| Revision as of 10:14, 30 June 2011 editThecheesykid (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers21,335 editsm Reverted edits by 217.155.148.230 (talk) identified as unconstructive (HG)← Previous edit |
Latest revision as of 17:50, 3 April 2022 edit undo1234qwer1234qwer4 (talk | contribs)Extended confirmed users, Page movers197,945 editsm correct param for MOS:REFSPACE (cf. Special:Diff/1065499921) (via WP:JWB) |
| (33 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=January 2011}} |
|
|
|
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 408192349 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = 1-Naptholphthalein.svg |
|
|
⚫ |
| verifiedrevid = 437024131 |
|
⚫ |
| ImageFile = 1-Naphtholphthalein.svg |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
| ImageName = Skeletal formula |
|
| ImageName = Skeletal formula |
|
| ImageFile1 = Naphtholphthalein-3D-balls.png |
|
| ImageFile1 = Naphtholphthalein-3D-balls.png |
|
| ImageName1 = Ball-and-stick model |
|
| ImageName1 = Ball-and-stick model |
|
| IUPACName = 3,3-bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1-one |
|
| PIN = 3,3-Bis(4-hydroxynaphthalen-1-yl)-2-benzofuran-1(3''H'')-one |
|
| OtherNames = 1-Naphtholphthalein, alpha-naphtholphthalein, naphtholphthalein blue |
|
| OtherNames = 1-Naphtholphthalein, alpha-naphtholphthalein, naphtholphthalein blue |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 596-01-0 |
|
| CASNo = 596-01-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2QEG1706NN |
|
| PubChem = 68993 |
|
| PubChem = 68993 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 62215 |
|
| SMILES = C1=CC=C2C(=C1)C(=CC=C2O)C3(C4=CC=CC=C4C(=O)O3)C5=CC=C(C6=CC=CC=C65)O |
|
| SMILES = C1=CC=C2C(=C1)C(=CC=C2O)C3(C4=CC=CC=C4C(=O)O3)C5=CC=C(C6=CC=CC=C65)O |
|
| Beilstein = 97816 }} |
|
| Beilstein = 97816 |
|
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 28 | H = 18 | O = 4 |
|
| C=28 | H=18 | O=4 |
|
| Appearance = Colorless-redish to blue-green solid |
|
| Appearance = Colorless-reddish to blue-green solid |
|
| Density = |
|
| Density = |
|
| MeltingPtC = 254 |
|
| MeltingPtC = 238-240 |
|
|
| MeltingPt_ref = <ref name="sigma"></ref> |
|
| BoilingPt = |
|
|
| Solubility = Insoluble}} |
|
| BoilingPt = |
|
|
| Solubility = Insoluble |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = Irritant ('''Xi''') |
|
| MainHazards = Irritant |
|
|
| GHSPictograms = {{GHS07}}<ref name="sigma" /> |
| ⚫ |
| FlashPt = |
|
|
|
| GHSSignalWord = Warning |
|
| Autoignition = }} |
|
|
|
| HPhrases = {{H-phrases|315|319|335}}<ref name="sigma" /> |
|
|
| PPhrases = {{P-phrases|261|305+351+338}}<ref name="sigma" /> |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''α-Naphtholphthalein''' (C<sub>28</sub>H<sub>18</sub>O<sub>4</sub>) is a ]. |
|
'''α-Naphtholphthalein''' (C<sub>28</sub>H<sub>18</sub>O<sub>4</sub>) is a ] used as a ] with a visual transition from colorless/reddish to ] at pH 7.3–8.7. {{pH_indicator|indicator_name=Naphtholphthalein|low_pH=7.3|high_pH=8.7|low_pH_color=pink|high_pH_color=#0D98BA|high_pH_text=white}} |
|
|
|
|
|
==External links== |
|
==References== |
|
|
{{reflist}} |
|
*http://www.sigmaaldrich.com/catalog/search/ProductDetail?ProdNo=N8257&Brand=SIGMA |
|
|
|
|
|
|
{{DEFAULTSORT:Naphtholphthalein, α-}} |
|
{{DEFAULTSORT:Naphtholphthalein}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|