| Revision as of 14:38, 24 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456763669 of page Olsalazine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG'). |
Latest revision as of 15:41, 12 April 2024 edit Marbletan (talk | contribs)Extended confirmed users5,340 edits no longer a stub |
| Line 1: |
Line 1: |
|
|
{{Short description|Pharmaceutical drug}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{more citations needed|date=January 2021}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 402512533 |
|
| verifiedrevid = 462265233 |
|
⚫ |
| image = Olsalazine.svg |
|
| IUPAC_name = 5--2-hydroxybenzoic acid |
|
| ⚫ |
| image = Olsalazine.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Dipentum |
|
| tradename = Dipentum |
|
| Drugs.com = {{drugs.com|monograph|dipentum}} |
|
| Drugs.com = {{drugs.com|monograph|olsalazine-sodium}} |
|
| MedlinePlus = a601088 |
|
| MedlinePlus = a601088 |
|
|
| DailyMedID = Olsalazine |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| pregnancy_AU = C |
|
| pregnancy_US = C<!-- A / B / C / D / X --> |
|
|
|
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Olsalazine (Dipentum) Use During Pregnancy | website=Drugs.com | date=6 September 2019 | url=https://www.drugs.com/pregnancy/olsalazine.html | access-date=9 October 2020}}</ref> |
| ⚫ |
| pregnancy_category = |
|
|
|
| pregnancy_US = C |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" /> |
|
⚫ |
| pregnancy_category = |
|
|
| legal_AU = S4 |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = POM |
|
| legal_US = Rx-only<!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = Rx-only |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = ] |
|
|
| ATC_prefix = A07 |
|
⚫ |
| ATC_suffix = EC03 |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = 99% |
|
| protein_bound = 99% |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 0.9 hours |
|
| elimination_half-life = 0.9 hours |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| index2_label = as salt |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 15722-48-2 |
|
| CAS_number = 15722-48-2 |
|
| ATC_prefix = A07 |
|
| PubChem = 22419 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| ATC_suffix = EC03 |
|
|
| PubChem = 6003770 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB01250 |
|
| DrugBank = DB01250 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 41: |
Line 44: |
|
| UNII = ULS5I8J03O |
|
| UNII = ULS5I8J03O |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: D00727 --> |
|
| KEGG = D08295 |
|
|
| KEGG2_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG2 = D00727 |
|
|
| ChEBI_Ref = |
|
|
| ChEBI = |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 571540 --> |
|
| ChEMBL = 425 |
|
|
| NIAID_ChemDB = |
|
| chemical_formula = |
|
|
| C=14 | H=10 | N=2 | O=6 |
|
| PDB_ligand = |
|
|
| synonyms = |
|
| molecular_weight = 302.239g/mol |
|
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=14 | H=10 | N=2 | O=6 |
|
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2 |
|
| smiles = O=C(O)c1cc(ccc1O)/N=N/c2cc(C(O)=O)c(O)cc2 |
|
| InChI = 1/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ |
|
|
| InChIKey = QQBDLJCYGRGAKP-FOCLMDBBBJ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ |
|
| StdInChI = 1S/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ |
| Line 55: |
Line 63: |
|
| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N |
|
| StdInChIKey = QQBDLJCYGRGAKP-FOCLMDBBSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Olsalazine''' is an anti-inflammatory medication used in the treatment of ].<ref name="pmid2131213">{{cite journal | vauthors = | title = Olsalazine--a further choice in ulcerative colitis | journal = Drug and Therapeutics Bulletin | volume = 28 | issue = 15 | pages = 57–8 | date = July 1990 | pmid = 2131213 | doi = 10.1136/dtb.28.15.57 | s2cid = 7178709 }}</ref><ref name="pmid1711964">{{cite journal | vauthors = Wadworth AN, Fitton A | title = Olsalazine. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic potential in inflammatory bowel disease | journal = Drugs | volume = 41 | issue = 4 | pages = 647–64 | date = April 1991 | pmid = 1711964 | doi = 10.2165/00003495-199141040-00009 | s2cid = 243654426 }}</ref> It is sold under the brand name '''Dipentum'''.<ref name=Med1>{{cite web |title=Olsalazine Sodium 250 mg Capsules - Summary of Product Characteristics (SmPC) - (emc) |url=https://www.medicines.org.uk/emc/product/3708/smpc#gref |website=www.medicines.org.uk |access-date=9 January 2021}}</ref> |
|
|
|
|
|
Olsalazine itself is a pro-drug of ] (5-aminosalicyclic acid or 5-ASA) and is not absorbed in the small intestine. Instead it continues through to the colon where it is cleaved into two molecules of 5-ASA by ] produced by colonic bacteria. Olsalazine thus exerts its anti-inflammatory effect by its colonic breakdown into 5-ASA which inhibits cyclooxygenase and lipoxygenase thereby reducing prostaglandin and leukotriene production.<ref name=Med1/> |
|
|
|
|
|
==History== |
|
|
Olsalazine gained ] (FDA) approval in 1990. |
|
|
|
|
|
==Supply== |
|
|
The drug is supplied by ]. |
|
|
|
|
|
==Research== |
|
|
In 2006 the Australian biotech company ] received a European patent for a combination therapy for treating constipation-predominant ] that uses olsalazine and the anti-] drug ], for trials the following year.<ref>{{cite news |title=Giaconda gets European patent for drug |url=https://www.smh.com.au/business/giaconda-gets-european-patent-for-drug-20061228-gdp4vv.html |access-date=16 January 2021 |work=The Sydney Morning Herald |date=28 December 2006 |language=en}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Antidiarrheals, intestinal anti-inflammatory/anti-infective agents}} |
|
|
{{Portal bar | Medicine}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |