| Revision as of 12:19, 6 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 11:46, 23 July 2023 edit undoGraham87 (talk | contribs)Account creators, Autopatrolled, Event coordinators, Extended confirmed users, Page movers, Importers, Rollbackers291,963 editsm 1 revision imported: import old edit from nost:PCAA |
| (15 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Metabolite of phencyclidine (PCP)}} |
|
{{About|the chemical compound|the former U.S. college athletics conference named Pacific Coast Athletic Association |Big West Conference}} |
|
|
|
{{Other uses}} |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400840290 |
|
| verifiedrevid = 400841375 |
|
| ImageFile = PCAA.png |
|
| ImageFile = PCAA.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = 5-pentanoic acid |
|
| PIN = 5-pentanoic acid |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 151498 |
|
| ChemSpiderID = 151498 |
|
| InChI = 1/C17H25NO2/c19-16(20)11-5-8-14-18-17(12-6-2-7-13-17)15-9-3-1-4-10-15/h1,3-4,9-10,18H,2,5-8,11-14H2,(H,19,20) |
|
| InChI = 1/C17H25NO2/c19-16(20)11-5-8-14-18-17(12-6-2-7-13-17)15-9-3-1-4-10-15/h1,3-4,9-10,18H,2,5-8,11-14H2,(H,19,20) |
| Line 15: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RZGZMLICFFEUIQ-UHFFFAOYSA-N |
|
| StdInChIKey = RZGZMLICFFEUIQ-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = BL9SJ9WN2A |
|
| CASNo = 77160-83-9 |
|
| CASNo = 77160-83-9 |
|
| PubChem = 173576 |
|
| PubChem = 173576 |
|
| SMILES = O=C(O)CCCCNC2(c1ccccc1)CCCCC2 |
|
| SMILES = O=C(O)CCCCNC2(c1ccccc1)CCCCC2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=17 | H=25 | N=1 | O=2 |
|
| Formula = C<sub>17</sub>H<sub>25</sub>NO<sub>2</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 275.386 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''PCAA''', or 5--aminopentanoic acid, is a ] of ] (PCP). It can be detected in the urine of PCP users by ] as means of drug screening.<ref>{{cite journal|author=Ojanpera, Suvi; Pelander, Anna; Pelzing, Matthias; Krebs, Ilmari; Vuori, Erkki; Ojanpera, Ilkka|title=Isotopic pattern and accurate mass determination in urine drug screening by liquid chromatography/time-of-flight mass spectrometry|journal=Rapid Communications in Mass Spectrometry|year=2006|volume=20|issue=7|pages=1161–1167 | doi = 10.1002/rcm.2429|pmid=16521169}}</ref> |
|
'''PCAA''', or '''5-pentanoic acid''', is a ] of ] (PCP). It can be detected in the urine of PCP users by ] as means of drug screening.<ref>{{cite journal|author1=Ojanpera, Suvi |author2=Pelander, Anna |author3=Pelzing, Matthias |author4=Krebs, Ilmari |author5=Vuori, Erkki |author6=Ojanpera, Ilkka |title=Isotopic pattern and accurate mass determination in urine drug screening by liquid chromatography/time-of-flight mass spectrometry|journal=Rapid Communications in Mass Spectrometry|year=2006|volume=20|issue=7|pages=1161–1167 | doi = 10.1002/rcm.2429|pmid=16521169|bibcode=2006RCMS...20.1161O }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 42: |
Line 46: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
| ⚫ |
{{amine-stub}} |
|
|
|
|
|
|
⚫ |
{{amine-stub}} |
|
] |
|