| Revision as of 13:34, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 22:03, 20 February 2023 edit undoMarbletan (talk | contribs)Extended confirmed users5,333 edits references |
| (17 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 381152572 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Methylnicotinamide.png |
|
|
⚫ |
| verifiedrevid = 428752125 |
| ⚫ |
|ImageSize=150px |
|
|
⚫ |
| ImageFile=Methylnicotinamide.png |
| ⚫ |
|IUPACName=''N''-Methylpyridine-3-carboxamide |
|
|
⚫ |
| ImageSize=150px |
| ⚫ |
|OtherNames=''N''-Methylnicotinamide; ''N''-Methylniacinamide |
|
|
|
| ImageAlt=Skeletal formula of nicotinyl methylamide |
|
|
| ImageFile1=Nicotinyl methylamide 3D ball.png |
|
|
| ImageSize1=180 |
|
|
| ImageAlt1=Ball-and-stick model of the nicotinyl methylamide molecule |
|
⚫ |
| PIN=''N''-Methylpyridine-3-carboxamide |
|
⚫ |
| OtherNames=''N''-Methylnicotinamide; ''N''-Methylniacinamide |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations=NAN |
|
| Abbreviations=NAN{{Citation needed|date=January 2012}} |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=114-33-0 |
|
| CASNo=114-33-0 |
| ⚫ |
| PubChem=64950 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=CNC(=O)C1=CN=CC=C1 |
|
|
|
| UNII = X3I82S5L8I |
|
| ATC_prefix = A05 |
|
|
⚫ |
| PubChem=64950 |
|
| ATC_suffix = AB01 |
|
|
|
| DrugBank = DB08840 |
|
⚫ |
| SMILES=CNC(=O)C1=CN=CC=C1 |
|
|
| InChI = 1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
|
|
| InChIKey = ZYVXHFWBYUDDBM-UHFFFAOYAC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZYVXHFWBYUDDBM-UHFFFAOYSA-N |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 58476 |
|
|
| EINECS = 204-046-4 |
|
|
| MeSHName = C008472 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 64399 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7|H=8|N=2|O=1 |
|
| C=7 | H=8 | N=2 | O=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt =}} |
|
| Autoignition=}} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|Section6={{Chembox Pharmacology |
|
| AdminRoutes = |
|
| ATCCode_prefix = A05 |
|
| Bioavail = |
|
| ATCCode_suffix = AB01 |
|
| Metabolism = |
|
| AdminRoutes = |
|
| HalfLife = |
|
| Bioavail = |
|
| ProteinBound = |
|
| Metabolism = |
|
| Excretion = |
|
| HalfLife = |
|
| Legal_status = |
|
| ProteinBound = |
|
| Legal_US = |
|
| Excretion = |
|
| Legal_UK = |
|
| Legal_status = |
|
| Legal_AU = |
|
| Legal_US = |
|
| Legal_CA = |
|
| Legal_UK = |
|
| PregCat = |
|
| Legal_AU = |
|
| PregCat_AU = |
|
| Legal_CA = |
|
|
| Pregnancy_category = |
|
| PregCat_US = }} |
|
|
|
| Pregnancy_AU = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Nicotinyl methylamide''' is a drug used in bile therapy. It is also a ] of ] (]). |
|
'''Nicotinyl methylamide''' is an experimental drug with no approved indication.<ref>{{cite web | url = https://go.drugbank.com/drugs/DB08840 | title = N-methylnicotinamide | work = ] }}</ref> It is also a ] of ] (]) and is found in urine.<ref>{{cite web | url = https://drugs.ncats.io/drug/X3I82S5L8I | title = Nicotinyl methylamide | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> |
|
|
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{Unreferenced|date=June 2009}} |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
| Line 56: |
Line 76: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |