| Revision as of 07:41, 17 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 21:13, 27 August 2017 edit undoAlyInWikiWonderland (talk | contribs)Autopatrolled, Extended confirmed users81,666 editsNo edit summary |
| (15 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Oxapium iodide.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 408355220 |
| ⚫ |
|IUPACName=1--1-methylpiperidin-1-ium iodide |
|
|
⚫ |
| ImageFile=Oxapium iodide.png |
| ⚫ |
|OtherNames=Cyclonium, ciclonium |
|
|
⚫ |
| ImageSize=200px |
|
⚫ |
| IUPACName=1--1-methylpiperidin-1-ium iodide |
|
⚫ |
| OtherNames=Cyclonium, ciclonium |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| CASNo=6577-41-9 |
|
|
|
| UNII = 682380CG4N |
| ⚫ |
| PubChem=168884 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=6577-41-9 |
|
⚫ |
| PubChem=168884 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2110800 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01815 |
|
| KEGG = D01815 |
|
| SMILES=C1(CCCCC1)CC2COC(O2)(C3CCCCC3)C4=CC=CC=C4. |
|
| SMILES=C1(CCCCC1)CC2COC(O2)(C3CCCCC3)C4=CC=CC=C4. |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 147726 |
|
|
| InChI = 1/C22H34NO2.HI/c1-23(15-9-4-10-16-23)17-21-18-24-22(25-21,19-11-5-2-6-12-19)20-13-7-3-8-14-20;/h2,5-6,11-12,20-21H,3-4,7-10,13-18H2,1H3;1H/q+1;/p-1 |
|
|
| InChIKey = YHEWVHONOOWLMW-REWHXWOFAE |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C22H34NO2.HI/c1-23(15-9-4-10-16-23)17-21-18-24-22(25-21,19-11-5-2-6-12-19)20-13-7-3-8-14-20;/h2,5-6,11-12,20-21H,3-4,7-10,13-18H2,1H3;1H/q+1;/p-1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YHEWVHONOOWLMW-UHFFFAOYSA-M |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>22</sub>H<sub>34</sub>INO<sub>2</sub> |
|
| Formula=C<sub>22</sub>H<sub>34</sub>INO<sub>2</sub> |
|
| MolarMass=471.42 g/mol |
|
| MolarMass=471.42 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Oxapium iodide''' ('''ciclonium''' or '''cyclonium''') is an ]. |
|
'''Oxapium iodide''' ('''ciclonium''' or '''cyclonium''', trade name '''Oxaperan''') is an ] indicated for the treatment of ], ], ], and other conditions. It is marketed in South Korea by ]. |
|
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
{{pharmacology-stub}} |
|
|
|
|
|
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
] |
|
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |