| Revision as of 18:04, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 03:40, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (21 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 447709286 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449570565 |
|
| Name = Orobol |
|
| Name = Orobol |
|
| ImageFile = Orobol.svg |
|
| ImageFile = Orobol.svg |
|
| ImageSize = 200px |
|
| ImageSize = 220px |
|
|
| ImageFile1 = Orobol-3D-balls.png |
|
| IUPACName = 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| OtherNames = Isoluteolin<br>Santol<br>5,7,3',4'-Tetrahydroxyisoflavone<br>3',4',5,7-Tetrahydroxyisoflavone |
|
|
|
| ImageAlt1 = Orborol molecule |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| IUPACName = 3′,4′,5,7-Tetrahydroxyisoflavone |
|
|
| SystematicName = 3-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = Isoluteolin<br>Santol<br>5,7,3',4'-Tetrahydroxyisoflavone |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 480-23-9 |
|
| CASNo = 480-23-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = LU8UZM1T51 |
|
| PubChem = 5281801 |
|
| PubChem = 5281801 |
|
| Beilstein=292790 |
|
| Beilstein = 292790 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 69437 |
|
| SMILES = C1=CC(=C(C=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O)O |
|
| SMILES = C1=CC(=C(C=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| ChemSpiderID = 4445113 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| InChI = 1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
|
|
| InChIKey = IOYHCQBYQJQBSK-UHFFFAOYAR |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IOYHCQBYQJQBSK-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = D011794 |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| MolarMass = 286.23 g/mol |
|
| MolarMass = 286.23 g/mol |
|
| ExactMass = 286.047738 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = |
|
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = |
|
|
}} |
|
}} |
|
}} |
|
'''Orobol''' is one of several known ]s. It can be isolated from '']'' or '']''. It is a potent inhibitor of ].<ref></ref><ref> |
|
'''Orobol''' is one of several known ]s. It can be isolated from '']'' or '']''. It is a potent inhibitor of ].<ref></ref><ref>{{Cite web |url=http://grande.nal.usda.gov/ibids/index.php?mode2=detail&origin=ibids_references&therow=249377 |title=Isoflavonoids, genistein, psi-tectorigenin, and orobol, increase cytoplasmic free calcium in isolated rat hepatocytes. Tomonaga, T : Mine, T : Kojima, I : Taira, M : Hayashi, H : Isono, K, 1992 |access-date=2009-09-15 |archive-url=https://web.archive.org/web/20090719234737/http://grande.nal.usda.gov/ibids/index.php?mode2=detail |archive-date=2009-07-19 |url-status=dead }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|