| Revision as of 08:31, 30 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 17:51, 12 December 2021 edit undoDePiep (talk | contribs)Extended confirmed users294,285 editsm GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr)Tag: AWB |
| (29 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 440974561 |
|
| verifiedrevid = 442172331 |
|
| Name = Phyllodulcin |
|
| Name = Phyllodulcin |
|
| ImageFile = Phyllodulcin.png |
|
| ImageFile = Phyllodulcin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of phyllodulcin |
|
| ImageName = Chemical structure of phyllodulcin |
|
| ImageAlt = Chemical structure of hyllodulcin |
|
| ImageAlt = Chemical structure of hyllodulcin |
|
| IUPACName = (3R)-8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydroisochromen-1-one |
|
| PIN = (3''R'')-8-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)-3,4-dihydro-1''H''-2-benzopyran-1-one |
|
| OtherNames = Praeruptorin<!-- <br> --> |
|
| OtherNames = Praeruptorin<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 21499-23-0 |
|
| CASNo = 21499-23-0 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = 9DDW04R41V |
|
| PubChem = 146694 |
|
| PubChem = 146694 |
|
|
| ChemSpiderID = 129391 |
|
| SMILES = COC1=C(C=C(C=C1)C2CC3=C(C(=CC=C3)O)C(=O)O2)O |
|
|
|
| SMILES = COc1ccc(cc1O)2Cc3cccc(c3C(=O)O2)O |
|
| InChI = |
|
|
|
| StdInChI = 1S/C16H14O5/c1-20-13-6-5-9(7-12(13)18)14-8-10-3-2-4-11(17)15(10)16(19)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m1/s1 |
|
|
| StdInChIKey = PBILBHLAPJTJOT-CQSZACIVSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>5</sub> |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>5</sub> |
|
| MolarMass = 286.27 g/mol |
|
| MolarMass = 286.27 g/mol |
|
| ExactMass = 286.084124 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Phyllodulcin''' is an ] found in '']''<ref>Effects of phyllodulcin, ], and their 8-O-glucosides, and ] and ] from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no8, pp. 870-872, {{INIST|1959604}}</ref> and '']''.<ref>Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume 37, Number 2, pp. 249-257, {{doi|10.1007/BF02515827}}</ref> |
|
'''Phyllodulcin''' is a ] found in '']''<ref>Effects of phyllodulcin, ], and their 8-O-glucosides, and ] and ] from Hydrangea macrophylla SERINGE var. thunbergii MAKINO on passive cutaneous anaphylaxis reaction in rats. Matsuda H., Shimoda H., Yamahara J. and Yoshikawa M., Biological & pharmaceutical bulletin, 1999, vol. 22, no. 8, pp. 870–872, {{INIST|1959604}}.</ref> and '']''.<ref>Accumulation of phyllodulcin in sweet-leaf plants of Hydrangea serrata and its neutrality in the defence against a specialist leafmining herbivore. Mami Ujihara, Masateru Shinozaki and Makoto Kato, Researches on population ecology, Volume 37, Number 2, pp. 249–257, {{doi|10.1007/BF02515827}}.</ref> It is a ] 400–800 times sweeter than sugar.<ref name=Tomasik-2003>Chemical and Functional Properties of Food Saccharides. P. Tomasik, CRC Press, Boca Raton, 2003, {{ISBN|978-0-8493-1486-5}}.</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commons category-inline}} |
|
|
|
|
|
{{Isocoumarin}} |
|
{{Isocoumarin}} |
|
|
{{Food Substitutes}} |
|
|
|
|
⚫ |
] |
|
|
] |
|
|
] |
|
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |