| Revision as of 13:14, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 432156544 of page Myclobutanil for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'StdInChI', 'StdInChIKey'). |
Latest revision as of 08:37, 11 September 2024 edit GTMotor815 (talk | contribs)33 edits delete advertisement linkTag: references removed |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| ImageFile = Systhane.svg |
|
| ImageFile = Myclobutanil Grundstruktur V1.svg |
|
⚫ |
| ImageSize = 200px |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
| ⚫ |
| ImageSize = 244 |
|
|
| ImageName = Kekulé, skeletal formula of myclobutanil |
|
| ImageName = Kekulé, skeletal formula of myclobutanil |
|
|
| ImageFile2 = Myclobutanil.png |
| ⚫ |
| PIN = 2-''p''-Chlorophenyl-2-(1''H''-1,2,4-triazol-1-ylmethyl)hexanenitrile{{Citation needed|date = May 2011}} |
|
|
|
| ImageSize2 = 200px |
|
| SystematicName = 2-(4-Chlorophenyl)-2-(1''H-1,2,4-triazol-1-ylmethyl)hexanenitrile{{Citation needed|date = May 2011}} |
|
|
|
| ImageName2 = Kekulé, skeletal formula of myclobutanil |
|
| OtherNames = 2-(4-Chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile{{Citation needed|date = May 2011}} |
|
|
⚫ |
| IUPACName = 2-(4-Chlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = |
|
| CASNo = 88671-89-0 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| PubChem = 6336 |
|
| CASNo = 88671-89-0 |
|
| PubChem_Ref = {{Pubchemcite|correct|pubchem}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| PubChem1 = 11077077 |
|
| PubChem = 6336 |
|
| PubChem1_Comment = <small>(2''R'')</small> |
|
| PubChem1 = 11077077 |
|
|
| PubChem1_Comment = <small>(2''R'')</small> |
|
⚫ |
| PubChem2 = 38989055 |
|
| PubChem1_Ref = {{pubchemcite|correct|pubchem}} |
|
|
⚫ |
| PubChem2_Comment = <small>(2''S'')</small> |
| ⚫ |
| PubChem2 = 38989055 |
|
|
| PubChem2_Ref = {{pubchemcite|correct|pubchem}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = B6T1JTM6KZ |
| ⚫ |
| PubChem2_Comment = <small>(2''S'')</small> |
|
|
| ChemSpiderID = 9252226 |
|
| ChemSpiderID = 6096 |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID1 = 9252226 |
|
| ChemSpiderID1 = 9252226 |
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID1_Comment = <small>(2''R'')</small> |
|
| ChemSpiderID1_Comment = <small>(2''R'')</small> |
|
| EINECS = 410-400-0 |
|
| EINECS = 410-400-0 |
|
| UNNumber = 3077 |
|
| UNNumber = 3077 |
|
| KEGG = C18477 |
|
| KEGG = C18477 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| MeSHName = Systhane |
|
|
| RTECS = XZ5257000 |
|
| ChEBI = 75281 |
|
| Beilstein = 7138849 |
|
| MeSHName = Systhane |
|
|
| RTECS = XZ5257000 |
| ⚫ |
| SMILES = CCCCC(Cn1cncn1)(C#N)c1ccc(Cl)cc1 |
|
|
|
| Beilstein = 7138849 |
| ⚫ |
| StdInChI = 1S/C15H17ClN4/c1-2-3-8-15(9-17,10-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,2-3,8,10H2,1H3/t15-/m0/s1 |
|
|
⚫ |
| SMILES = CCCCC(Cn1cncn1)(C#N)c1ccc(Cl)cc1 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| StdInChI = 1S/C15H17ClN4/c1-2-3-8-15(9-17,10-20-12-18-11-19-20)13-4-6-14(16)7-5-13/h4-7,11-12H,2-3,8,10H2,1H3 |
| ⚫ |
| StdInChIKey = HZJKXKUJVSEEFU-HNNXBMFYSA-N |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
⚫ |
| StdInChIKey = HZJKXKUJVSEEFU-UHFFFAOYSA-N |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=15|H=17|N=4|Cl=1 |
|
| C=15 | H=17 | N=4 | Cl=1 |
|
⚫ |
| Appearance = Pale, yellow, translucent crystals |
|
| ExactMass = 288.114174271 g mol<sup>-1</sup> |
|
|
|
| MeltingPtC = 63 to 68 |
| ⚫ |
| Appearance = Pale, yellow, translucent crystals |
|
|
|
| BoilingPtC = 202 to 208 |
|
| MeltingPtCL = 63 |
|
|
|
| BoilingPt_notes = at 130 Pa |
|
| MeltingPtCH = 68 |
|
|
⚫ |
| Solubility = 142{{nbsp}}mg⋅dm<sup>−3</sup> |
|
| BoilingPtCL = 202 |
|
|
| BoilingPtCH = 208 |
