| Revision as of 20:21, 5 February 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:37, 23 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenol ethers; added Category:4-Methoxyphenyl compounds using HotCat |
| (27 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{one source|date=October 2014}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 406623532 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Poncirin |
|
|
⚫ |
| verifiedrevid = 412210452 |
|
| ImageFile = Poncirin.svg |
|
|
| ImageSize = 300px |
|
| Name = Poncirin |
|
| ImageName = Poncirin |
|
| ImageFile = Poncirin.svg |
|
|
| ImageSize = 300px |
|
| IUPACName = <nowiki>(2S)-7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4, |
|
|
⚫ |
| ImageName = Poncirin |
|
5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one</nowiki> |
|
|
|
| IUPACName = (2''S'')-5-Hydroxy-4′-methoxy-7-flavan-4-one |
| ⚫ |
| OtherNames = Isosakuranetin-7-neohesperidoside |
|
|
|
| SystematicName = (2''S'')-7-{oxy}oxan-2-yl]oxy}-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-4''H''-1-benzopyran-4-one |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = Isosakuranetin-7-neohesperidoside |
|
| CASNo = 14941-08-3 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| EINECS = |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| SMILES = CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
|
|
| PubChem = 442456 |
|
| CASNo = 14941-08-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8MUY4P95B4 |
|
⚫ |
| EINECS = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 66773 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 451050 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 390894 |
|
⚫ |
| SMILES = C1((((O1)O2(((O2OC3=CC(=C4C(=O)C(OC4=C3)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
|
|
| InChI = 1/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
|
|
| InChIKey = NLAWPKPYBMEWIR-SKYQDXIQBA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NLAWPKPYBMEWIR-SKYQDXIQSA-N |
|
|
| PubChem = 442456 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=28 | H=34 | O=14 |
|
| Formula = C<sub>28</sub>H<sub>34</sub>O<sub>14</sub> |
|
|
⚫ |
| MeltingPt = <!-- °C --> |
|
| MolarMass = 594.56 g/mol |
|
|
⚫ |
| Solvent = |
|
| ExactMass = 594.194856 |
|
|
⚫ |
| SolubleOther = |
| ⚫ |
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| Solvent = |
|
| ⚫ |
| SolubleOther = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Poncirin''' is the 7-O-] of ]. Poncirin can be extracted from ] (''Poncirus trifoliata'')<ref>. |
|
'''Poncirin''' is the 7-''O''-] of ]. Poncirin can be extracted from ] (''Poncirus trifoliata'').<ref>{{cite journal | doi = 10.1248/bpb.22.422 | title = Anti-Helicobacter pylori Activity of the Metabolites of Poncirin from Poncirus trifoliata by Human Intestinal Bacteria | date = 1999 | last1 = Kim | first1 = Dong-Hyun | last2 = Bae | first2 = Eun-Ah | last3 = Han | first3 = Myung Joo | journal = Biological and Pharmaceutical Bulletin | volume = 22 | issue = 4 | pages = 422–424 | pmid = 10328566 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
*{{Commonscat-inline}} |
|
|
|
|
|
{{Flavanone}} |
|
{{Flavanone}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
| ⚫ |
{{polyphenol-stub}} |
|
|
|
|
|
|
⚫ |
{{Aromatic-stub}} |
|
] |
|