Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Plicatin B: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 10:39, 18 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 448831333 of page Plicatin_B for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').  Latest revision as of 20:01, 20 December 2023 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Vinylogous carboxylic acids using HotCat 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 448829566
| Watchedfields = changed
| verifiedrevid = 477512114
| Name = Plicatin B | Name = Plicatin B
| ImageFile = Plicatin B.svg | ImageFile = Plicatin B.svg
Line 7: Line 8:
| ImageName = Chemical structure of plicatin B | ImageName = Chemical structure of plicatin B
| ImageAlt = Chemical structure of plicatin B | ImageAlt = Chemical structure of plicatin B
| IUPACName = methyl (''E'')-3-prop-2-enoate | PIN = Methyl (2''E'')-3-prop-2-enoate
| OtherNames = <!-- <br> --> | OtherNames = <!-- <br> -->
|Section1= {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo = <!-- blanked - oldvalue: 72704-01-9 --> | CASNo = 72704-01-9
| CASNo_Ref = | CASNo_Ref = {{cascite|changed|??}}=
| CASOther = | CASNoOther =
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 451699 | ChEMBL = 451699
| PubChem = 6438704 | PubChem = 6438704
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4943161 | ChemSpiderID = 4943161
| SMILES = O=C(OC)\C=C\c1ccc(O)c(c1)C/C=C(\C)C | SMILES = O=C(OC)\C=C\c1ccc(O)c(c1)C/C=C(\C)C
| InChI = 1/C15H18O3/c1-11(2)4-7-13-10-12(5-8-14(13)16)6-9-15(17)18-3/h4-6,8-10,16H,7H2,1-3H3/b9-6+ | InChI = 1/C15H18O3/c1-11(2)4-7-13-10-12(5-8-14(13)16)6-9-15(17)18-3/h4-6,8-10,16H,7H2,1-3H3/b9-6+
| InChIKey = LZEOAWXRNGQEHO-RMKNXTFCBP | InChIKey = LZEOAWXRNGQEHO-RMKNXTFCBP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H18O3/c1-11(2)4-7-13-10-12(5-8-14(13)16)6-9-15(17)18-3/h4-6,8-10,16H,7H2,1-3H3/b9-6+ | StdInChI = 1S/C15H18O3/c1-11(2)4-7-13-10-12(5-8-14(13)16)6-9-15(17)18-3/h4-6,8-10,16H,7H2,1-3H3/b9-6+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LZEOAWXRNGQEHO-RMKNXTFCSA-N | StdInChIKey = LZEOAWXRNGQEHO-RMKNXTFCSA-N
| MeSHName = | MeSHName =
}} }}
|Section2= {{Chembox Properties |Section2={{Chembox Properties
| Formula = C<sub>15</sub>H<sub>18</sub>O<sub>3</sub> | Formula = C<sub>15</sub>H<sub>18</sub>O<sub>3</sub>
| MolarMass = 246.30 g/mol | MolarMass = 246.30 g/mol
| ExactMass = 246.125594 u
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = <!-- °C --> | MeltingPt =
| BoilingPt = <!-- °C --> | BoilingPt =
| Solubility = | Solubility =
}} }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
}}
}} }}
}}
'''Plicatin B''' is a ] found in '']''.<ref>Plicatin A and B, two phenolic cinnamates from Psoralea plicata. Nazli Rasool, Abdul Qasim Khan and Abdul Malik, Phytochemistry, Volume 29, Issue 12, 1990, Pages 3979-3981, {{doi|10.1016/0031-9422(90)85385-S}}</ref>

==References==
{{Reflist}}

{{Hydroxycinnamic acid}}

]


{{aromatic-stub}}