| Revision as of 07:15, 9 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk: |
Latest revision as of 00:20, 2 November 2023 edit LaundryPizza03 (talk | contribs)Extended confirmed users54,256 edits →Properties: Wrong compound |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 402114675 |
|
| verifiedrevid = 417919604 |
|
|
| Name = Perfluorocyclohexane |
|
| Name = Ethyl (-)-<small>L</small>-lactate |
|
|
| ImageFile = Ethyl L-lactate.png |
|
| ImageFile = Perfluorocyclohexane.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Ethyl <small>L</small>-lactate |
|
| ImageName = Perfluorocyclohexane |
|
|
| PIN = Dodecafluorocyclohexane |
|
| IUPACName = Ethyl (''R'')-2-hydroxypropanoate |
|
|
|
| OtherNames = 1,1,2,2,3,3,4,4,5,5,6,6-Dodecafluorocyclohexane, Cyclohexane, dodecafluoro- |
|
| OtherNames = Ethyl lactate; Lactic acid ethyl ester; 2-Hydroxypropanoic acid ethyl ester; Actylol; Acytol |
|
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| SMILES = CCOC(=O)C(C)O |
|
| SMILES = C1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 13837423 |
|
| ChemSpiderID = 9263 |
|
| InChI = 1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
|
| InChI = 1S/C6F12/c7-1(8)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12 |
|
| InChIKey = LZCLXQDLBQLTDK-UHFFFAOYAV |
|
| InChIKey = RKIMETXDACNTIE-UHFFFAOYSA-N |
|
⚫ |
| CASNo = 355-68-0 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 9640 |
|
| StdInChI = 1S/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
|
|
|
| EC_number = 206-591-3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = LZCLXQDLBQLTDK-UHFFFAOYSA-N |
|
| ⚫ |
| CASNo = 687-47-8 |
|
|
| CASNo_Comment = (<small>L</small>-isomer) |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo1 = 97-64-3 |
|
|
| CASNo_Comment = (racemate) |
|
|
| CASNo2 = 7699-00-5 |
|
|
| CASNo_Comment = (<small>D</small>-isomer) |
|
| ⚫ |
| PubChem = 7344 |
|
|
| RTECS = OD5075000 |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=5|H=10|O=3 |
|
| C=6|F=12 |
|
| Appearance = Clear to slightly yellow liquid |
|
| Appearance = clear, waxy solid |
|
| Density = 1.03 g/cm<sup>3</sup> |
|
| Density = 1.684 g/cm<sup>3</sup> |
|
| Solubility = Miscible |
|
| SolubleOther = Miscible with organic compounds |
|
|
| MeltingPtC = 52 |
|
| Solvent = ]<br /> and most ]s |
|
|
|
| MeltingPt_ref = <ref>{{cite journal|last1=Sander|first1=M.|last2=Blöchl|first2=W.|title=Herstellung von Perfluoralkanen und Perfluorcycloalkanen|journal=Chemie Ingenieur Technik|date=January 1965|volume=37|issue=1|pages=7–13|doi=10.1002/cite.330370103|language=German}}</ref> |
|
| SolubleOther = Miscible |
|
|
| MeltingPtC = -26 |
|
| BoilingPtC = 59–60 |
|
| BoilingPtCL = 151 |
|
|
| BoilingPtCH = 155 |
|
|
| SpecRotation = −11.3° |
|
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
|
| ExternalSDS = MSDS |
|
| ExternalMSDS = |
|
|
|
| GHSPictograms = {{GHS07}} |
| ⚫ |
| MainHazards = Irritant (Xi) |
|
|
|
| GHSSignalWord = Warning |
|
| NFPA-H = 1 |
|
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
| NFPA-F = 1 |
|
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
| NFPA-R = 0 |
|
|
⚫ |
| MainHazards = Irritant |
|
| RPhrases = {{R10}} {{R37}} {{R41}} |
|
|
| SPhrases = {{S2}} {{S24}} {{S26}} {{S39}} |
|
|
| FlashPt = 46 °C |
|
|
}} |
|
}} |
|
