| Revision as of 15:35, 30 July 2010 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): musculoskeletal-drug-stub← Previous edit |
Latest revision as of 12:40, 13 May 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,578 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (20 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = bis(phosphonic acid) |
|
|
|
| Watchedfields = changed |
|
| image = Olpadronate.png |
|
|
|
| verifiedrevid = 376276522 |
| ⚫ |
| CAS_number = 63132-39-8 |
|
|
⚫ |
| IUPAC_name = bis(phosphonic acid) |
|
| CAS_supplemental = |
|
|
|
| image = Olpadronic acid.svg |
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| ATC_supplemental = |
|
| ⚫ |
| PubChem = 198716 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| chemical_formula = |
|
| ⚫ |
| C=5 | H=15 | N=1 | O=7 | P=2 |
|
|
| molecular_weight = 263.12 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
| ⚫ |
}} |
|
|
|
|
|
|
|
<!--Clinical data--> |
|
'''Olpadronic acid''' (]; salt form ''olpadronate'') is a ]. |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 63132-39-8 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| ATC_supplemental = |
|
⚫ |
| PubChem = 198716 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 874HHB2V3S |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 171999 |
|
|
| smiles = CN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C5H15NO7P2/c1-6(2)4-3-5(7,14(8,9)10)15(11,12)13/h7H,3-4H2,1-2H3,(H2,8,9,10)(H2,11,12,13) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = UGEPSJNLORCRBO-UHFFFAOYSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=5 | H=15 | N=1 | O=7 | P=2 |
|
⚫ |
}} |
|
|
|
|
|
|
'''Olpadronic acid''' (]; salt form ''olpadronate'') is a ]. It is used as part of a cancer symptom treatment support in cases of high blood calcium levels (hypercalcemia) and the reduction of fractures/pain that are the result of when cancer spreads to the bone (metastasis).<ref>{{Cite web|url=http://chemocare.com/chemotherapy/drug-info/Zoledronic-Acid.aspx|title=Zoledronic Acid - Chemotherapy Drugs - Chemocare|website=chemocare.com|access-date=2018-12-23}}</ref> |
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Bisphosphonates}} |
|
{{Bisphosphonates}} |