Revision as of 19:36, 18 May 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits removed Category:Enzyme inhibitors; added Category:Protein kinase inhibitors using HotCat← Previous edit |
Latest revision as of 08:36, 9 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,111 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
(30 intermediate revisions by 24 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 387924516 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 429769063 |
|
| ImageFile = PP2 skeletal.svg |
|
| ImageFile = PP2 skeletal.svg |
|
| ImageSize = |
|
| ImageSize = 120px |
|
| ImageAlt = |
|
| ImageAlt = |
|
|
| Name = PP2 |
|
| IUPACName = (4-amino-5-(4-chlorophenyl)-7-(dimethylethyl)pyrazolopyrimidine |
|
| PIN = 1-''tert''-Butyl-3-(4-chlorophenyl)-1''H''-pyrazolopyrimidin-4-amine |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 172889-27-9 |
|
|
| PubChem = 4878 |
|
| CASNo = 172889-27-9 |
|
|
| PubChem = 4878 |
⚫ |
| SMILES = Nc2ncnc(c12)n(C(C)(C)C)nc1-c3ccc(Cl)cc3 |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
⚫ |
| InChI = 1S/C15H16ClN5/c1-15(2,3)21-14-11(13(17)18-8-19-14)12(20-21)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H2,17,18,19)}} |
|
|
|
| ChemSpiderID = 4712 |
⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| C=15 | H=16 | Cl=1 | N=5 |
|
|
|
| UNII = PK8JPC58XB |
|
| MolarMass = 301.774 |
|
|
|
| ChEBI = 78331 |
⚫ |
| Appearance = white to off-white solid |
|
|
⚫ |
| SMILES = Nc2ncnc(c12)n(C(C)(C)C)nc1-c3ccc(Cl)cc3 |
⚫ |
| Density = |
|
|
⚫ |
| InChI = 1S/C15H16ClN5/c1-15(2,3)21-14-11(13(17)18-8-19-14)12(20-21)9-4-6-10(16)7-5-9/h4-8H,1-3H3,(H2,17,18,19)}} |
⚫ |
| MeltingPt = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| BoilingPt = |
|
|
⚫ |
| C=15 | H=16 | Cl=1 | N=5 |
|
| Solubility = |
|
|
⚫ |
| Appearance = White to off-white solid |
⚫ |
| SolubleOther = 25 mg/ml |
|
|
⚫ |
| Density = |
⚫ |
| Solvent = ]}} |
|
|
⚫ |
| MeltingPt = |
⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| BoilingPt = |
|
| FlashPt = |
|
| Solubility = |
|
⚫ |
| SolubleOther = 25 mg/ml |
|
| Autoignition = }} |
|
|
⚫ |
| Solvent = ]}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
'''PP2''' is a substance used in cancer research as a selective ] for ]s. It strongly inhibits the kinases ] (]=4 ]), ] (5 nM) and ] (5 nM), shows weaker inhibition of ] (480 nM) and practically no inhibition of ] (100 µM) and ] (50 µM).<ref>{{cite journal|pmid=8557675|year=1996|last1=Hanke|first1=JH|last2=Gardner|first2=JP|last3=Dow|first3=RL|last4=Changelian|first4=PS|last5=Brissette|first5=WH|last6=Weringer|first6=EJ|last7=Pollok|first7=BA|last8=Connelly|first8=PA|title=Discovery of a novel, potent, and Src family-selective tyrosine kinase inhibitor. Study of Lck- and FynT-dependent T cell activation|volume=271|issue=2|pages=695–701|journal=The Journal of biological chemistry}}</ref><ref>{{cite journal|doi=10.1074/jbc.275.18.13789|pmid=10788500|year=2000|last1=Chen|first1=JK|last2=Capdevila|first2=J|last3=Harris|first3=RC|title=Overexpression of C-terminal Src kinase blocks 14, 15-epoxyeicosatrienoic acid-induced tyrosine phosphorylation and mitogenesis|volume=275|issue=18|pages=13789–92|journal=The Journal of biological chemistry}}</ref><ref>{{cite journal|doi=10.1074/jbc.275.16.11706|pmid=10766791|year=2000|last1=Yoshizumi|first1=M|last2=Abe|first2=J|last3=Haendeler|first3=J|last4=Huang|first4=Q|last5=Berk|first5=BC|title=Src