| Revision as of 17:04, 22 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 21:15, 8 September 2024 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,019 edits Reference edited with ProveIt #proveit | Add: bibcode, pages, issue, volume, journal, date, title, authors 1-2. | Use this tool. Report bugs. | #UCB_GadgetTag: ProveIt edit |
| (37 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 406619012 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 415344475 |
|
| Name = Neohesperidose |
|
| Name = Neohesperidose |
|
| ImageFile = Neohesperidose.svg |
|
| ImageFile = Neohesperidose.svg |
|
|
| ImageFile2 = Neohesperidose 3D BS.png |
|
| ImageSize = 200px |
|
|
|
| IUPACName = α-<small>L</small>-Rhamnopyranosyl-(1→2)-<small>D</small>-glucose |
|
| IUPACName = (2''S'',3''R'',4''R'',5''R'',6''S'')-2-methyl-6-oxyoxane-3,4,5-triol |
|
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-3,4,5,6-Tetrahydroxy-2-<nowiki/>{oxy}hexanal |
|
| OtherNames = 2-O-alpha-L-Rhamnopyranosyl-D-glucopyranose<br>2-O-alpha-L-Rhamnosyl-D-glucose<br>2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose |
|
| OtherNames = 2-O-alpha-L-Rhamnopyranosyl-D-glucopyranose<br>2-O-alpha-L-Rhamnosyl-D-glucose<br>2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 17074-02-1 |
|
|
| PubChem = 441426 |
|
| CASNo = 17074-02-1 |
|
| EINECS = |
|
| PubChem = 441426 |
|
|
| EINECS = |
|
| SMILES = CC1C(C(C(C(O1)OC2C(C(C(OC2O)CO)O)O)O)O)O |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 390159 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| Formula= C<sub>12</sub>H<sub>22</sub>O<sub>10</sub> |
|
|
|
| ChEBI = 73992 |
| ⚫ |
| MolarMass = 326.29 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ExactMass = 326.121297 |
|
|
| Appearance = |
|
| ChEMBL = 1651520 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
| ⚫ |
| Density = |
|
|
| MeltingPt = |
|
| KEGG = C08244 |
|
|
| SMILES = O(1(O)O(CO)(O)1O)2O((O)(O)2O)C |
| ⚫ |
| BoilingPt = |
|
|
|
| InChI = 1/C12H22O10/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12-/m0/s1 |
| ⚫ |
| Solubility = |
|
|
|
| InChIKey = VSRVRBXGIRFARR-OUEGHFHCBJ |
| ⚫ |
}} |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| StdInChI = 1S/C12H22O10/c1-3-5(14)7(16)9(18)12(20-3)22-10-8(17)6(15)4(2-13)21-11(10)19/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12-/m0/s1 |
| ⚫ |
| MainHazards = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| FlashPt = |
|
|
|
| StdInChIKey = VSRVRBXGIRFARR-OUEGHFHCSA-N |
|
| Autoignition = |
|
|
}} |
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>10</sub> |
|
⚫ |
| MolarMass = 326.29 g/mol |
|
|
| Appearance = |
|
⚫ |
| Density = 1.662 g/mL |
|
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherCompounds = ]<br />] |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Neohesperidose''' is the ] which is present in some ] ]s. It can be found in species of '']''<ref>, in species of '']''<ref></ref> |
|
'''Neohesperidose''' is the ] which is present in some ]s. It can be found in species of '']''.<ref>{{cite journal | url=https://www.sciencedirect.com/science/article/abs/pii/S0040402001992117 | doi=10.1016/S0040-4020(01)99211-7 | title=Flavonoids of citrus—VI: The structure of neohesperidose | journal=Tetrahedron | date=January 1963 | volume=19 | issue=5 | pages=773–782 | last1=Horowitz | first1=R. M. | last2=Gentili | first2=Bruno }}</ref><ref name="Andersen">{{Cite journal |doi=10.1016/0031-9422(89)80039-1 |title=Delphinidin-3-neohesperidoside and cyanidin-3- neohesperidoside from receptacles of Podocarpus species |date=1989 |last1=Andersen |first1=Oyvind M. |journal=Phytochemistry |volume=28 |issue=2 |pages=495–497 |bibcode=1989PChem..28..495A }}</ref> |
|
|
|
|
|
==Neohesperidosides== |
|
== Neohesperidosides == |
| ⚫ |
* ]-3-neohesperidoside |
|
| ⚫ |
* ]-3-neohesperidoside |
|
| ⚫ |
* ] or ] 7-O-neohesperidoside |
|
| ⚫ |
* ] found in '']''<ref>A novel cytotoxic flavonoid glycoside from Physalis angulata. N. Ismail and M. Alam, Fitoterapia, Volume 72, Issue 6, August 2001, Pages 676-679, {{doi|10.1016/S0367-326X(01)00281-7}}</ref> |
|
|
|
|
|
|
⚫ |
* ]-3-neohesperidoside<ref name=Andersen/> |
| ⚫ |
==References== |
|
|
⚫ |
* ]-3-neohesperidoside<ref name=Andersen/> |
| ⚫ |
* |
|
|
⚫ |
* ] or ] 7-''O''-neohesperidoside |
|
⚫ |
* ] found in '']''<ref>{{Cite journal |doi=10.1016/S0367-326X(01)00281-7 |title=A novel cytotoxic flavonoid glycoside from Physalis angulata |date=2001 |last1=Ismail |first1=N. |last2=Alam |first2=M. |journal=Fitoterapia |volume=72 |issue=6 |pages=676–679 }}</ref> |
|
|
* ] (] 7-''O''-neohesperidoside) |
|
|
* ] (] 7-''O''-neohesperidoside) |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
⚫ |
* {{dead link|date=March 2019|bot=medic}}{{cbignore|bot=medic}} |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
== External links == |
|
* |
|
* |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|