| Section8 = {{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherCpds = ] |
|
| OtherCompounds = ] |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Perfluorocyclohexane''' or '''dodecafluorocyclohexane''' is a chemical which belongs to the class of ], sometimes referred to as perfluorocarbons or PFCs. ] and their derivatives are useful ], ], ], and ]. |
|
'''Ethyl lactate''', also known as lactic acid ethyl ester, is a monobasic ] formed from ] and ], commonly used as a ]. This compound is considered ] and can be used as a water-rinsible degreaser. Ethyl lactate is found naturally in small quantities in a wide variety of foods including ], ], and various ]s. The odor of ethyl lactate when dilute is mild, ]y, ]y, with hints of fruit and ]. |
|
|
|
|
|
|
|
==Synthesis== |
|
Ethyl lactate is produced from biological sources, and can be either the levo (''S'') form or dextro (''R'') form, depending on the organism that is the source of the ]. Most biologically sourced ethyl lactate is ethyl (-)-<small>L</small>-lactate. Ethyl lactate is also produced industrially from petrochemical stocks, and this ethyl lactate consists of the racemic mixture of levo and dextro forms. In some jurisdictions, the ''natural'' product is exempt from many restrictions placed upon use and disposal of solvents. Because both enantiomers are found in nature, and because ethyl lactate is easily biodegradable, it is considered to be a ''green'' solvent. |
|
|
|
Perfluorocyclohexane can be synthesized by fluorination of cyclohexane.<ref>{{cite journal |
|
|
|author=Sandford G. |
|
|
|title=Perfluoroalkanes |
|
|
|journal=Tetrahedron |
|
|
|volume=59 |pages=437–454 |year=2003 |
|
|
|issue=4 |
|
|
|doi=10.1016/s0040-4020(02)01568-5}}</ref> |
|
|
|
|
|
|
==Properties== |
|
Due to its relatively low toxicity, ethyl lactate is used commonly in pharmaceutical preparations, ]s,<ref>{{Dead link|date=December 2010}} ], Center for Food Safety and Applied Nutrition</ref> and ]. Ethyl lactate is also used as solvent for ], ] ], and cellulose ]s.<ref>"Industrial Solvents Handbook" by Ernest W. Flick. 5th Edition. William Andrew Inc., 1998. ISBN 0815514131, 9780815514138</ref> |
|
|
|
Perfluorocyclohexane is chemically inert and thermally stable. It is a relatively non-toxic, clear, waxy solid, which has a high ] and therefore sublimes readily at room temperature.{{cn|date=November 2023}} |
|
|
|
|
|
|
The molecule predominantly exists in its chair conformation, in which it possesses D<sub>3d</sub> ]. |
|
Ethyl lactate ] in the presence of ] and ]s or ] into ] and ]. |
|
|
|
|
|
|
⚫ |
== References == |
|
Ethyl lactate can be used as a cosolvent to produce suitable conditions for the formation of aryl aldimines.<ref>{{cite journal | author = Jacqueline S. Bennett, Kaitlyn L. Charles, Matthew R. Miner, Caitlin F. Heuberger, Elijah J. Spina, Michael F. Bartels and Taylor Foreman | title = Ethyl lactate as a tunable solvent for the synthesis of aryl aldimines | journal = Green Chem. | year = 2009 | volume = 11 | issue = 2 | pages = 166–168 | doi = 10.1039/b817379f}}</ref> |
|
|
|
|
| ⚫ |
==References== |
|
|
{{reflist}} |
|
{{reflist}} |
|
{{Use dmy dates|date=December 2010}} |
|
|
|
|
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
⚫ |
] |
|
] |
|
|
⚫ |
] |
|
] |
|
|
⚫ |
] |
|
] |
|