| Revision as of 11:48, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 17:04, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids |
| (22 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 401491579 |
|
| verifiedrevid = 424843032 |
|
|Name = Nω-Nitro-<small>L</small>-arginine |
|
| Name = Nω-Nitro-{{sm|l}}-arginine |
|
|ImageFile=Nitroarginine.png |
|
| ImageFile=Nitroarginine.png |
|
|ImageSize=200px |
|
| ImageSize=250px |
|
|IUPACName=(2''S'')-2-Amino-5-<nowiki>amino]pentanoic acid |
|
| IUPACName=(2''S'')-2-Amino-5-<nowiki>amino]pentanoic acid |
|
|OtherNames=N5-(nitroamidino)-L-Ornithine; (+)-NG-Nitroarginine; NG-nitro-<small>L</small>-Arginine, <small>L</small>-NG-Nitroarginine; L-NNA; L-NOARG; NG-Nitro-<small>L</small>-arginine; NG-Nitroarginine; NOLA; NSC 53662; Nitro-<small>L</small>-arginine; Nω-Nitro-<small>L</small>-arginine; Nω-Nitro-<small>L</small>-arginine; ω-Nitro-<small>L</small>-arginine; ω-Nitroarginine |
|
| OtherNames=N5-(nitroamidino)-{{sm|l}}-Ornithine; (+)-NG-Nitroarginine; NG-nitro-{{sm|l}}-Arginine, {{sm|l}}-NG-Nitroarginine; L-NNA; L-NOARG; NG-Nitro-{{sm|l}}-arginine; NG-Nitroarginine; NOLA; NSC 53662; Nitro-{{sm|l}}-arginine; Nω-Nitro-{{sm|l}}-arginine; Nω-Nitro-{{sm|l}}-arginine; ω-Nitro-{{sm|l}}-arginine; ω-Nitroarginine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=2149-70-4 |
|
| CASNo=2149-70-4 |
| ⚫ |
| PubChem=440005 |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| SMILES=OC((N)CCCNC(N()=O)=N)=O |
|
|
|
| ChEMBL = 227744 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 7O8V7H6P2J |
|
⚫ |
| PubChem=440005 |
|
⚫ |
| SMILES=OC((N)CCCNC(N()=O)=N)=O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=6 | H=13 | N=5 | O=4 |
|
| Formula=C<sub>6</sub>H<sub>13</sub>N<sub>5</sub>O<sub>4</sub> |
|
|
|
| Appearance= |
|
| MolarMass=219.20 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Nitroarginine''', or Nω-nitro-<small>L</small>-arginine, is a ] derivative of the ] ]. It is an ] of ] and hence a vaso-constrictor and coronary constrictor. As such, it finds widespread use as a biochemical tool in the study of ] and its biological effects.<ref>{{cite journal | doi = 10.1007/BF00966685 | title = Chronic administration of a nitric oxide synthase inhibitor, N omega-nitro-L-arginine, and drug-induced increase in cerebellar cyclic GMP in vivo | author = Bansinath M; Arbabha B; Turndorf H; Garg U C | journal = Neurochemical research | year = 1993 | volume = 18 | issue = 10 | pages = 1063–6 | pmid = 7504789}}</ref> |
|
'''Nitroarginine''', or '''''N''<sup>ω</sup>-nitro-{{sm|l}}-arginine''', also known as '''L-NOARG''', is a ] derivative of the ] ].<ref>{{Cite journal|last1=Moore|first1=P. K.|last2=Al‐Swayeh|first2=O. A.|last3=Chong|first3=N. W. S.|last4=Evans|first4=R. A.|last5=Gibson|first5=A.|date=1990|title=l-NG-nitro arginine (l-NOARG), a novel, l-arginine-reversible inhibitor of endothelium-dependent vasodilatation in vitro|url= |journal=British Journal of Pharmacology|language=en|volume=99|issue=2|pages=408–412|doi=10.1111/j.1476-5381.1990.tb14717.x|issn=1476-5381|pmc=1917379|pmid=2328404}}</ref> It is an ] of ] and hence a ]. As such, it finds widespread use as a biochemical tool in the study of ] and its biological effects.<ref>{{cite journal | doi = 10.1007/BF00966685 | title = Chronic administration of a nitric oxide synthase inhibitor, ''N''<sup>ω</sup>-nitro-L-arginine, and drug-induced increase in cerebellar cyclic GMP in vivo |vauthors=Bansinath M, Arbabha B, Turndorf H, Garg UC | journal = Neurochemical Research | year = 1993 | volume = 18 | issue = 10 | pages = 1063–6 | pmid = 7504789| s2cid = 2447933 }}</ref> |
|
|
|
|
|
Nitroarginine has been used in research studying coronary constriction, in the presence of ] vasodilatation was unaffected by nitroarginine.<ref>{{cite journal | title = N-nitro L-arginine causes coronary vasoconstriction and inhibits endothelium-dependent vasodilatation in anaesthetized greyhounds| author = O.L. Woodman; G.J. Dusting | journal = Br. J. Pharmacol. | year = 1991 | volume = 103 | pages = 1407–1410 | pmid = 1909199 | issue = 2 | pmc = 1908370}}</ref> |
|
Nitroarginine has been used in research studying coronary constriction, and it was found that, in the presence of ] vasodilatation was unaffected by nitroarginine.<ref>{{cite journal | title = N-nitro L-arginine causes coronary vasoconstriction and inhibits endothelium-dependent vasodilatation in anaesthetized greyhounds|author1=O.L. Woodman |author2=G.J. Dusting | journal = Br. J. Pharmacol. | year = 1991 | volume = 103 | pages = 1407–1410 | pmid = 1909199 | issue = 2 | pmc = 1908370 | doi=10.1111/j.1476-5381.1991.tb09802.x}}</ref> Due to the presence of all three isoforms of nitric oxide synthase in ] tissue in the ], research has also been conducted on how its inhibition might affect ] and ] half-life in the striatal ].<ref>{{Cite journal|last1=Prieto|first1=Sonia Guerrero|last2=Silva|first2=João Carlos dos Santos|last3=de Lima|first3=Mairon Oliveira|last4=Almeida|first4=Maria Camila|last5=Echeverry|first5=Marcela Bermúdez|date=February 2019|title=Cross-tolerance between nitric oxide synthase inhibition and atypical antipsychotics modify nicotinamide-adenine-dinucleotide phosphate-diaphorase activity in mouse lateral striatum|url=http://insights.ovid.com/crossref?an=00008877-201902000-00007|journal=Behavioural Pharmacology|language=en|volume=30|issue=1|pages=67–78|doi=10.1097/FBP.0000000000000406|issn=0955-8810|pmid=29664745|s2cid=4933721|via=Ovid}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Nitric oxide signaling}} |
| ⚫ |
] |
|
| ⚫ |
] |
|
|
] |
|
|
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
|
|
{{cardiovascular-drug-stub}} |