| Revision as of 17:22, 20 July 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits svg← Previous edit |
Latest revision as of 23:44, 5 June 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
| (11 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401254748 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 440512804 |
|
| ImageFile = NOBIN.png |
|
| ImageFile = NOBIN.png |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| IUPACName = 2-Amino-2′-hydroxy-1,1′-binaphthalene |
|
| PIN = 2′-Amino-2-ol |
|
| OtherNames = 2-Amino-2'-hydroxy-1,1'-binaphthyl |
|
| OtherNames = 2-Amino-2'-hydroxy-1,1'-binaphthyl |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 134532-03-9 |
|
| CASNo = 134532-03-9 |
|
|
| CASNo_Comment = |
|
| CASOther = <br>137848-28-3 (''R'')<br>137848-29-4 (''S'') |
|
|
|
| CASNo2_Ref = {{cascite|changed|??}} |
| ⚫ |
| PubChem = |
|
|
|
| CASNo2 = 137848-28-3 |
|
|
| CASNo2_Comment = (''R'') |
|
|
| CASNo3_Ref = {{cascite|changed|??}} |
|
|
| CASNo3 = 137848-29-4 |
|
|
| CASNo3_Comment = (''S'') |
|
⚫ |
| PubChem = 3617797 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 2852904 |
|
|
| InChI = 1/C20H15NO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,22H,21H2 |
|
|
| InChIKey = HIXQCPGXQVQHJP-UHFFFAOYAR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H15NO/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12,22H,21H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = HIXQCPGXQVQHJP-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = C493913 |
|
| SMILES = OC1=C(C2=C(C=CC=C3)C3=CC=C2N)C4=CC=CC=C4C=C1 |
|
| SMILES = OC1=C(C2=C(C=CC=C3)C3=CC=C2N)C4=CC=CC=C4C=C1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=20|H=15|N=1|O=1 |
|
| C=20 | H=15 | N=1 | O=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 18: |
Line 37: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
| Line 37: |
Line 56: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |