| Revision as of 08:50, 9 June 2011 editPashihiko (talk | contribs)Extended confirmed users3,552 editsNo edit summary← Previous edit |
Latest revision as of 20:20, 25 November 2024 edit undoLaura240406 (talk | contribs)Extended confirmed users737 edits Link suggestions feature: 3 links added.Tags: Visual edit Newcomer task Suggested: add links |
| (20 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''para''-Cresidine}} |
|
{{DISPLAYTITLE:''para''-Cresidine}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 415868237 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Name=''para''-Cresidine |
|
|
⚫ |
| verifiedrevid = 433356029 |
| ⚫ |
|ImageFile=cresidine.svg |
|
|
⚫ |
| Name = ''para''-Cresidine |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = cresidine.svg |
| ⚫ |
|IUPACName=2-methoxy-5-methylaniline |
|
|
⚫ |
| ImageSize = 180 |
| ⚫ |
|OtherNames= |
|
|
|
| ImageAlt = Skeletal formula of para-cresidine |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1 = Para-Cresidine 3D ball.png |
| ⚫ |
| RTECS = BZ6720000 |
|
|
|
| ImageSize1 = 180 |
| ⚫ |
| CASNo=120-71-8 |
|
|
|
| ImageAlt1 = Ball-and-stick model of the para-cresidine molecule |
| ⚫ |
| PubChem=8445 |
|
|
⚫ |
| PIN = 2-Methoxy-5-methylaniline |
|
⚫ |
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| RTECS = BZ6720000 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 120-71-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4C11L78UR3 |
|
⚫ |
| PubChem = 8445 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 13869579 |
|
|
| InChI = 1/C8H11NO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,9H2,1-2H3 |
|
|
| InChIKey = WXWCDTXEKCVRRO-UHFFFAOYAY |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C8H11NO/c1-6-3-4-8(10-2)7(9)5-6/h3-5H,9H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = WXWCDTXEKCVRRO-UHFFFAOYSA-N |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C19216 |
|
| KEGG = C19216 |
|
| SMILES=CC1=CC(=C(C=C1)OC)N |
|
| SMILES = CC1=CC(=C(C=C1)OC)N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8|H=11|N=1|O=1 |
|
| Formula=C<sub>8</sub>H<sub>11</sub>NO |
|
|
| MolarMass=137.179 |
|
| MolarMass=137.179 |
|
| Appearance=White crystals |
|
| Appearance=White crystals |
|
| Density= |
|
| Density= |
|
| MeltingPtC=51.5 |
|
| MeltingPtC=51.5 |
|
| BoilingPtC=235 |
|
| BoilingPtC=235 |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''''para''-Cresidine''' is an ] that is used to create dyes and pigments. It is a light yellow to light brown solid with the chemical formula C<sub>8</sub>H<sub>11</sub>ON or CH<sub>3</sub>OC<sub>6</sub>H<sub>3</sub>(CH<sub>3</sub>)NH<sub>2</sub>. It appears as white crystals. Its carcinogen category is 2, and upon heating it produces toxic fumes including nitrogen oxides. It reacts with strong ] and some forms of plastic, rubber, and coatings. ''para''-Cresidine is possibly ] to humans. It boils at 235 °C, melts at 51.5 °C, and is not very soluble in water. |
|
'''''para''-Cresidine''' is an ] with the formula CH<sub>3</sub>OC<sub>6</sub>H<sub>3</sub>(CH<sub>3</sub>)NH<sub>2</sub>. It is a white solid that is soluble in organic solvents. The compound features both amine and methoxy ]s. It is used as an ] in preparation of dyes and pigments. |
|
|
|
|
|
==Synthesis and reactions== |
|
|
The compound is obtained in several steps from ]. ] gives mainly 3-nitro-4-chlorotoluene, which reacts with methoxide sources to give 4-methoxy-2-nitrotoluene. Reduction of this nitro compound affords the aniline.<ref name=Ullmann>P. F. Vogt, J. J. Gerulis, "Amines, Aromatic" in ''Ullmann’s Encyclopedia of Industrial Chemistry'', 2005, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a02_037}}</ref> |
|
|
|
|
|
Sulfonation with ] gives 4-amino-5-methoxy-2-methylbenzenesulfonic acid. This ] is a precursor to ], a red ].<ref name=Ullmann/> |
|
|
|
|
|
]{{clear-left}} |
|
|
|
|
|
== References == |
|
== References == |
|
|
<references /> |
| ⚫ |
*, Center for Disease Control |
|
|
|
|
|
|
==External links== |
|
⚫ |
*, Center for Disease Control |
|
|
|
|
|
{{DEFAULTSORT:Cresidine, para-}} |
|
{{DEFAULTSORT:Cresidine, para-}} |
| Line 40: |
Line 67: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|