| Revision as of 14:10, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,055 edits Saving copy of the {{chembox}} taken from revid 444065253 of page Pregnane for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 15:25, 22 April 2024 edit Tarlby (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers5,386 edits Added {{No footnotes}} tag: Ton of external links, one inline citationTag: Twinkle |
| Line 1: |
Line 1: |
|
|
{{No footnotes|date=April 2024}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444063593 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Pregnane.svg |
|
|
⚫ |
| verifiedrevid = 464213607 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile=Pregnane.svg |
|
|IUPACName=(8''S'',9''S'',10''S'',13''R'',14''S'',17''S'')-17-ethyl-<br>10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,<br>14,15,16,17-tetradecahydro-1''H''-<br>cyclopentaphenanthrene |
|
|
⚫ |
| ImageSize= |
| ⚫ |
|OtherNames= |
|
|
|
| ImageAlt=Skeletal formula of pregnane |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1=Pregnane 3D ball.png |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| ImageAlt1=Ball-and-stick model of the pregnane molecule |
|
|
| IUPACName=5ξ-Pregnane<ref>{{cite book |author=] |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=] |pages=1530 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}</ref> |
|
|
| SystematicName=(1''S'',3a''S'',3b''S'',5a''Ξ'',9a''S'',9b''S'',11a''R'')-1-Ethyl-9a,11a-dimethylhexadecahydro-1''H''-cyclopentaphenanthrene |
|
⚫ |
| OtherNames= |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5256760 |
|
| ChemSpiderID = 5256760 |
|
| InChI = 1/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3/t15-,16?,17-,18-,19-,20-,21+/m0/s1 |
|
| InChI = 1/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3/t15-,16?,17-,18-,19-,20-,21+/m0/s1 |
| Line 15: |
Line 21: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JWMFYGXQPXQEEM-WZBAXQLOSA-N |
|
| StdInChIKey = JWMFYGXQPXQEEM-WZBAXQLOSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 24909-91-9 --> |
|
|
|
| CASNo = 481-26-5 |
| ⚫ |
| PubChem=6857422 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 10Z78HHV4C |
|
⚫ |
| PubChem=6857422 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8386 |
|
| ChEBI = 8386 |
|
| SMILES = C41CCCC1(3(2CC(2(C)CC3)CC)CC4)C |
|
| SMILES = C41CCCC1(3(2CC(2(C)CC3)CC)CC4)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>21</sub>H<sub>36</sub> |
|
| Formula=C<sub>21</sub>H<sub>36</sub> |
|
| MolarMass=288.511 g/mol |
|
| MolarMass=288.511 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density=0.926 g/ml |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Pregnane''', also known as '''17β-ethylandrostane''' or as '''10β,13β-dimethyl-17β-ethylgonane''', is a C21 ] and, indirectly, a ] of ]. It is a parent ] for two series of steroids stemming from ] (originally ]) and ] (17β-ethyl]). It has a ] core. |
|
|
|
|
|
5β-Pregnane is the parent of ]s, ]s, and ]s, and is found largely in ] as a ] product of 5β-pregnane ]s. |
|
|
|
|
|
==Pregnanes== |
|
|
] nomenclature: Pregnanes have carbons 1 through 21.]] |
|
|
|
|
|
'''Pregnanes''' are ] derivatives with carbons present at positions 1 through 21. |
|
|
|
|
|
Most biologically significant pregnane derivatives fall into one of two groups: ]s and ]s. Another class is ]s. |
|
|
|
|
|
==Pregnenes== |
|
|
{{main|Pregnene}} |
|
|
]]] |
|
|
|
|
|
Pregnenes have a ]. Examples include: |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==Pregnadienes== |
|
|
{{main|Pregnadiene}} |
|
|
]]] |
|
|
|
|
|
Pregnadienes have two ]s. Examples include: |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
==External links== |
|
|
* {{Commonscatinline}} |
|
|
* {{MeshName|Pregnanes}} |
|
|
* |
|
|
* |
|
|
* |
|
|
* |
|
|
* |
|
|
|
|
|
{{Steroid classification}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{steroid-stub}} |