Misplaced Pages

Patuletin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 06:43, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit Latest revision as of 03:07, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,418,262 edits Added bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:O-methylated flavonols | #UCB_Category 12/33 
(28 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 401011214
| Name = Patuletin | Name = Patuletin
| ImageFile = Patuletin.PNG | ImageFile = Patuletin.svg
| ImageSize = 200px
| ImageName = Chemical structure of patuletin | ImageName = Chemical structure of patuletin
| IUPACName = 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxychromen-4-one | IUPACName = 3,3′,4′,5,7-Pentahydroxy-6-methoxyflavone
| SystematicName = 2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4''H''-1-benzopyran-4-one
| OtherNames = 6-Methoxyquercetin<br>Quercetagetin 6-methyl ether<br>2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone | OtherNames = 6-Methoxyquercetin<br>Quercetagetin 6-methyl ether<br>2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methoxy-4-benzopyrone
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = 519-96-0 | CASNo = 519-96-0
| CASNo_Ref = | CASNo_Ref = {{cascite|correct|??}}
| CASOther = | CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9BNM33N01N
| PubChem = 5281678 | PubChem = 5281678
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 465155
| SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O | SMILES = COC1=C(C=C2C(=C1O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)O)O)O
| InChI = | EINECS = 208-280-8
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4444997
| InChI = 1/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3
| InChIKey = JMIFIYIEXODVTO-UHFFFAOYAR
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H12O8/c1-23-16-9(19)5-10-11(13(16)21)12(20)14(22)15(24-10)6-2-3-7(17)8(18)4-6/h2-5,17-19,21-22H,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = JMIFIYIEXODVTO-UHFFFAOYSA-N
| RTECS =
| MeSHName = | MeSHName =
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 75164
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| C=16 | H=12 | O=8
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>8</sub>
| MolarMass = 332.26 g/mol
| ExactMass = 332.053217 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
}} }}
'''Patuletin''' is an ]. It can be found in the genus '']''.<ref></ref> '''Patuletin''' is an ]. It can be found in the genus '']''.<ref>{{Cite journal | last1 = Bate-Smith | first1 = E. C. | last2 = Harborne | first2 = J. B. | doi = 10.1016/S0031-9422(00)86351-7 | title = Quercetagetin and patuletin in Eriocaulon | journal = Phytochemistry | volume = 8 | issue = 6 | pages = 1035 | year = 1969 | bibcode = 1969PChem...8.1035B }}</ref>


==Glycosides== == Glycosides ==
Patuletin glycosides can be found in '']''.<ref></ref> Patuletin glycosides can be found in '']''.<ref>{{Cite journal | last1 = Smith | first1 = D. M. | last2 = Glennie | first2 = C. W. | last3 = Harborne | first3 = J. B. | doi = 10.1016/S0031-9422(00)97361-8 | title = Identification of eupalitin, eupatolitin and patuletin glycosides in Ipomopsis aggregata | journal = Phytochemistry | volume = 10 | issue = 12 | pages = 3115 | year = 1971 | bibcode = 1971PChem..10.3115S }}</ref>


] can be isolated from the aerial parts of '']''.<ref></ref> ] can be isolated from the aerial parts of '']''.<ref>{{Cite journal | last1 = Lin | first1 = L. | last2 = Qiu | first2 = S. | last3 = Lindenmaier | first3 = M. | last4 = He | first4 = X. | last5 = Featherstone | first5 = T. | last6 = Cordell | first6 = G. A. | doi = 10.1076/phbi.40.2.92.5839 | title = Patuletin-3-O-Rutinoside from the Aerial Parts of Echinacea angustifolia | journal = Pharmaceutical Biology | volume = 40 | issue = 2 | pages = 92 | year = 2002 | s2cid = 84855629 }}</ref>


]s can be isolated from '']''.<ref></ref> ]s can be isolated from '']''.<ref>{{Cite journal
| last1 = Costa | first1 = S. S.
⚫ ==References==
| last2 = Jossang | first2 = A.
{{reflist}}
| last3 = Bodo | first3 = B.
| last4 = Souza | first4 = M. L. M.
| last5 = Moraes | first5 = V. L. G.
| title = Patuletin Acetylrhamnosides from Kalanchoe brasiliensis as Inhibitors of Human Lymphocyte Proliferative Activity
| doi = 10.1021/np50113a005
| journal = Journal of Natural Products
| volume = 57
| issue = 11
| pages = 1503–1510
| year = 1994
| pmid = 7853000
}}</ref>

⚫ == References ==
{{Reflist}}


{{flavonol}} {{flavonol}}


] ]
]
]
]


{{polyphenol-stub}} {{aromatic-stub}}