| Revision as of 13:16, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChIKey').← Previous edit |
Latest revision as of 13:31, 2 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,622 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (23 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Wikify|date=December 2010}} |
|
|
|
{{Drugbox |
|
⚫ |
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444056288 |
|
⚫ |
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate |
|
⚫ |
| image = Piprozolin.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
{{unreferenced|date=December 2010}} |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
{{drugbox |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| Verifiedfields = changed |
|
|
⚫ |
| protein_bound = |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| metabolism = |
| ⚫ |
| UNII = 7786W0VV8M |
|
|
⚫ |
| elimination_half-life = |
| ⚫ |
| verifiedrevid = 403953636 |
|
|
⚫ |
| excretion = |
| ⚫ |
| IUPAC_name = Ethyl (2''Z'')-2-(3-ethyl-4-oxo-5-piperidin-1-yl-1,3-thiazolidin-2-ylidene)acetate |
|
|
|
|
| ⚫ |
| image = Piprozolin.png |
|
|
|
<!--Identifiers--> |
|
| CAS_number = 17243-64-0 |
|
| CAS_number = 17243-64-0 |
|
| ATC_prefix = A05 |
|
| ATC_prefix = A05 |
|
| ATC_suffix = AX01 |
|
| ATC_suffix = AX01 |
|
| PubChem = 5911905 |
|
|
| CASNo = 63250-48-6 |
|
| PubChem = 5911905 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChEMBL = 2105231 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4744588 |
|
| ChemSpiderID = 4744588 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| StdInChIKey = UAXYBJSAPFTPNB-KHPPLWFESA-N |
|
|
⚫ |
| UNII = 7786W0VV8M |
|
| SMILES = O=C(OCC)\C=C1/SC(C(=O)N1CC)N2CCCCC2 |
|
|
|
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=14 | H=22 | N=2 | O=3 | S=1 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10- |
|
| StdInChI = 1S/C14H22N2O3S/c1-3-16-11(10-12(17)19-4-2)20-14(13(16)18)15-8-6-5-7-9-15/h10,14H,3-9H2,1-2H3/b11-10- |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| DrugBank = |
|
|
⚫ |
| StdInChIKey = UAXYBJSAPFTPNB-KHPPLWFESA-N |
| ⚫ |
| C=14|H=22|N=2|O=3|S=1 |
|
|
| molecular_weight = 298.40 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Piprozolin''' (or '''piprozoline''') is a ] for ] therapy.<ref>{{cite journal | vauthors = Koss FW, Vollmer KO, Herrmann M | title = | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 198 | issue = 2 | pages = 333–46 | date = August 1972 | pmid = 5074733 }}</ref><ref>{{cite web | work = Drugs-about.com | url = http://drugs-about.com/ing/piprozolin.html | title = Piprozolin }}</ref> |
|
'''Piprozolin''' (or '''piprozoline''') is a molecule used in ] therapy. |
|
|
|
|
|
|
==Synthesis== |
|
|
Compared to ], piprozolin shows ] rather than anti-inflammatory activity. That is, the compound is useful in those conditions where the flow of bile is to be increased. |
|
|
] | gdate = 1976}}</ref>]] |
|
|
Condensation of ] with ] leads to ] ('''4'''); an intermediate such as '''3''', involving addition of the ] to the nitrile function can reasonably be invoked. M/ethylation with di(m)] proceeds on nitrogen with the concomitant shift of the enamine to afford olefin ('''5'''). Bromination of the active ] ('''6''') followed by displacement of halogen by piperidine affords the ] piprozolin ('''7'''). |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Bile and liver therapy}} |
|
{{Bile and liver therapy}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{gastrointestinal-drug-stub}} |
|
{{gastrointestinal-drug-stub}} |