| Revision as of 11:52, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456536506 of page Perindopril for the Chem/Drugbox validation project (updated: 'DrugBank', 'UNII', 'CAS_number'). |
Latest revision as of 00:38, 30 September 2024 edit Whywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,132 edits AU rank |
| Line 1: |
Line 1: |
|
|
{{Short description|High blood pressure medication}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 418739936 |
|
| verifiedrevid = 464199140 |
|
| IUPAC_name = (2''S'',3''aS'',7''aS'')-1-amino}propanoyl]-octahydro-1''H''-indole-2-carboxylic acid |
|
| IUPAC_name = (2''S'',3''aS'',7''aS'')-1-amino}propanoyl]-octahydro-1''H''-indole-2-carboxylic acid |
|
| image = Perindopril.svg |
|
| image = Perindopril 2.svg |
|
| width = 180 |
|
| width = 222 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Aceon |
|
| tradename = Coversyl, Coversum, Aceon |
|
| Drugs.com = {{drugs.com|monograph|aceon}} |
|
| Drugs.com = {{drugs.com|monograph|aceon}} |
|
|
| routes_of_administration = ] |
|
| MedlinePlus = a602017 |
|
|
|
|
|
| pregnancy_category = D |
|
|
| legal_status = |
|
| legal_CA = Rx-only |
|
|
| legal_CA_comment = <ref>{{cite web | url=https://hpr-rps.hres.ca/reg-content/regulatory-decision-summary-detail.php?lang=en&linkID=RDS00418 | title=Regulatory Decision Summary for APO-Perindopril Arginine | website=] | date=23 October 2014 }}</ref> |
|
| routes_of_administration = oral |
|
|
|
| legal_UK = POM |
|
|
| legal_US = Rx-only |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 24% |
|
| bioavailability = 24% |
|
| protein_bound = 20% |
|
| protein_bound = 20% |
|
| metabolism = Renal |
|
| metabolism = Kidney |
|
| elimination_half-life = 1 hour - 17 hours for perindoprilat (active metabolite) |
|
| elimination_half-life = 1–17 hours for perindoprilat (active metabolite) |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 6367 |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 82834-16-0 --> |
|
| CAS_number = 82834-16-0 |
|
| ATC_prefix = C09 |
|
| ATC_prefix = C09 |
|
| ATC_suffix = AA04 |
|
| ATC_suffix = AA04 |
|
| ATC_supplemental = <br>{{ATC|C09|BA04}} (with ]s)<br>{{ATC|C09|BB04}} (with ]) |
|
| ATC_supplemental = <br />{{ATC|C09|BA04}} (with ]s)<br />{{ATC|C09|BB04}} (with ]) |
|
| PubChem = 107807 |
|
| PubChem = 107807 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 33: |
Line 35: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 96956 |
|
| ChemSpiderID = 96956 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = Y5GMK36KGY |
|
| UNII = Y5GMK36KGY |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03753 |
|
| KEGG = D03753 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8024 |
|
| ChEBI = 8024 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| Line 43: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=32 | N=2 | O=5 |
|
| C=19 | H=32 | N=2 | O=5 |
|
| molecular_weight = 368.468 g/mol |
|
|
| smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCC |
|
| smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCC |
|
| InChI = 1/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
|
|
| InChIKey = IPVQLZZIHOAWMC-QXKUPLGCBD |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
|
| StdInChI = 1S/C19H32N2O5/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24/h12-16,20H,4-11H2,1-3H3,(H,23,24)/t12-,13-,14-,15-,16-/m0/s1 |
| Line 53: |
Line 52: |
|
| StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N |
|
| StdInChIKey = IPVQLZZIHOAWMC-QXKUPLGCSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Perindopril''' is a ] used to treat ], ], or stable ].<ref>{{cite web |url = http://www.racgp.org.au/cmi/gxcperin.pdf |title = Consumer Medicine Information, GenRx Perindopril |work = Clinical Resources, Medicine information for health professionals | publisher = Royal Australian College of General Practitioners |url-status = dead |archive-url = https://web.archive.org/web/20070901023153/http://www.racgp.org.au/cmi/gxcperin.pdf |archive-date = 2007-09-01 }}</ref> As a long-acting ], it works by relaxing ] and decreasing ]. As a ], perindopril is ] in the liver to its active ], perindoprilat. It was patented in 1980 and approved for medical use in 1988.<ref name="Fisher_2006">{{cite book| vauthors = Fischer J, Ganellin CR |url= https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA467 |title=Analogue-based Drug Discovery |date=2006|publisher=John Wiley & Sons|isbn=9783527607495|page=467 }}</ref> |
|
|
|
|
|
Perindopril is taken in the form of perindopril arginine (with ], brand names include '''Coversyl''', '''Coversum''') or perindopril erbumine (with ], brand name '''Aceon'''). Both forms are therapeutically equivalent and interchangeable,<ref>{{cite web |url = http://www.pbs.gov.au/html/healthpro/search/results?term=perindopril&scope=PBS+STATIC&form-type=simple |title = PBS For Health Professionals |work = Pharmaceutical Benefits Scheme |year = 2008 | publisher = Australian Government Department of Health and Ageing |access-date = 2008-09-04 |url-status = dead |archive-url = https://web.archive.org/web/20081030010429/http://www.pbs.gov.au/html/healthpro/search/results?term=perindopril&scope=PBS+STATIC&form-type=simple |archive-date = 2008-10-30}}</ref> but the dose prescribed to achieve the same effect differs between the two forms. |
|
|
|
|
|
In Australia, it was one of the top 10 most prescribed medications between 2017 and 2023.<ref>{{cite web | title=Medicines in the health system | website=Australian Institute of Health and Welfare | date=2 July 2024 | url=https://www.aihw.gov.au/reports/medicines/medicines-in-the-health-system | access-date=30 September 2024}}</ref> |
|
|
|
|
|
==Medical uses== |
|
|
Perindopril shares the indications of ACE inhibitors as a class, including essential ], stable ] (reduction of risk of cardiac events in patients with a history of ] and/or ]), treatment of symptomatic ] or ], and ].<ref name="amh">{{Cite web|title=Australian Medicines Handbook|url=https://amhonline.amh.net.au/auth?page=chapters/cardiovascular-drugs/antihypertensives/ace-inhibitors/perindopril|website=amhonline.amh.net.au|access-date=2020-05-10}}</ref> |
|
|
|
|
|
===Combination therapy=== |
|
|
====With indapamide==== |
|
|
{{main|Perindopril/indapamide}} |
|
|
In combination with ], perindopril has been shown to significantly reduce the progression of ] and renal complications in patients with type 2 diabetes.<ref>{{cite journal | vauthors = Netchessova TA, Shepelkevich AP, Gorbat TV | collaboration = NIKA Study Group | title = Efficacy of single-pill perindopril/indapamide in patients with hypertension and type 2 diabetes | journal = High Blood Pressure & Cardiovascular Prevention | volume = 21 | issue = 1 | pages = 63–69 | date = March 2014 | pmid = 24357222 | doi = 10.1007/s40292-013-0036-x | s2cid = 20819715 }}</ref><ref>{{cite journal | vauthors = Patel A, MacMahon S, Chalmers J, Neal B, Woodward M, Billot L, Harrap S, Poulter N, Marre M, Cooper M, Glasziou P, Grobbee DE, Hamet P, Heller S, Liu LS, Mancia G, Mogensen CE, Pan CY, Rodgers A, Williams B | display-authors = 6 | title = Effects of a fixed combination of perindopril and indapamide on macrovascular and microvascular outcomes in patients with type 2 diabetes mellitus (the ADVANCE trial): a randomised controlled trial | journal = Lancet | volume = 370 | issue = 9590 | pages = 829–840 | date = September 2007 | pmid = 17765963 | doi = 10.1016/s0140-6736(07)61303-8 | s2cid = 21153924 }}</ref> In addition, the Perindopril pROtection aGainst REcurrent Stroke Study ('''PROGRESS''') found that whilst perindopril monotherapy demonstrated no significant benefit in reducing recurrent strokes when compared to placebo, the addition of low dose indapamide to perindopril therapy was associated with larger reductions in both blood pressure lowering and recurrent ] in patients with pre-existing ], irrespective of their blood pressure.