| Revision as of 18:03, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo← Previous edit |
Latest revision as of 14:39, 3 July 2024 edit undoJorge Stolfi (talk | contribs)Autopatrolled, Extended confirmed users, Rollbackers27,605 edits Description of molecule. Occurrence in pea root nodules. It is *not* D-pinitol. |
| (7 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 444513754 |
|
| verifiedrevid = 449570367 |
|
| ImageFile = ononitol.svg |
|
| ImageFile = ononitol.svg |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = (1''R'',2''S'',3''S'',4''S'',5''S'',6''S'')-6-Methoxycyclohexane-1,2,3,4,5-pentaol |
|
| IUPACName = 4-''O''-methyl-''myo''-inositol |
|
|
| SystematicName = (1''R'',2''S'',3''S'',4''S'',5''S'',6''S'')-6-Methoxycyclohexane-1,2,3,4,5-pentol |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| OtherNames = 4-''O''-Methyl-''myo''-inositol |
|
|
|
| CASNo = 6090-97-7 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = |
|
| PubChem = 164619 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| PubChem = |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 21864849 |
|
| ChemSpiderID = 21864849 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 18266 |
|
| ChEBI = 18266 |
|
|
| DrugBank = DB12969 |
| ⚫ |
| SMILES = COC1C(C(C(C(C1O)O)O)O)O |
|
|
|
| KEGG = C06352 |
|
|
| UNII = A998ME07KR |
|
⚫ |
| SMILES = CO1((((1O)O)O)O)O |
|
| InChI = 1/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6-,7-/m0/s1 |
|
| InChI = 1/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6-,7-/m0/s1 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6-,7-/m0/s1 |
|
| StdInChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6-,7-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DSCFFEYYQKSRSV-GESKJZQWSA-N |
|
| StdInChIKey = DSCFFEYYQKSRSV-GESKJZQWSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7 | H=14 | O=6 |
|
| C=7 | H=14 | O=6 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
|
The ] '''ononitol''' is a derivative of ], specifically 4-O-methyl-''myo''-inositol: an ] that can be described as the result of replacing the ] (–OH) in position 4 of ] by a ]. |
| ⚫ |
'''Ononitol''' is a ]. It is a 4-''O''-methyl-] and is a constituent of '']''.<ref>{{cite journal | title = Ononitol (4-O-methyl-myo-inositol) as a constituent of Medicago sativa | doi=10.1016/0003-9861(62)90261-8 | author = E. A. McComb and V. V. Rendig | journal = Archives of Biochemistry and Biophysics | volume = 99 | issue = 1 | year = 1962 | pages =192–193}}</ref> |
|
|
|
|
|
|
This compound occurs in several organisms. It is one of the predominant soluble carbohydrate derivatives in the ]s of the ] plant created by the bacterium '']'',<ref name=skot1984/> and a constituent of '']''.<ref name=mcco1962/> |
|
|
|
|
|
==References== |
|
==References== |
|
|
<references> |
|
{{reflist}} |
|
|
|
|
|
⚫ |
<ref name=mcco1962>{{cite journal | title = Ononitol (4-O-methyl-myo-inositol) as a constituent of Medicago sativa | doi=10.1016/0003-9861(62)90261-8 | author = E. A. McComb and V. V. Rendig | journal = Archives of Biochemistry and Biophysics | volume = 99 | issue = 1 | year = 1962 | pages =192–193}}</ref> |
|
|
|
|
|
<ref name=skot1984>Lief Skøt, Helge Egsgaard (1984): "Identification of ononitol and O-methyl-''scyllo''-inositol in pea root nodules". ''Planta'', volume 161, pages 32–36. {{doi|10.1007/BF00951457}}</ref> |
|
|
|
|
|
</references> |
|
|
|
|
|
] |
|
] |