| Revision as of 19:08, 11 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antiinfective-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 13:45, 30 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,023 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444197399 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 1-{(''E'')-2-(methylthio)-1-vinyl}-1''H''-imidazole |
|
|
⚫ |
| verifiedrevid = 449870016 |
|
⚫ |
| IUPAC_name = 1-{(''E'')-2-(Methylthio)-1-vinyl}-1''H''-imidazole |
|
| image = Neticonazole.svg |
|
| image = Neticonazole.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|neticonazole}} |
|
| Drugs.com = {{drugs.com|international|neticonazole}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = |
|
| CAS_number = 130726-68-0 |
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
| ATC_prefix = D01 |
|
|
| ATC_suffix = AC21 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 5282433 |
|
| PubChem = 5282433 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = KVL61ZF9UO |
|
| UNII = KVL61ZF9UO |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445587 |
|
|
| ChEBI = 135281 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=17 | H=22 | N=2 | O=1 | S=1 |
|
| C=17 | H=22 | N=2 | O=1 | S=1 |
|
|
| smiles = CCCCCOc1ccccc1/C(=C\SC)/n2ccnc2 |
|
| molecular_weight = 302.43 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H22N2OS/c1-3-4-7-12-20-17-9-6-5-8-15(17)16(13-21-2)19-11-10-18-14-19/h5-6,8-11,13-14H,3-4,7,12H2,1-2H3/b16-13+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = VWOIKFDZQQLJBJ-DTQAZKPQSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Neticonazole''' (]) is an ] ] for the treatment of fungal skin infections.<ref>{{cite journal |author=Nimura K, Niwano Y, Ishiduka S, Fukumoto R |title=Comparison of in vitro antifungal activities of topical antimycotics launched in 1990s in Japan |journal=Int. J. Antimicrob. Agents |volume=18 |issue=2 |pages=173–8 |year=2001 |month=August |pmid=11516941 |doi= 10.1016/S0924-8579(01)00365-X|url=http://linkinghub.elsevier.com/retrieve/pii/S0924-8579(01)00365-X}}</ref><ref>{{cite journal |author=Tsuboi R, Matsumoto T, Ogawa H |title=Hyperkeratotic chronic tinea pedis treated with neticonazole cream. Neticonazole Study Group |journal=Int. J. Dermatol. |volume=35 |issue=5 |pages=371–3 |year=1996 |month=May |pmid=8734665 |doi= 10.1111/j.1365-4362.1996.tb03644.x|url=}}</ref> |
|
'''Neticonazole''' (]) is an ] ] for the treatment of fungal skin infections.<ref>{{cite journal |vauthors=Nimura K, Niwano Y, Ishiduka S, Fukumoto R |title=Comparison of in vitro antifungal activities of topical antimycotics launched in 1990s in Japan |journal=Int. J. Antimicrob. Agents |volume=18 |issue=2 |pages=173–8 |date=August 2001 |pmid=11516941 |doi= 10.1016/S0924-8579(01)00365-X}}</ref><ref>{{cite journal |vauthors=Tsuboi R, Matsumoto T, Ogawa H |title=Hyperkeratotic chronic tinea pedis treated with neticonazole cream. Neticonazole Study Group |journal=Int. J. Dermatol. |volume=35 |issue=5 |pages=371–3 |date=May 1996 |pmid=8734665 |doi= 10.1111/j.1365-4362.1996.tb03644.x|s2cid=34516725 }}</ref> |
|
|
|
|
|
Neticonazole is only approved for use in ]. It is sold as a topical ointment under the tradename '''Atolant'''. |
|
Neticonazole is only approved for use in ]. It is sold as a topical ointment under the tradename '''Atolant'''.{{cn|date=December 2022}} |
|
|
|
|
|
==References== |
|
==References== |
| Line 50: |
Line 61: |
|
{{Antifungals}} |
|
{{Antifungals}} |
|
|
|
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|