<ref name="PROGRESS">{{cite journal | vauthors = ((PROGRESS Collaborative Group)) | title = Randomised trial of a perindopril-based blood-pressure-lowering regimen among 6,105 individuals with previous stroke or transient ischaemic attack | journal = Lancet | volume = 358 | issue = 9287 | pages = 1033–1041 | date = September 2001 | pmid = 11589932 | doi = 10.1016/s0140-6736(01)06178-5 | series = 2001 Sep 29 | s2cid = 10053225 }}</ref><ref>{{cite journal | title = Post-stroke antihypertensive treatment study. A preliminary result | journal = Chinese Medical Journal | volume = 108 | issue = 9 | pages = 710–717 | date = September 1995 | pmid = 8575241 | url = https://pubmed.ncbi.nlm.nih.gov/8575241/ | author1 = PATS Collaborating Group }}</ref> There is evidence to support the use of perindopril and indapamide combination over perindopril monotherapy to prevent strokes and improve mortality in patients with a history of stroke, transient ischaemic attack or other cardiovascular disease.<ref name="PROGRESS"/><ref>{{cite journal | vauthors = Beckett NS, Peters R, Fletcher AE, Staessen JA, Liu L, Dumitrascu D, Stoyanovsky V, Antikainen RL, Nikitin Y, Anderson C, Belhani A, Forette F, Rajkumar C, Thijs L, Banya W, Bulpitt CJ | display-authors = 6 | title = Treatment of hypertension in patients 80 years of age or older | journal = The New England Journal of Medicine | volume = 358 | issue = 18 | pages = 1887–1898 | date = May 2008 | pmid = 18378519 | doi = 10.1056/NEJMoa0801369 | doi-access = free }}</ref> |
|
|
|
|
|
====With amlodipine==== |
|
|
{{anchor|With amlodipine}} |
|
|
The Anglo-Scandinavian Cardiac Outcomes Trial-Blood Pressure Lowering Arm ('''ASCOT-BLA''') was a 2005 landmark trial that compared the effects of the established therapy of the combination of ] and ] to the new drug combination of ] and perindopril (trade names '''Viacoram''', '''AceryCal''' etc.).<ref>{{cite journal | vauthors = Dahlöf B, Sever PS, Poulter NR, Wedel H, Beevers DG, Caulfield M, Collins R, Kjeldsen SE, Kristinsson A, McInnes GT, Mehlsen J, Nieminen M, O'Brien E, Ostergren J | display-authors = 6 | title = Prevention of cardiovascular events with an antihypertensive regimen of amlodipine adding perindopril as required versus atenolol adding bendroflumethiazide as required, in the Anglo-Scandinavian Cardiac Outcomes Trial-Blood Pressure Lowering Arm (ASCOT-BPLA): a multicentre randomised controlled trial | journal = Lancet | volume = 366 | issue = 9489 | pages = 895–906 | date = September 2005 | pmid = 16154016 | doi = 10.1016/S0140-6736(05)67185-1 | s2cid = 26084146 }}</ref> The study of more than 19 000 patients world-wide was terminated earlier than anticipated because it clearly demonstrated a statistically significant improvement in mortality and cardiovascular outcomes with the newer treatment. The combination of amlodipine and perindopril remains in the current treatment guidelines for hypertension and the outcomes of the ASCOT-BLA trial paved the way for further research into combination therapy and newer agents.<ref>{{Cite web |title=Hypertension clinical information and guidelines |location=Australia |work=The Heart Foundation |url=https://www.heartfoundation.org.au/conditions/hypertension |access-date=2020-05-10 |archive-date=2020-05-14 |archive-url=https://web.archive.org/web/20200514021049/https://www.heartfoundation.org.au/conditions/hypertension |url-status=dead }}</ref> |
|
|
|
|
|
==Contraindications== |
|
|
*Children |
|
|
*] |
|
|
*] |
|
|
*Situations where a patient has a history of hypersensitivity |
|
|
*] |
|
|
|
|
|
==Precautions== |
|
|
*Assess ] function before and during treatment where appropriate. |
|
|
*] |
|
|
*Surgery/anesthesia |
|
|
*An analysis on the PROGRESS trial showed that perindopril has key benefits in reducing cardiovascular events by 30% in patients with chronic kidney disease defined as a CrCl <60ml/min.<ref>{{cite journal | vauthors = Perkovic V, Ninomiya T, Arima H, Gallagher M, Jardine M, Cass A, Neal B, Macmahon S, Chalmers J | display-authors = 6 | title = Chronic kidney disease, cardiovascular events, and the effects of perindopril-based blood pressure lowering: data from the PROGRESS study | journal = Journal of the American Society of Nephrology | volume = 18 | issue = 10 | pages = 2766–2772 | date = October 2007 | pmid = 17804673 | doi = 10.1681/ASN.2007020256 | doi-access = free }}</ref> A 2016 and 2017 meta-analysis review looking at ACE inhibitors demonstrated a reduction in cardiovascular events but also slowed the decline of renal failure by 39% when compared to placebo.