|
|
| Boiling_notes = at 130 Pa |
|
| ⚫ |
| Solubility = 142 mg dm<sup>-3</sup> |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| GHSPictograms = {{GHS exclamation mark}} {{GHS health hazard}} {{GHS environment}} |
|
| GHSPictograms = {{GHS exclamation mark}} {{GHS health hazard}} {{GHS environment}} |
|
| GHSSignalWord = Warning |
|
| GHSSignalWord = Warning |
|
| HPhrases = {{H-phrases|302|319|361|411}} |
|
| HPhrases = {{H-phrases|302|319|361|411}} |
|
| PPhrases = {{P-phrases|273|281|305+351+338}} |
|
| PPhrases = {{P-phrases|273|281|305+351+338}} |
|
⚫ |
| NFPA-H = 2 |
|
| EUClass = {{Hazchem Xn}} {{Hazchem N}} |
|
|
|
| NFPA-F = 1 |
|
| RPhrases = {{R22}}, {{R36}}, {{R51/53}}, {{R63}} |
|
|
|
| NFPA-R = 0 |
|
| SPhrases = {{S36/37}}, {{S46}}, {{S61}} |
|
|
| NFPA-H = 2 |
|
| FlashPt = > |
|
| NFPA-F = 1 |
|
| FlashPtC = 100 |
| ⚫ |
| NFPA-R = 0 |
|
|
| FlashPt = >100 °C |
|
|
}} |
|
}} |
|
| verifiedrevid = 396509008 |
|
| verifiedrevid = 462256248 |
|
}} |
|
}} |
|
|
|
|
|
'''Myclobutanil''' is a ] chemical used as a ]. It is a steroid demethylation (]) inhibitor, specifically inhibiting ] ]. Ergosterol is a critical component of fungal cell membranes. |
|
|
|
|
|
== Stereoisomerism == |
|
|
{| class="wikitable" style="text-align:center;" |
|
|
|- class="hintergrundfarbe6" |
|
|
! colspan="2" | Myclobutanil (2 stereoisomers) |
|
|
|- |
|
|
| ]<br />{{small|(''S'')-configuration}} |
|
|
| ]<br />{{small|(''R'')-configuration}} |
|
|
|} |
|
|
== Safety == |
|
|
The ] indicates the following hazards: |
|
|
*Suspected of damaging fertility or the unborn child. |
|
|
*Toxic to aquatic life with long lasting effects.<ref>{{cite web |title=SAFETY DATA SHEET Myclobutanil |url=https://www.caymanchem.com/msdss/24100m.pdf |publisher=Cayman Chemical Company |access-date=11 August 2021}}</ref> |
|
|
The first hazard has caused this chemical to be placed on the ] toxics list. |
|
|
|
|
|
When heated, myclobutanil decomposes to produce corrosive and/or toxic fumes, including ], ], ], ], and ].<ref>{{cite web|url=https://cameochemicals.noaa.gov/chemical/30020|title=MYCLOBUTANIL - CAMEO Chemicals - NOAA|first=NOAA Office of Response and Restoration, US|last=GOV|website=cameochemicals.noaa.gov}}</ref><ref>{{cite web | url = http://www.dow.com/webapps/include/GetDoc.aspx?filepath=productsafety/pdfs/noreg/233-01023.pdf&pdf=true | title = Product Safety Assessment: Myclobutanil}}</ref> |
|
|
|
|
|
== Banned for cannabis cultivation== |
|
|
Myclobutanil is banned in ], ], ], ], and ] for the production of medical and ]. In 2014, a Canadian news investigation by '']'' reported the discovery of myclobutanil in ] produced by at least one government licensed grower.<ref>{{cite news|url=https://www.theglobeandmail.com/news/national/canadians-not-told-about-banned-pesticide-found-in-medical-marijuana-supply/article33443887/|title=Canadians not told about banned pesticide found in medical pot supply|via=The Globe and Mail}}</ref> In September 2019, ] commissioned ] to test ] cartridges for ], pesticides, and residual solvents like ]; pesticides, including myclobutanil, was found in products from unlicensed dealers.<ref name=NBCCannaSafe>{{cite web |url=https://www.nbcnews.com/health/vaping/tests-show-bootleg-marijuana-vapes-tainted-hydrogen-cyanide-n1059356 |title=Tests show bootleg marijuana vapes tainted with hydrogen cyanide|website=]}}</ref> In Michigan, the current state action limit for myclobutanil is 200 ] in cannabis products.<ref>{{cite web|url=https://www.michigan.gov/documents/lara/Department_Banned_Pesticide_Active_Ingredient_List_620039_7.pdf&pdf=true | title = Technical Bulletin}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{PPDB|478}} |
|
|
* |
|
|
|
|
|
] |
|
|
] |
|
|
] |