) is a particular isomer of (and frequently confused with) the generic cyclohexane 1,2,3,4,5,6 hexol (CAS 87-89-8). This confusion should be avoided. The correct "chair" representation of ''muco''-inositol is shown here. The numbering reflects the recommended 1988 numbering based on the fact that the isomer is typically phosphorylated at the hydroxyl group associated with the #1 carbon when used as the hydrated sodium receptor. |
|
|
] |
|
|
|
|
|
It is quite difficult to represent the critical stereo-graphic features of ''muco''-inositol without employing the three-dimensional representation provided by the Jmol 3D images in the Chembox at upper right. The reason is that the distances between pairs of specific oxygen atoms are critically important to its operation as the active portion of the sodium channel sensory receptor. The values calculated using the Jmol script on this page will be used in this article in place of the preferred but unavailable measured values of these distances. There are many inaccurate Jmol representations of ''muco''-inositol present on the internet. Please use caution and verify the accuracy of any other Jmol script used. |
|
|
|
|
|
===Detailed nomenclature=== |
|
|
Note, the O3 and O4 atoms are both associated with axial hydroxyl groups pointed in opposite direction and separated by the single carbon-carbon bond of C3 and C4. The angles between the carbon-hydroxyl group bonds and the carbon-carbon bond are nominally 109.5 degrees. |
|
|
|
|
|
===Nomenclature of sodium ion in solution=== |
|
|
|
|
|
To address the role of PtdIns in the first step of the two-step Na-path sensory transduction process, the conformation of the sodium ion in solution must be appreciated. It cannot exist as a free ion in solution. Upon solvation, the total molecule is ionized and the sodium-ion is immediately hydrated, involving coordination chemistry, to form {{chem2|Na(H2O)_{n}+}} where n varies but is most commonly six. |
|
|
|
|
|
==See also== |
|
==See also== |
| ⚫ |
*] |
|
| ⚫ |
*] |
|
|
*] |
|
*] |
|
*] |
|
*] |
|
⚫ |
*] |
|
⚫ |
*] |
|
*] |
|
*] |
|
|
*] |
|
*] |
|
*] |
|
*] |
|
*] |
|
|
|
|
|
|
*] |
|
|
|
|
|
|
==References== |
| ⚫ |
{{DEFAULTSORT:Inositol, muco-}} |
|
|
|
{{Reflist}} |
|
|
|
|
|
⚫ |
{{DEFAULTSORT:Inositol, muco-}} |
|
] |
|
] |
|
|
|
|
|
|
|
{{alcohol-stub}} |
|