<ref name=":0" /><ref>{{cite journal | vauthors = Liu Y, Ma X, Zheng J, Jia J, Yan T | title = Effects of angiotensin-converting enzyme inhibitors and angiotensin receptor blockers on cardiovascular events and residual renal function in dialysis patients: a meta-analysis of randomised controlled trials | journal = BMC Nephrology | volume = 18 | issue = 1 | pages = 206 | date = June 2017 | pmid = 28666408 | pmc = 5493067 | doi = 10.1186/s12882-017-0605-7 | doi-access = free }}</ref> These studies included patients with moderate to severe kidney disease and those on dialysis. |
|
|
*Its renoprotective benefits of decreasing blood pressure and removing filtration pressure is highlighted in a 2016 review.<ref name=":0">{{cite journal | vauthors = Xie X, Liu Y, Perkovic V, Li X, Ninomiya T, Hou W, Zhao N, Liu L, Lv J, Zhang H, Wang H | display-authors = 6 | title = Renin-Angiotensin System Inhibitors and Kidney and Cardiovascular Outcomes in Patients With CKD: A Bayesian Network Meta-analysis of Randomized Clinical Trials | journal = American Journal of Kidney Diseases | volume = 67 | issue = 5 | pages = 728–741 | date = May 2016 | pmid = 26597926 | doi = 10.1053/j.ajkd.2015.10.011 | doi-access = free }}</ref> ACE inhibitor can result in an initial increase of serum creatinine, but mostly returns to baseline in a few weeks in majority of patients.<ref>{{cite journal | vauthors = Garlo KG, Bates DW, Seger DL, Fiskio JM, Charytan DM | title = Association of Changes in Creatinine and Potassium Levels After Initiation of Renin Angiotensin Aldosterone System Inhibitors With Emergency Department Visits, Hospitalizations, and Mortality in Individuals With Chronic Kidney Disease | journal = JAMA Network Open | volume = 1 | issue = 7 | pages = e183874 | date = November 2018 | pmid = 30646338 | pmc = 6324397 | doi = 10.1001/jamanetworkopen.2018.3874 }}</ref> It has been suggested that increased monitoring, especially in advanced kidney failure, will minimise any related risk and improve long-term benefits.<ref>{{cite journal | vauthors = Ohkuma T, Jun M, Rodgers A, Cooper ME, Glasziou P, Hamet P, Harrap S, Mancia G, Marre M, Neal B, Perkovic V, Poulter N, Williams B, Zoungas S, Chalmers J, Woodward M | display-authors = 6 | title = Acute Increases in Serum Creatinine After Starting Angiotensin-Converting Enzyme Inhibitor-Based Therapy and Effects of its Continuation on Major Clinical Outcomes in Type 2 Diabetes Mellitus | journal = Hypertension | volume = 73 | issue = 1 | pages = 84–91 | date = January 2019 | pmid = 30571562 | doi = 10.1161/HYPERTENSIONAHA.118.12060 | hdl-access = free | s2cid = 58547523 | hdl = 10044/1/66141 }}</ref> |
|
|
*Use cautiously in patients with sodium or volume depletion due to potential excessive hypotensive effects of ] blockade causing symptomatic ].<ref name="amh"/> Careful monitoring or short-term dose reduction of diuretics prior to commencing perindopril is recommended to prevent this potential effect.<ref name="amh"/> A diuretic may later be given in combination if necessary; potassium-sparing diuretics are not recommended in combination with perindopril due to the risk of ].<ref name="amh"/> |
|
|
*Combination with ]s or imipramine-type drugs may increase the blood pressure lowering effect. Serum ] concentrations may rise during lithium therapy. |
|
|
|
|
|
==Side effects== |
|
|
Side effects are mild, usually at the start of treatment; they include: |
|
|
*Cough |
|
|
*Fatigue |
|
|
*Weakness/] |
|
|
*Headache |
|
|
*Disturbances of mood and/or sleep |
|
|
|
|
|
Less often |
|
|
*Taste impairment |
|
|
*] discomfort |
|
|
*Nausea |
|
|
*Abdominal pain |
|
|
*Rash |
|
|
|
|
|
Reversible increases in blood ] and ] may be observed. ] has occurred in some patients. Rarely, angioneurotic ] and decreases in ], red cells, and ] have been reported. |
|
|
|
|
|
==Composition== |
|
|
Each tablet contains 2, 4, or 8 mg of the tert-butylamine salt of perindopril. Perindopril is also available under the trade name ], containing 4 mg of perindopril combined with 1.25 mg ], a ]. |
|
|
|
|
