| Revision as of 13:13, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 414645309 of page Mutisianthol for the Chem/Drugbox validation project (updated: 'StdInChI', 'CASNo'). |
Latest revision as of 00:13, 29 November 2023 edit Kupirijo (talk | contribs)Extended confirmed users9,129 edits -Category:Terpeno-phenolic compounds |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400398252 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 462256195 |
|
| ImageFile = Mutisianthol.svg |
|
| ImageFile = Mutisianthol.svg |
|
| ImageSize = |
|
| ImageSize = |
|
|
| PIN = (1''S'',3''R'')-3,6-Dimethyl-1-(2-methylprop-1-en-1-yl)-2,3-dihydro-1''H''-inden-5-ol |
|
| IUPACName = |
|
|
| SystematicName = |
|
| SystematicName = |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 70855-59-3 --> |
|
| CASNo = 70855-59-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = F69DJ259PV |
|
| EINECS = |
|
| EINECS = |
|
| EINECSCASNO = |
|
| PubChem = 12168490 |
|
|
| DTXSID = DTXSID20479072 |
|
| PubChem = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 24750874 |
|
| ChemSpiderID = 24750874 |
|
| SMILES = Cc1cc2c(cc1O)(C2C=C(C)C)C |
|
| SMILES = Cc1cc2c(cc1O)(C2C=C(C)C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H20O/c1-9(2)5-12-6-10(3)13-8-15(16)11(4)7-14(12)13/h5,7-8,10,12,16H,6H2,1-4H3/t10-,12-/m1/s1 |
|
| StdInChI = 1S/C15H20O/c1-9(2)5-12-6-10(3)13-8-15(16)11(4)7-14(12)13/h5,7-8,10,12,16H,6H2,1-4H3/t10-,12-/m1/s1 |
| Line 25: |
Line 29: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
|
| C=15 | H=20 | O=1 |
|
| ATC_Supplemental =}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>15</sub>H<sub>20</sub>O |
|
|
| MolarMass = 216.319 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = |
|
| Solubility = |
|
| SolubleOther = |
|
| SolubleOther = |
| Line 46: |
Line 47: |
|
| pKa = |
|
| pKa = |
|
| pKb = }} |
|
| pKb = }} |
|
| Section8 = {{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherAnions = |
|
| OtherAnions = |
|
| OtherCations = |
|
| OtherCations = |
|
| OtherFunctn = |
|
| OtherFunction = |
|
| Function = |
|
| OtherFunction_label = |
|
| OtherCpds = }} |
|
| OtherCompounds = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Mutisianthol''' is a ] compound found in '']''. It was first isolated by Bohlmann et al. in 1979.<ref>{{cite journal| author=da Silva, Gil V. J. |author2=Álvaro Cunha Neto | date=2005-08-08 | title=Calculated NMR as a tool for structural elucidation of jungianol and mutisianthol | journal=Tetrahedron | volume=61 | issue=32 | pages=7763–7767 | doi=10.1016/j.tet.2005.05.101}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |