| Revision as of 09:29, 14 August 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: it:Acido ossalsuccinico← Previous edit |
Latest revision as of 05:56, 2 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users2,009 edits Fixes image in dark mode |
| (32 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|date=March 2007}} |
|
{{More citations needed|date=May 2019}} |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 410512622 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444775363 |
|
| ImageFile = Oxalbernsteinsäure.png |
|
| ImageFile = Oxalbernsteinsäure.png |
|
|
| ImageClass = skin-invert |
|
| IUPACName = 1-Oxopropane-1,2,3-tricarboxylic acid |
|
| PIN = 1-Oxopropane-1,2,3-tricarboxylic acid |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 1948-82-9 |
|
|
| PubChem = 972 |
|
| CASNo = 1948-82-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = C(C(C(=O)C(=O)O)C(=O)O)C(=O)O |
|
|
| MeSHName = |
|
| UNII = DFK99PW32K |
|
|
| PubChem = 972 |
| ⚫ |
}} |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| ChEBI = 7815 |
| ⚫ |
| C=6|H=6|O=7 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MolarMass = 190.108 |
|
|
| Appearance = |
|
| ChemSpiderID = 947 |
|
| Density = |
|
| RTECS = |
|
| MeltingPt = |
|
| MeSHName = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
| ⚫ |
| BoilingPt = |
|
|
|
| KEGG = C05379 |
| ⚫ |
}} |
|
|
⚫ |
| SMILES = C(C(C(=O)C(=O)O)C(=O)O)C(=O)O |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| InChI = 1/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13) |
|
| Solubility = |
|
|
|
| InChIKey = UFSCUAXLTRFIDC-UHFFFAOYAK |
| ⚫ |
| MainHazards = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| FlashPt = |
|
|
|
| StdInChI = 1S/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13) |
|
| Autoignition = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
}} |
|
|
|
| StdInChIKey = UFSCUAXLTRFIDC-UHFFFAOYSA-N |
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=6 | H=6 | O=7 |
|
⚫ |
| MolarMass = 190.108 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
'''Oxalosuccinic acid''' is a substrate of the ]. It is acted upon by ]. Salts and ]s of oxalosuccinic acid are known as '''oxalosuccinates'''. |
|
'''Oxalosuccinic acid''' is a substrate of the ]. It is acted upon by ]. Salts and ]s of oxalosuccinic acid are known as '''oxalosuccinates'''. |
|
|
|
|
|
|
Oxalosuccinic acid/oxalosuccinate is an unstable 6-carbon intermediate in the ]. It's a ], formed during the ] of ] to ], which is catalyzed by the enzyme isocitrate dehydrogenase. Isocitrate is first oxidized by coenzyme ] to form oxalosuccinic acid/oxalosuccinate.<ref>{{cite journal | vauthors = Ochoa S | title = Biosynthesis of tricarboxylic acids by carbon dioxide fixation; the preparation and properties of oxalosuccinic acid | journal = The Journal of Biological Chemistry | volume = 174 | issue = 1 | pages = 115–22 | date = May 1948 | doi = 10.1016/S0021-9258(18)57381-6 | pmid = 18914069 | url = http://www.jbc.org/content/174/1/115 | doi-access = free }}</ref> Oxalosuccinic acid is both an alpha-keto and a beta-keto acid (an unstable compound) and it is the beta-ketoic property that allows the loss of carbon dioxide in the enzymatic reaction in conversion to the five-carbon molecule ].<ref>{{cite journal | vauthors = Romkina AY, Kiriukhin MY | title = Biochemical and molecular characterization of the isocitrate dehydrogenase with dual coenzyme specificity from the obligate methylotroph Methylobacillus Flagellatus | journal = PLOS ONE | volume = 12 | issue = 4 | pages = e0176056 | date = 2017-04-19 | pmid = 28423051 | pmc = 5397045 | doi = 10.1371/journal.pone.0176056 | bibcode = 2017PLoSO..1276056R | doi-access = free }}</ref> |
| ⚫ |
{{Citric acid cycle}} |
|
|
|
|
|
|
==References== |
|
⚫ |
<references />{{Citric acid cycle}} |
|
|
|
|
|
{{DEFAULTSORT:Oxalosuccinic Acid}} |
|
{{DEFAULTSORT:Oxalosuccinic Acid}} |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{biochemistry-stub}} |
|
{{biochemistry-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|