|
In Australia, each tablet contains 2.5, 5, or 10 mg of perindopril arginine. Perindopril is also available under the trade name Coversyl Plus, containing 5 mg of perindopril arginine combined with 1.25 mg indapamide and ], containing 2.5 mg of perindopril arginine combined with 0.625 mg indapamide. |
|
|
|
|
|
The efficacy and tolerability of a fixed-dose combination of 4 mg perindopril and 5 mg ], a calcium channel antagonist, has been confirmed in a prospective, observational multicenter trial of 1,250 hypertensive patients.<ref name="test">Bahl VK, Jadhav UM, Thacker HP. Management of Hypertension with the Fixed Combination of Perindopril and Amlodipine in Daily Clinical Practice: Results from the STRONG Prospective, Observational, Multicenter Study. ''American Journal of Cardiovascular Drugs'' May 22, 2009; '''9''' (3): 135-42 {{Webarchive|url=https://web.archive.org/web/20110707090029/http://adisonline.com/cardiovascular/pages/articleviewer.aspx?year=2009&issue=09030&article=00001&type=abstract |date=2011-07-07 }}</ref> A preparation of the two drugs is available commercially as Coveram. |
|
|
|
|
|
==Society and culture== |
|
|
===Brand names=== |
|
|
Perindopril is available under the following brand names among others: |
|
|
{{columns-list|colwidth=10em| |
|
|
*Acertil |
|
|
*Actiprex |
|
|
*Armix |
|
|
*Idaprex |
|
|
*Coverene |
|
|
*Coverex |
|
|
*Coversum |
|
|
*Coversyl |
|
|
*Covinace |
|
|
*Indapril |
|
|
*Perindo |
|
|
*Perineva |
|
|
*Prenessa |
|
|
*Prestarium |
|
|
*Preterax |
|
|
*Prexanil |
|
|
*Prexum |
|
|
*Procaptan |
|
|
*Provinace |
|
|
*Pericard |
|
|
*Percarnil |
|
|
*Perindal |
|
|
*Repres |
|
|
*Relika |
|
|
}} |
|
|
|
|
|
===Marketing=== |
|
|
In July 2014, the ] imposed fines of {{Euro|427,700,000}} on ] and five companies which produce generics due to Servier's abuse of their dominant market position, in breach of European Union Competition law. Servier's strategy included acquiring the principal source of generic production of perindopril and entering into several pay-for-delay agreements with potential generic competitors.<ref>{{Cite web|url=https://europa.eu/rapid/press-release_IP-14-799_en.htm| work = European Commission | title = Antitrust: Commission fines Servier and five generic companies for curbing entry of cheaper versions of cardiovascular medicine | date = 9 July 2014 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== Further reading == |
|
|
{{refbegin}} |
|
|
* {{cite journal | vauthors = Wang JG, Pimenta E, Chwallek F | title = Comparative review of the blood pressure-lowering and cardiovascular benefits of telmisartan and perindopril | journal = Vascular Health and Risk Management | volume = 10 | pages = 189–200 | date = 2014 | pmid = 24741317 | pmc = 3983078 | doi = 10.2147/VHRM.S59429 | doi-access = free }} |
|
|
* {{cite journal | vauthors = Shirley M, McCormack PL | title = Perindopril/amlodipine (Prestalia(®)): a review in hypertension | journal = American Journal of Cardiovascular Drugs | volume = 15 | issue = 5 | pages = 363–370 | date = October 2015 | pmid = 26341621 | doi = 10.1007/s40256-015-0144-1 | s2cid = 40807688 }} |
|
|
* {{cite journal | vauthors = Bertrand ME, Vlachopoulos C, Mourad JJ | title = Triple Combination Therapy for Global Cardiovascular Risk: Atorvastatin, Perindopril, and Amlodipine | journal = American Journal of Cardiovascular Drugs | volume = 16 | issue = 4 | pages = 241–253 | date = August 2016 | pmid = 27256435 | doi = 10.1007/s40256-016-0175-2 | s2cid = 13318472 }} |
|
|
* {{cite journal | vauthors = Ancion A, Tridetti J, Nguyen Trung ML, Oury C, Lancellotti P | title = A Review of the Role of Bradykinin and Nitric Oxide in the Cardioprotective Action of Angiotensin-Converting Enzyme Inhibitors: Focus on Perindopril | journal = Cardiology and Therapy | volume = 8 | issue = 2 | pages = 179–191 | date = December 2019 | pmid = 31578675 | pmc = 6828891 | doi = 10.1007/s40119-019-00150-w }} |
|
|
{{refend}} |
|
|
|
|
|
== External links == |
|
|
{{Commons category-inline}} |
|
|
|
|
|
{{ACE inhibitors}} |
|
|
{{Angiotensin receptor modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |