| Revision as of 17:22, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 09:05, 23 September 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,654 edits cas |
| (25 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| verifiedrevid = 405764220 |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 8-chloro-3-(methoxymethyl)-5-methyl-4H-imidazobenzodiazepin-6-one |
|
|
|
| Watchedfields = changed |
|
| image = PWZ-029_structure.png |
|
|
⚫ |
| verifiedrevid = 424715425 |
| ⚫ |
| CAS_number = |
|
|
⚫ |
| IUPAC_name = 8-chloro-3-(methoxymethyl)-5-methyl-4''H''-imidazobenzodiazepin-6-one |
| ⚫ |
| ATC_prefix = |
|
|
|
| image = PWZ-029.svg |
| ⚫ |
| ATC_suffix = |
|
|
|
|
| ⚫ |
| PubChem = 9971547 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| DrugBank = |
|
|
|
| tradename = |
| ⚫ |
| C=14|H=14|Cl=1|N=3|O=2 |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| molecular_weight = 291.732 g/mol |
|
|
| smiles = c3c(Cl)ccc-1c3C(=O)N(C)Cc2n-1cnc2COC |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| elimination_half-life = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| excretion = |
|
|
⚫ |
| legal_status = |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| routes_of_administration = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
|
| ⚫ |
| pregnancy_category= |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| protein_bound = |
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
⚫ |
| metabolism = |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| excretion = |
| ⚫ |
| legal_status = |
|
|
|
|
| ⚫ |
| routes_of_administration = |
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 164025-33-6 |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 9971547 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 45346 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8147139 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=14 | Cl=1 | N=3 | O=2 |
|
|
| smiles = ClC1=CC=C2C(C(N(CC3=C(COC)N=CN32)C)=O)=C1 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H14ClN3O2/c1-17-6-13-11(7-20-2)16-8-18(13)12-4-3-9(15)5-10(12)14(17)19/h3-5,8H,6-7H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FXIDXTIMKAEBGY-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''PWZ-029''' is a ] derivative drug with ] effects. It acts as a subtype-selective, mixed agonist-inverse agonist at the ] binding site on the ] ], acting as a partial ] at the ] and a weak ] at the ]. This gives it a mixed pharmacological profile, producing at low doses memory-enhancing effects but with no ] or ] effects or muscle weakness, although at higher doses it produces some sedative effects.<ref>Savić MM, Clayton T, Furtmüller R, Gavrilović I, Samardzić J, Savić S, Huck S, Sieghart W, Cook JM. PWZ-029, a compound with moderate inverse agonist functional selectivity at GABA(A) receptors containing alpha5 subunits, improves passive, but not active, avoidance learning in rats. ''Brain Research''. 2008 May 7;1208:150-9. {{DOI|10.1016/j.brainres.2008.02.020}} PMID 18394590</ref> |
|
'''PWZ-029''' is a ] derivative drug with ] effects developed by WiSys,<ref>US Patent application US2006/258643 A1</ref> It acts as a subtype-selective, mixed agonist-inverse agonist at the ] binding site on the ] ], acting as a partial ] at the ] and a weak ] at the ]. This gives it a mixed pharmacological profile, producing at low doses memory-enhancing effects but with no ] or ] effects or muscle weakness, although at higher doses it produces some sedative effects.<ref name="pmid18394590">{{cite journal | vauthors = Savić MM, Clayton T, Furtmüller R, Gavrilović I, Samardzić J, Savić S, Huck S, Sieghart W, Cook JM | title = PWZ-029, a compound with moderate inverse agonist functional selectivity at GABA(A) receptors containing alpha5 subunits, improves passive, but not active, avoidance learning in rats | journal = Brain Research | volume = 1208 | pages = 150–9 | date = May 2008 | pmid = 18394590 | pmc = 2577822 | doi = 10.1016/j.brainres.2008.02.020 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{GABA receptor modulators}} |
|
{{Benzodiazepines}} |
|
{{Benzodiazepines}} |
|
{{Psychostimulants, agents used for ADHD and nootropics}} |
|
|
{{GABAergics}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Nervous-system-drug-stub}} |