and Cas mediate JNK activation but not ERK1/2 and p38 kinases by reactive oxygen species|volume=275|issue=16|pages=11706–12|journal=The Journal of biological chemistry}}</ref><ref>{{cite journal|doi=10.1210/jc.2002-021278|pmid=12679489|year=2003|last1=Carlomagno|first1=F|last2=Vitagliano|first2=D|last3=Guida|first3=T|last4=Basolo|first4=F|last5=Castellone|first5=MD|last6=Melillo|first6=RM|last7=Fusco|first7=A|last8=Santoro|first8=M|title=Efficient inhibition of RET/papillary thyroid carcinoma oncogenic kinases by 4-amino-5-(4-chloro-phenyl)-7-(t-butyl)pyrazolo3,4-dpyrimidine (PP2)|volume=88|issue=4|pages=1897–902|journal=The Journal of clinical endocrinology and metabolism }}</ref> |
|
'''PP2''' is a substance that has frequently been used in cancer research as a "selective" ] for ]s. It strongly inhibits the kinases ] (]=4 ]), ] (5 nM) and ] (5 nM), shows weaker inhibition of ] (480 nM) and practically no inhibition of ] (100 μM) and ] (50 μM).<ref>{{cite journal|pmid=8557675|year=1996|last1=Hanke|first1=JH|last2=Gardner|first2=JP|last3=Dow|first3=RL|last4=Changelian|first4=PS|last5=Brissette|first5=WH|last6=Weringer|first6=EJ|last7=Pollok|first7=BA|last8=Connelly|first8=PA|title=Discovery of a novel, potent, and Src family-selective tyrosine kinase inhibitor. Study of Lck- and FynT-dependent T cell activation|volume=271|issue=2|pages=695–701|journal=The Journal of Biological Chemistry|doi=10.1074/jbc.271.2.695|doi-access=free}}</ref><ref>{{cite journal|doi=10.1074/jbc.275.18.13789|pmid=10788500|year=2000|last1=Chen|first1=JK|last2=Capdevila|first2=J|last3=Harris|first3=RC|title=Overexpression of C-terminal Src kinase blocks 14, 15-epoxyeicosatrienoic acid-induced tyrosine phosphorylation and mitogenesis|volume=275|issue=18|pages=13789–92|journal=The Journal of Biological Chemistry|doi-access=free}}</ref><ref>{{cite journal|doi=10.1074/jbc.275.16.11706|pmid=10766791|year=2000|last1=Yoshizumi|first1=M|last2=Abe|first2=J|last3=Haendeler|first3=J|last4=Huang|first4=Q|last5=Berk|first5=BC|title=Src and Cas mediate JNK activation but not ERK1/2 and p38 kinases by reactive oxygen species|volume=275|issue=16|pages=11706–12|journal=The Journal of Biological Chemistry|doi-access=free}}</ref><ref>{{cite journal|doi=10.1210/jc.2002-021278|pmid=12679489|year=2003|last1=Carlomagno|first1=F|last2=Vitagliano|first2=D|last3=Guida|first3=T|last4=Basolo|first4=F|last5=Castellone|first5=MD|last6=Melillo|first6=RM|last7=Fusco|first7=A|last8=Santoro|first8=M|title=Efficient inhibition of RET/papillary thyroid carcinoma oncogenic kinases by 4-amino-5-(4-chloro-phenyl)-7-(t-butyl)pyrazolo3,4-dpyrimidine (PP2)|volume=88|issue=4|pages=1897–902|journal=The Journal of Clinical Endocrinology and Metabolism |doi-access=free}}</ref> Despite its extensive use as a Src-selective inhibitor, recent research has shown that PP2 is non-selective and inhibits many other kinases with similar affinities.<ref>{{cite journal|doi=10.1021/cb300172e|pmid=22594480|year=2012|last1=Brandvold|first1=KR|last2=Steffey|first2=ME|last3=Fox|first3=CC|last4=Soellner|first4=MB|title=Development of a Highly Selective c-Src Kinase Inhibitor|volume=ASAP|pages=1393–1398|journal=ACS Chemical Biology|issue=8 |pmc=3423592}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{biochemistry-stub}} |
|
{{biochemistry-stub}} |