| Revision as of 05:44, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 16:33, 7 November 2022 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Pyridines; added Category:4-Pyridyl compounds using HotCat |
| (12 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444208861 |
|
⚫ |
| ImageFile= nolatrexed.png |
|
⚫ |
| ImageSize=200px |
|
|
| PIN = 2-Amino-6-methyl-5-quinazolin-4(1''H'')-one |
|
⚫ |
| OtherNames= |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = K75ZUN743Q |
|
| UNII = K75ZUN743Q |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| verifiedrevid = 443732022 |
|
|
⚫ |
| CASNo=147149-76-6 |
| ⚫ |
|ImageFile= nolatrexed.png |
|
|
⚫ |
| PubChem=108189 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| SMILES=CC1=C(C2=C(C=C1)NC(=NC2=O)N)SC3=CC=NC=C3 |
|
|IUPACName=2-Amino-6-methyl-5-(4-pyridylthio)-1''H''-quinazolin-4-one |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
|OtherNames= |
|
|
|
| ChemSpiderID = 97268 |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| InChI = 1/C14H12N4OS/c1-8-2-3-10-11(13(19)18-14(15)17-10)12(8)20-9-4-6-16-7-5-9/h2-7H,1H3,(H3,15,17,18,19) |
| ⚫ |
| CASNo=147149-76-6 |
|
|
|
| InChIKey = XHWRWCSCBDLOLM-UHFFFAOYAK |
| ⚫ |
| PubChem=108189 |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| SMILES=CC1=C(C2=C(C=C1)NC(=NC2=O)N)SC3=CC=NC=C3 |
|
|
|
| StdInChI = 1S/C14H12N4OS/c1-8-2-3-10-11(13(19)18-14(15)17-10)12(8)20-9-4-6-16-7-5-9/h2-7H,1H3,(H3,15,17,18,19) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XHWRWCSCBDLOLM-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>12</sub>N<sub>4</sub>OS |
|
| Formula=C<sub>14</sub>H<sub>12</sub>N<sub>4</sub>OS |
|
| MolarMass=284.34 g/mol |
|
| MolarMass=284.34 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Nolatrexed''' is a ].<ref name="pmid9918208">{{cite journal |author=Hughes AN, Rafi I, Griffin MJ, ''et al.'' |title=Phase I studies with the nonclassical antifolate nolatrexed dihydrochloride (AG337, THYMITAQ) administered orally for 5 days |journal=Clin. Cancer Res. |volume=5 |issue=1 |pages=111–8 |year=1999 |month=January |pmid=9918208 |doi= |url=http://clincancerres.aacrjournals.org/cgi/pmidlookup?view=long&pmid=9918208}}</ref> |
|
'''Nolatrexed''' is a ].<ref name="pmid9918208">{{cite journal |vauthors=Hughes AN, Rafi I, Griffin MJ, etal |title=Phase I studies with the nonclassical antifolate nolatrexed dihydrochloride (AG337, THYMITAQ) administered orally for 5 days |journal=Clin. Cancer Res. |volume=5 |issue=1 |pages=111–8 |date=January 1999 |pmid=9918208 |url=http://clincancerres.aacrjournals.org/cgi/pmidlookup?view=long&pmid=9918208}}</ref><ref>{{cite web|title=Nolatrexed|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=108188|website=PubChem.gov|publisher=Pub Chem|access-date=12 August 2014}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |