| Revision as of 13:19, 18 June 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: pl:Prymulina← Previous edit |
Latest revision as of 12:22, 17 April 2024 edit undoEmmanuel.boutet (talk | contribs)11 editsmNo edit summary |
| (21 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 400999571 |
|
| verifiedrevid = 434929161 |
|
| name = Primulin |
|
| Name = Primulin |
|
| ImageFile = Malvidin 3-galactoside.svg |
|
| ImageFile = Malvidin 3-galactoside.svg |
|
| ImageSize = 300px |
|
| ImageSize = 300px |
|
| IUPACName = (2''S'',3''R'',4''S'',5''R'',6''R'')-2-oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride |
|
| IUPACName = (2''S'',3''R'',4''S'',5''R'',6''R'')-2-oxy-6-(hydroxymethyl)oxane-3,4,5-triol chloride |
|
| OtherNames = Malvidin 3-galactoside<br>Malvidin-3-galactoside chloride<br>Malvidin-3-O-galactoside<br>Malvidin-3-O-galactoside chloride<br>3-(Galactosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride<br>Primulin Yellow<ref></ref> |
|
| OtherNames = Malvidin 3-galactoside<br>Malvidin-3-galactoside chloride<br>Malvidin-3-O-galactoside<br>Malvidin-3-O-galactoside chloride<br>3-(Galactosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-1-benzopyrylium chloride<br>Primulin Yellow<ref></ref> |
|
| Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 30113-37-2 |
|
|
| PubChem = 94409 |
|
| CASNo = 30113-37-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = COC1=CC(=CC(=C1O)OC)C2=C(C=C3C(=CC(=CC3=2)O)O)OC4C(C(C(C(O4)CO)O)O)O. |
|
|
|
| UNII = MB4022065G |
|
|
| PubChem = 94409 |
|
|
| ChemSpiderID = 85201 |
|
⚫ |
| SMILES = COc1cc(cc(c1O)OC)c2c(cc3c(cc(cc32)O)O)O4((((O4)CO)O)O)O |
|
|
| InChI = 1/C23H24O12/c1-31-14-3-9(4-15(32-2)18(14)27)22-16(7-11-12(26)5-10(25)6-13(11)33-22)34-23-21(30)20(29)19(28)17(8-24)35-23/h3-7,17,19-21,23-24,28-30H,8H2,1-2H3,(H2-,25,26,27)/p+1/t17-,19+,20+,21-,23-/m1/s1 |
|
|
| InChIKey = PXUQTDZNOHRWLI-IRUYQYSKBI |
|
|
| StdInChI = 1S/C23H24O12/c1-31-14-3-9(4-15(32-2)18(14)27)22-16(7-11-12(26)5-10(25)6-13(11)33-22)34-23-21(30)20(29)19(28)17(8-24)35-23/h3-7,17,19-21,23-24,28-30H,8H2,1-2H3,(H2-,25,26,27)/p+1/t17-,19+,20+,21-,23-/m1/s1 |
|
|
| StdInChIKey = PXUQTDZNOHRWLI-XSEKTIEYSA-O |
|
|
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>23</sub>H<sub>25</sub>ClO<sub>12</sub><br>C<sub>23</sub>H<sub>25</sub>O<sub>12</sub><sup>+</sup> |
|
| Formula=C<sub>23</sub>H<sub>25</sub>ClO<sub>12</sub><br>C<sub>23</sub>H<sub>25</sub>O<sub>12</sub><sup>+</sup> |
|
| MolarMass = 528.89 g/mol (chloride)<br>493.43 g/mol |
|
| MolarMass = 528.89 g/mol (chloride)<br>493.43 g/mol |
|
|
| Appearance = |
|
| ExactMass = 528.103454 u (chloride)<br>493.13460119 u |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Primulin''' is an ]. It is the 3-] of ]. It can be found in '']''<ref>. |
|
'''Primulin''' is an ]. It is the 3-] of ]. It can be found in '']''.<ref>{{cite journal |url=http://www.biochemj.org/bj/078/0298/0780298.pdf |title=Plant Polyphenols: 3. Flavonoids in genotypes of ''Primula sinensis'' |author=J. B. Harborne |author2=H. S. A. Sherratt |journal=Biochem. J. |volume=78 |issue= 2|year= 1961 |pages=298–306|doi=10.1042/bj0780298 |pmid=13711452 |pmc=1205266 }}</ref> |
|
|
|
|
|
|
The first crystalline form of this pigment was prepared by ] in about 1930. This was the first crystalline anthocyanin pigment ever identified. This was possible because of her insight into linking genetics with chemistry.<ref>, Cathie Martin, April 2016, Biochemical classics, Biochemist.org, Retrieved 5 July 2016</ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Anthocyanins}} |
|
{{Anthocyanins}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
|
|
|
|
{{Aromatic-stub}} |
|
] |
|