| Revision as of 18:08, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 03:09, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,418,800 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavonols | #UCB_Category 28/33 |
| (27 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 431155178 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Pachypodol |
|
|
⚫ |
| verifiedrevid = 449571126 |
| ⚫ |
| ImageFile = Pachypodol.svg |
|
|
⚫ |
| Name = Pachypodol |
| ⚫ |
| ImageSize = 250px |
|
|
| ImageName = Pachypodol structure |
|
| ImageFile = Pachypodol.svg |
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| IUPACName = 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxychromen-4-one |
|
|
⚫ |
| ImageName = Pachypodol structure |
| ⚫ |
| OtherNames= Quercetin 3,7,3'-trimethyl ether<br>4',5-Dihydroxy-3,3',7-trimethoxyflavone |
|
|
|
| ImageFile2 = Pachypodol 3D BS.png |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageSize2 = 200px |
| ⚫ |
| CASNo = 33708-72-4 |
|
|
|
| ImageName2 = Pachypodol 3D structure |
| ⚫ |
| PubChem = 5281677 |
|
|
|
| IUPACName = 4′,5-Dihydroxy-3,3′,7-trimethoxyflavone |
| ⚫ |
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)OC)O |
|
|
⚫ |
| SystematicName = 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames= Quercetin 3,7,3'-trimethyl ether |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 33708-72-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8AG6B2DMP5 |
|
⚫ |
| PubChem = 5281677 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 70007 |
|
⚫ |
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)OC)O |
|
|
| InChI = 1/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-11(19)13(6-9)23-2/h4-8,19-20H,1-3H3 |
|
|
| InChIKey = KQFUXLQBMQGNRT-UHFFFAOYAA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-11(19)13(6-9)23-2/h4-8,19-20H,1-3H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KQFUXLQBMQGNRT-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = C008751 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444996 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C = 18 |
|
| C=18 | H=16 | O=7 |
|
| H = 16 |
|
| Density = |
|
| O = 7 |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| ExactMass = 344.089603 g mol<sup>−1</sup> |
|
|
| Density = |
|
|
| MeltingPt = |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Pachypodol''' is an ], a type of chemical compound. It can be isolated from '']'', from Chinese herb '']'' and from leaves of '']'' (Korean mint). |
|
|
|
|
|
|
|
'''Pachypodol''' is a chemical compound classified as an ]. It can be isolated from a variety of plants including '']'',<ref>{{Cite journal | doi = 10.1002/ptr.2539 | title = Pachypodol, a flavonol from the leaves of ''Calycopteris floribunda'', inhibits the growth of CaCo 2 colon cancer cell line ''in vitro'' | year = 2008 | last1 = Ali | first1 = Husne-Ara | last2 = Chowdhury | first2 = A. K. Azad | last3 = Rahman | first3 = Abul K. M. | last4 = Borkowski | first4 = Tomasz | last5 = Nahar | first5 = Lutfun | last6 = Sarker | first6 = Satyajit D. | journal = Phytotherapy Research | volume = 22 | issue = 12 | pages = 1684–1687 | pmid = 18570232 | s2cid = 1498024 | doi-access = free }}</ref> '']'',<ref>{{Cite journal | doi = 10.1016/j.sjbs.2021.12.012 | title = Pachypodol attenuates Perfluorooctane sulphonate-induced testicular damage by reducing oxidative stress | year = 2022 | last1 = Umar Ijaz | first1 = Muhammad | last2 = Rauf | first2 = Ayesha | last3 = Mustafa | first3 = Shama | last4 = Ahmed | first4 = Hussain | last5 = Ashraf | first5 = Asma | last6 = Al-Ghanim | first6 = Khalid | last7 = Swamy Mruthinti | first7 = Satyanarayana | last8 = Mahboob | first8 = S. | journal = Saudi Journal of Biological Sciences | volume = 29 | issue = 3 | pages = 1380–1385 | pmid = 35280584 | pmc = 8913419 | bibcode = 2022SJBS...29.1380U }}</ref> and '']''.<ref>{{Cite journal | doi = 10.1021/jf051897s | title = Pachypodol from ''Croton ciliatoglanduliferus'' Ort. As Water-Splitting Enzyme Inhibitor on Thylakoids | year = 2006 | last1 = González-Vázquez | first1 = Raquel | last2 = King Díaz | first2 = Beatriz | last3 = Aguilar | first3 = María Isabel | last4 = Diego | first4 = Nelly | last5 = Lotina-Hennsen | first5 = Blas | journal = Journal of Agricultural and Food Chemistry | volume = 54 | issue = 4 | pages = 1217–1221 | pmid = 16478239 | bibcode = 2006JAFC...54.1217G }}</ref> |
| ⚫ |
{{flavonol}} |
|
|
|
|
|
|
|
== References == |
|
] |
|
|
|
{{reflist}} |
|
] |
|
|
|
|
|
⚫ |
{{flavonol}} |
|
|
|
|
|
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
|
|
|
|
{{Aromatic-stub}} |
|
] |
|